[Monosaccharide] D-Ribulose 5-phosphate sodium [AAA09387][CAS no. 93-87-8(free acid)]_Biosynth - 코아사이언스

 

D-Ribulose 5-phosphate sodium

Cat.# AAA09387 / Size: 1mg, 2mg, 5mg, 10mg, 25mg

Specification / MSDS

Ribulose 5-phosphate sodium is a chemical that can be used to inhibit the enzyme ribulose phosphate reductase. Ribulose 5-phosphate sodium has been shown to inhibit glycolaldehyde production in the chloroplasts of plants, effectively reducing the amount of carbon dioxide produced. This chemical has also been shown to have an inhibitory effect on other enzymes involved in carbon fixation and assimilation. The effectiveness of this chemical is dependent on the specific plant species and environmental conditions.

​

CAS No: [93-87-8(free acid)]

MDL No: MFCD00056674

MOL file: Download

Chemical Formula: C5H11O8P•Nax

Molecular Weight: 230.11 g/mol

Smiles: C(C(C(C(=O)CO)O)O)OP(=O)(O)O

Boiling Point: 539.90 °C

Flash Point: 280.30 °C

​

 

* 본 상품은 오직 연구용으로만 사용 가능합니다. 인체 및 제품화에 사용하실 수 없습니다.

 

코아사이언스 coresciences​ Biosynth Carbosynth limited UK Korea 한국 대리점