티스토리 뷰
ELISA,항체,단백질
FineTest ELISA kit Product List #5_Wuhan Fine Biological Technology Korea - 코아사이언스
코피디 2016. 6. 28. 18:12FineTest ELISA kit Product List #5
| Species | Cat. No. | Full name | Short name | Size | Alias |
| Human | EH2138 | Human DDAH2(N(G),N(G)-dimethylarginine dimethylaminohydrolase 2) | DDAH2 | 96T | DDAH2/DDAH/DDAHII/G6a/NG30/S-phase protein/Protein G6a/DDAHII/Dimethylargininase-2 |
| Human | EH2139 | Human HIG2(Hypoxia-inducible gene 2 protein) | HIG2 | 96T | HIG2/C7orf68/FLJ21076/HIG-2/HIG2. |
| Human | EH2140 | Human NES(Nestin) | NES | 96T | NES/FLJ21841/nestin |
| Human | EH2141 | Human SYP(Synaptophysin) | SYP | 96T | SYP/Major synaptic vesicle protein p38/SYP/Major synaptic vesicle protein p38/MRX/MRXSYP/synaptophysin |
| Human | EH2142 | Human BST1(ADP-ribosyl cyclase 2) | BST1 | 96T | BST1/CD157/ADP-ribosyl cyclase 2/Cyclic ADP-ribose hydrolase 2/BP-3/BST1/cADPr hydrolase 2/CD157/ADP-ribosyl cyclase 2/Bone marrow stromal antigen 1/bone marrow stromal cell antigen 1/BST-1/cADPr hydrolase 2/CD157/CD157 antigen/Cyclic ADP-ribose hydrolase 2/NAD(+) nucleosidase |
| Human | EH2143 | Human PIICP(C-terminal propeptide of Collagen alpha-1(II) chain) | PIICP | 96T | PIICP/Chondrocalcin |
| Human | EH2144 | Human PIINP(N-terminal propeptide of Collagen alpha-1(II) chain) | PIINP | 96T | PIINP |
| Human | EH2145 | Human DCP(Des-gamma carboxyprothrombin) | DCP | 96T | DCP |
| Human | EH2146 | Human WNT3A(Protein Wnt-3a) | WNT3A | 96T | WNT3A/MGC119418/MGC119419/MGC119420/protein Wnt-3a/wingless-type MMTV integration site family, member 3A |
| Human | EH2147 | Human SMAD2(Mothers against decapentaplegic homolog 2) | SMAD2 | 96T | SMAD2/JV18/MADH2/MADR2/JV18-1/hMAD-2/hSMAD2/SMAD family member 2(SMAD 2/Smad2/hSMAD2)/JV18-1/Mad-related protein 2(hMAD-2)/ |
| Human | EH2148 | Human Smad3/MADH3 (Mothers Against Decapentaplegic Homolog 3) | Smad3/MADH3 | 96T | Smad3/MADH3/JV15-2/SMAD family member 3/hMAD-3/hSMAD3/MAD homolog 3/mad protein homolog/MAD, mothers against decapentaplegic homolog 3/MAD, mothers against decapentaplegic homolog 3(Drosophila)/mad3/Mad3/MADH3mad homolog JV15-2/mothers against decapentaplegic homolog 3/Mothers against DPP homolog 3/SMA- and MAD-related protein 3/SMAD family member 3HSPC193/SMAD, mothers against DPP homolog 3/SMAD, mothers against DPP homolog 3(Drosophila)/Smad3 |
| Human | EH2149 | Human PPRC1(Peroxisome proliferator-activated receptor gamma coactivator-related protein 1) | PPRC1 | 96T | PPRC1/PGC-1-related coactivator(PRC) |
| Human | EH2150 | Human CD24(Signal transducer CD24) | CD24 | 96T | CD24/CD24A/FLJ22950/FLJ43543/MGC75043/Small cell lung carcinoma cluster 4 antigen/CD24A/CD24 antigen/CD24 antigen(small cell lung carcinoma cluster 4 antigen)/CD24 molecule/CD24Asignal transducer CD24/Small cell lung carcinoma cluster 4 antigen |
| Human | EH2151 | Human RPESP(RPE-spondin) | RPESP | 96T | RPESP/C8orf84/FLJ40021 |
| Human | EH2152 | Human SEMA3G(Semaphorin-3G) | SEMA3G | 96T | SEMA3G/sem2/Semaphorin sem2 |
| Human | EH2153 | Human ZG16B(Zymogen granule protein 16 homolog B) | ZG16B | 96T | ZG16B/EECP/HRPE773/JCLN2/ZG16B/hTrabid/TRABIDubiquitin thioesterase ZRANB1/TRAF-binding protein domain/Zinc finger Ran-binding domain-containing protein 1/zinc finger, RAN-binding domain containing 1 |
| Human | EH2154 | Human ZG16(Zymogen granule membrane protein 16) | ZG16 | 96T | ZG16(Zymogen granule membrane protein 16)/Secretory lectin ZG16/Zymogen granule protein 16/hZG16 |
| Human | EH2155 | Human LDHA(L-lactate dehydrogenase A chain) | LDHA | 96T | LDHA( L-lactate dehydrogenase A chain)/LDH1/LDHM/Cell proliferation-inducing gene 19 protein/lactate dehydrogenase A/lactate dehydrogenase M/LDH muscle subunit/LDH-A/LDH-M/proliferation-inducing gene 19/Renal carcinoma antigen NY-REN-59 |
| Human | EH2156 | Human LDHC(L-lactate dehydrogenase C chain) | LDHC | 96T | LDHC(L-lactate dehydrogenase C chain)/LDH-X/Cancer,testis antigen 32(CT32)/LDH testis subunit |
| Human | EH2157 | Human UCN(Urocortin) | UCN | 96T | UCN(Urocortin)/UI/UROC/urocortin, preproprotein/UROCUI |
| Human | EH2158 | Human SOD3(Extracellular superoxide dismutase [Cu-Zn]) | SOD3 | 96T | SOD3(Extracellular superoxide dismutase [Cu-Zn])/EC-SOD/extracellular superoxide dismutase [Cu-Zn]/superoxide dismutase 3, extracellular |
| Human | EH2159 | Human GP6(Platelet glycoprotein VI) | GP6 | 96T | GP6/Glycoprotein 6/glycoprotein VI(platelet)/GPIV/GPVIplatelet collagen receptor/platelet glycoprotein VI |
| Human | EH2160 | Human LPCAT3(Lysophospholipid acyltransferase 5) | LPCAT3 | 96T | LPCAT3(Lysophospholipid acyltransferase 5) |
| Human | EH2161 | Human OXM(Oxyntomodulin) | OXM | 96T | OXM(Oxyntomodulin) |
| Human | EH2162 | Human AQP9(Aquaporin-9) | AQP9 | 96T | AQP9(Aquaporin-9)/Aquaglyceroporin-9/Small solute channel 1 |
| Human | EH2163 | Human SOD2(Superoxide dismutase [Mn], mitochondrial) | SOD2 | 96T | SOD2(Superoxide dismutase [Mn], mitochondrial)/IPO-B/Mn SOD/SOD, Mitochodrial/indophenoloxidase B/IPOB/manganese-containing superoxide dismutase/mangano-superoxide dismutase/Mn superoxide dismutase/MNSOD/MVCD6/superoxide dismutase [Mn], mitochondrial/superoxide dismutase 2, mitochondrial |
| Human | EH2164 | Human AKR1B1(Aldose reductase) | AKR1B1 | 96T | AKR1B1(Aldose reductase)/Aldo-keto reductase family 1 member B1 |
| Human | EH2165 | Human ADIPOR1(Adiponectin receptor protein 1) | ADIPOR1 | 96T | ADIPOR1/ACDCR1/CGI45/PAQR1/TESBP1A/ACDCR1/adiponectin receptor 1/adiponectin receptor protein 1/ADR1/CGI45/FLJ42464/PAQR1FLJ25385/Progestin and adipoQ receptor family member I/TESBP1A |
| Human | EH2166 | Human PRDX1(Peroxiredoxin-1) | PRDX1 | 96T | PRDX1/NKEF-A/PRDX1/PRX1/TDPX2/Natural killer cell-enhancing factor A/natural killer-enhancing factor A/NKEFA/NKEF-A/PAG/PAGAMSP23/PAGB/peroxiredoxin 1/peroxiredoxin-1/proliferation-associated gene A/Proliferation-associated gene protein/PRX1/PRXI/TDPX2/Thioredoxin peroxidase 2/Thioredoxin-dependent peroxide reductase 2 |
| Human | EH2167 | Human ITGB1(Integrin beta-1) | ITGB1 | 96T | ITGB1/CD29/CD29 antigen/Fibronectin receptor subunit beta/FNRBVLAB/GPIIA/integrin beta-1/integrin VLA-4 beta subunit/integrin, beta 1(fibronectin receptor, beta polypeptide, antigen CD29 includesMDF2, MSK12)/MDF2/MSK12/very late activation protein, beta polypeptide/VLA-4 subunit beta/VLA-BETA |
| Human | EH2168 | Human MEP1A(Meprin A subunit alpha) | MEP1A | 96T | MEP1A/PPHA/Endopeptidase-2/PPH alpha/meprin A subunit alpha/meprin A, alpha(PABA peptide hydrolase)/N-benzoyl-L-tyrosyl-P-amino-benzoic acid hydrolase subunit alpha/PABA peptide hydrolase/bA268F1.1(meprin A alpha(PABA peptide hydrolase)) |
| Human | EH2169 | Human BMX(Cytoplasmic tyrosine-protein kinase BMX) | BMX | 96T | BMX/ETK/NTK38/PSCTK3/BMX non-receptor tyrosine kinase/Bone marrow tyrosine kinase gene in chromosome X protein/Epithelial and endothelial tyrosine kinase/Etk/Bmx cytosolic tyrosine kinase/ETKcytoplasmic tyrosine-protein kinase BMX/NTK38/NTK38 tyrosine kinase/PSCTK2 |
| Human | EH2170 | Human LPCAT2(Lysophosphatidylcholine acyltransferase 2) | LPCAT2 | 96T | LPCAT2/LPC acyltransferase 2/LPCAT-2/LysoPC acyltransferase 2/Lysophosphatidic acid acyltransferase alpha/LPAAT-alpha/Acetyl-CoA,lyso-PAF acetyltransferase |
| Human | EH2171 | Human TPH2(Tryptophan 5-hydroxylase 2) | TPH2 | 96T | TPH2/Neuronal tryptophan hydroxylase/Tryptophan 5-monooxygenase 2/ |
| Human | EH2172 | Human TPH1(Tryptophan 5-hydroxylase 1) | TPH1 | 96T | TPH1/TPRH/indoleacetic acid-5-hydroxylase/L-tryptophan hydroxylase/tryptophan 5-hydroxylase 1/Tryptophan 5-monooxygenase 1/tryptophan hydroxylase(tryptophan 5-monooxygenase)/tryptophan hydroxylase 1 |
| Human | EH2173 | Human NDST2(Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2) | NDST2 | 96T | NDST2/bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2/Glucosaminyl N-deacetylase/N-sulfotransferase 2/N-deacetylase/N-sulfotransferase(heparan glucosaminyl) 2/NDST-2/N-heparan sulfate sulfotransferase 2/N-HSST 2/NST2 |
| Human | EH2174 | Human APLN(Apelin) | APLN | 96T | APLN(Apelin)/APEL/XNPEP2/APJ endogenous ligand |
| Human | EH2175 | Human GAS1(Growth arrest-specific protein 1) | GAS1 | 96T | GAS1/GAS-1/growth arrest-specific 1/Growth arrest-specific gene-1/growth arrest-specific protein 1 |
| Human | EH2176 | Human MASP2(Mannan-binding lectin serine protease 2) | MASP2 | 96T | MASP2/MBL-associated serine protease 2/Mannose-binding protein-associated serine protease 2/MASP-2 |
| Human | EH2177 | Human TFR2(Transferrin receptor protein 2) | TFR2 | 96T | TFR2/HFE3/TFRC2/HFE3transferrin receptor protein 2/TFRC2/transferrin receptor 2 |
| Human | EH2178 | Human GP5(Platelet glycoprotein V) | GP5 | 96T | GP5/CD42d/GP5/GPV/platelet glycoprotein V/CD42d/glycoprotein V(platelet)/GPV |
| Human | EH2180 | Human AZGP1(Zinc-alpha-2-glycoprotein) | AZGP1 | 96T | AZGP1/ZA2G/ZNGP1/alpha-2-glycoprotein 1, zinc/alpha-2-glycoprotein 1, zinc-binding/ZA2G/ZAGzn-alpha-2-GP/zinc/zinc-alpha-2-glycoprotein/zn-alpha-2-glycoprotein/ZNGP1 |
| Human | EH2181 | Human FABP6(Gastrotropin) | FABP6 | 96T | FABP6/Gastrotropin/I-15P/IBABP/I-BAP/ILBP/ILBP3/ILLBP/fatty acid binding protein 6, ileal/Fatty acid-binding protein 6/gastrotropin/I-15PIntestinal 15 kDa protein/I-BABPIntestinal bile acid-binding protein/I-BALB/I-BAP/ILBP3/ILBPGT/ileal bile acid binding protein/ILLBPIleal lipid-binding protein/illeal lipid-binding protein |
| Human | EH2182 | Human CAPN2(Calpain-2 catalytic subunit) | CAPN2 | 96T | CAPN2/Millimolar-calpain/M-calpain/Calpain-2 large subunit/Calpain large polypeptide L2/Calcium-activated neutral proteinase 2/CANP 2/Calpain M-type |
| Human | EH2183 | Human CAPN6(Calpain-6) | CAPN6 | 96T | CAPN6/Calpain-like protease X-linked/Calpamodulin/CalpM |
| Human | EH2184 | Human KL(Klotho) | KL | 96T | KL/klotho/KLOTHO |
| Human | EH2185 | Human ULBP2(NKG2D ligand 2) | ULBP2 | 96T | ULBP2/ALCAN-alpha/N2DL2/NKG2DL2/RAET1H/ALCAN-alpha/N2DL2/N2DL-2/NKG2D ligand 2/RAET1HNKG2DL2/retinoic acid early transcript 1 H/Retinoic acid early transcript 1H/UL16 binding protein 2/UL16-binding protein 2 |
| Human | EH2186 | Human SEPT5(Septin-5) | SEPT5 | 96T | SEPT5/Cell division control-related protein 1/CDCrel-1/Peanut-like protein 1/PNUTL1 |
| Human | EH2187 | Human TREML1(Trem-like transcript 1 protein) | TREML1 | 96T | TREML1(Trem-like transcript 1 protein)/Triggering receptor expressed on myeloid cells-like protein 1/TLT-1/TLT1/trem-like transcript 1 protein |
| Human | EH2188 | Human SMOX(Spermine oxidase) | SMOX | 96T | SMOX(Spermine oxidase)Polyamine oxidase 1/PAO-1/PAOh1 |
| Human | EH2189 | Human NEFH(Neurofilament heavy polypeptide) | NEFH | 96T | Human NEFH/NEFH neurofilament, heavy polypeptide/neurofilament, heavy polypeptid/NFH/200 kDa neurofilament protein/Neurofilament triplet H protein/NF-H |
| Human | EH2190 | Human CASP7(Caspase-7) | CASP7 | 96T | Human CASP7(Caspase-7)/ICE-like apoptotic protease 3(ICE-LAP3)/Apoptotic protease Mch-3/CMH-1/CASP-7/MCH3/CASP7/Mch3/apoptosis-related cysteine protease/Apoptotic protease Mch-3/CASP-7/caspase 7, apoptosis-related cysteine peptidase/ICE-like apoptotic protease 3/Lice2 alpha/beta/gamma/CASP7/MCH3/Apoptotic protease Mch-3/CMH-1/ICE-like apoptotic protease 3/ICE-LAP3 |
| Human | EH2191 | Human HRG(Histidine-rich glycoprotein) | HRG | 96T | HRG/HPRG/HRGP/THPH11/Histidine-proline-rich glycoprotein(HPRG) |
| Human | EH2192 | Human HSD11B1(Corticosteroid 11-beta-dehydrogenase isozyme 1) | HSD11B1 | 96T | HSD11B1/11-beta-hydroxysteroid dehydrogenase 1/11-DH/11-beta-HSD1/HSD11/11-beta-HSD1/HDL/HSD11B/HSD11L/11-DH |
| Human | EH2193 | Human SEMA3A(Semaphorin-3A) | SEMA3A | 96T | SEMA3A/Sema3A/(semaphorin) 3A/coll-1/collapsin 1/Hsema-I/Hsema-III/sema domain, immunoglobulin domain(Ig), short basic domain, secreted/Sema III/SEMA1/SEMAD/SEMAIII/SEMAL/semaphorin D/Semaphorin III/semaphorin L/semaphorin-3A/SemD/Semaphorin III(Sema III) |
| Human | EH2194 | Human SEMA3B(Semaphorin-3B) | SEMA3B | 96T | SEMA3B/LUCA-1/SEMA3B/SEMA5/SEMAA/SEMAV/semaphorin 3B/LUCA-1/SemA/Sema A(V)/sema domain, immunoglobulin domain(Ig), short basic domain, secreted/Sema V/sema5/SEMA5/SEMAA/semaphorin A/semaphorin V/semaphorin-3B/Semaphorin-V/semaphorin-V/semaV/Sema A(V)/Semaphorin-V(Sema V) |
| Human | EH2195 | Human SEMA3F(Semaphorin-3F) | SEMA3F | 96T | SEMA3F/Sema III/F/Semaphorin IV(Sema IV)/Sema3F/SEMA4/SEMAK/sema domain, immunoglobulin domain(Ig), short basic domain, secreted,(semaphorin) 3F/sema domain, immunoglobulin domain(Ig), short basic domain, secreted, 3F/sema III/F/sema IV/SEMA4/SEMA-IV/semaphorin III/F/semaphorin IV |
| Human | EH2196 | Human SEMA4D(Semaphorin-4D) | SEMA4D | 96T | SEMA4D/GR3/A8/BB18/CD100/COLL-4/M-sema-G/SEMA4D/SEMAJ/A8/CD100 antigen/CD100M-sema-G/coll-4/immunoglobulin domain(Ig), transmembrane domain(TM) and shortcytoplasmic domain, 4D/sema domain, immunoglobulin domain(Ig), transmembrane domain(TM) and shortcytoplasmic domain,(semaphorin) 4D/semaphorin-4D |
| Human | EH2197 | Human UMOD(Uromodulin) | UMOD | 96T | UMOD/ADMCKD2/FJHN/HNFJ/MCKD2/THGP/THP/UMOD/Uromucoid/ADMCKD2/FJHN/HNFJ/HNFJ1/MCKD2/Tamm-Horsfall glycoprotein/THGP/THP/uromodulin(uromucoid, Tamm-Horsfall glycoprotein)/uromucoid/Tamm-Horsfall urinary glycoprotein(THP)/ADMCKD2/FJHN/HNFJ/HNFJ1/MCKD2/THGP/THP |
| Human | EH2199 | Human KRT1(Keratin, type II cytoskeletal 1) | KRT1 | 96T | KRT1/Type-II keratin Kb1/Keratin-1(K1)/Hair alpha protein/67 kDa cytokeratin/Cytokeratin-1(CK-1)/KRTA |
| Human | EH2200 | Human CASP14(Caspase-14) | CASP14 | 96T | CASP14/Caspase-14(CASP-14)/CASP14/apoptosis-related cysteine protease/caspase 14, apoptosis-related cysteine peptidase/caspase 14, apoptosis-related cysteine protease/caspase-14/MICE |
| Human | EH2201 | Human ILF3(Interleukin enhancer-binding factor 3) | ILF3 | 96T | ILF3/Translational control protein 80(TCP80)/Nuclear factor of activated T-cells 90 kDa/NF-AT-90/Nuclear factor associated with dsRNA(NFAR)/Double-stranded RNA-binding protein 76(DRBP76)/M-phase phosphoprotein 4(MPP4)/DRBF/MPHOSPH4/NF90 |
| Human | EH2202 | Human ARNT(Aryl hydrocarbon receptor nuclear translocator) | ARNT | 96T | ARNT/Hypoxia-inducible factor 1-beta(HIF-1-beta/HIF1-beta)/Class E basic helix-loop-helix protein 2(bHLHe2)/Dioxin receptor, nuclear translocator/HIF-1 beta/TANGO/ARNT protein/aryl hydrocarbon receptor nuclear translocator/BHLHE2/HIF-1 Beta/HIF1B/HIF1BETA/HIF-1-beta/HIF1-beta/hypoxia-inducible factor 1, beta subunit/Hypoxia-inducible factor 1-beta/nuclear translocator |
| Human | EH2203 | Human KRT10(Keratin, type I cytoskeletal 10) | KRT10 | 96T | KRT10/Cytokeratin-10(CK-10)/Keratin-10(K10)/KPP |
| Human | EH2204 | Human SSTR2(Somatostatin receptor type 2) | SSTR2 | 96T | SSTR2/Smstr2/SST2/SSTR2/somatostatin receptor 2/somatostatin receptor type 2/SRIF-1/SS2R/SS-2-R/SS2-R/SRIF-1 |
| Human | EH2205 | Human AMOT(Angiomotin) | AMOT | 96T | AMOT/KIAA1071 |
| Human | EH2206 | Human AMOTL1(Angiomotin-like protein 1) | AMOTL1 | 96T | AMOTL1/JEAP |
| Human | EH2208 | Human PMEL(Melanocyte protein PMEL) | PMEL | 96T | PMEL/P100/P1/Melanoma-associated ME20 antigen/Melanocytes lineage-specific antigen GP100/Silver locus protein homolog/Premelanosome protein/ME20-M(ME20M)/Melanocyte protein Pmel 17/PMEL17/SILV |
| Human | EH2209 | Human ITGB2(Integrin beta-2) | ITGB2 | 96T | Cell surface adhesion glycoproteins LFA-1/CR3/p150,95 subunit beta/Complement receptor C3 subunit beta/CD18/MFI7 |
| Human | EH2210 | Human CD68(Macrosialin) | CD68 | 96T | CD68/Gp110/LAMP4/SCARD1/SCARD1/SR-D1/CD68 antigenmacrophage antigen CD68/molecule/macrosialin/SCARD1/scavenger receptor class D, member 1 |
| Human | EH2211 | Human KRT16(Keratin, type I cytoskeletal 16) | KRT16 | 96T | KRT16/Cytokeratin-16(CK-16)/Keratin-16/CK16/K1CP/NEPPK/FNEPPK/KRT16A |
| Human | EH2212 | Human S100A11(Protein S100-A11) | S100A11 | 96T | S100A11/S100 calcium-binding protein A11/Protein S100-C/Calgizzarin/Metastatic lymph node gene 70 protein(MLN 70)/Calgizzarin/MLN70/S100C/calgizzarin/Calgizzarin/Metastatic lymph node gene 70 protein/MLN 70/protein S100-A11/Protein S100-C/S100 calcium binding protein A11/ |
| Human | EH2213 | Human SALL2(Sal-like protein 2) | SALL2 | 96T | SALL2/Zinc finger protein Spalt-2/Sal-2/hSal2/Zinc finger protein 795/Zinc finger protein SALL2 |
| Human | EH2214 | Human KCNB2(Potassium voltage-gated channel subfamily B member 2) | KCNB2 | 96T | KCNB2/Voltage-gated potassium channel subunit Kv2.2 |
| Human | EH2215 | Human UBR1(E3 ubiquitin-protein ligase UBR1) | UBR1 | 96T | UBR1/Ubiquitin-protein ligase E3-alpha-I/N-recognin-1/E3 ubiquitin-protein ligase UBR1/N-recognin-1 |
| Human | EH2216 | Human TK2(Thymidine kinase 2, mitochondrial) | TK2 | 96T | TK2/Mt-TK/EC 2.7.1.21/thymidine kinase 1 soluble isoform/thymidine kinase 1, soluble/thymidine kinase, cytosolic/thymidine kinase-1 |
| Human | EH2217 | Human HUWE1(E3 ubiquitin-protein ligase HUWE1) | HUWE1 | 96T | HUWE1/Upstream regulatory element-binding protein 1/URE-B1/URE-binding protein 1/Mcl-1 ubiquitin ligase E3/Large structure of UREB1/LASU1/Homologous to E6AP carboxyl terminus homologous protein 9/HectH9/ARF-binding protein 1/ARF-BP1/HECT, UBA and WWE domain-containing protein 1 |
| Human | EH2218 | Human PDCD4(Programmed cell death protein 4) | PDCD4 | 96T | PDCD4/H731/nuclear antigen H731/Neoplastic transformation inhibitor protein/Nuclear antigen H731-like/programmed cell death 4(neoplastic transformation inhibitor)/programmed cell death protein 4/Protein 197/15a |
| Human | EH2219 | Human EGFLAM(Pikachurin) | EGFLAM | 96T | EGFLAM/Agrin-like protein/EGF-like, fibronectin type-III and laminin G-like domain-containing protein/AGRINL/AGRNL |
| Human | EH2220 | Human SNAI2(Zinc finger protein SNAI2) | SNAI2 | 96T | SNAI2/Neural crest transcription factor Slug/Protein snail homolog 2/SLUG/SLUGH |
| Human | EH2221 | Human NOTCH2(Neurogenic locus notch homolog protein 2) | NOTCH2 | 96T | NOTCH2/AGS2/hN2/Notch(Drosophila) homolog 2/notch 2Notch homolog 2(Drosophila)/Notch homolog 2 |
| Human | EH2222 | Human NOTCH4(Neurogenic locus notch homolog protein 4) | NOTCH4 | 96T | NOTCH4/INT3/Notch 4/hNotch4 |
| Human | EH2223 | Human AKR1C4(Aldo-keto reductase family 1 member C4) | AKR1C4 | 96T | AKR1C4/3-alpha-HSD/AKR1C4/CDR/CHDR/DD4/HAKRA/C11/DD-4 |
| Human | EH2224 | Human ATG12(Ubiquitin-like protein ATG12) | ATG12 | 96T | ATG12/APG12/FBR93/HAPG12/Apg12(autophagy 12, S. cerevisiae)-like/APG12 autophagy 12-like(S. cerevisiae)/APG12HAPG12/APG12-like/ATG12 autophagy related 12 homolog(S. cerevisiae)/Autophagy-related protein 12/FBR93 |
| Human | EH2225 | Human FOLR2(Folate receptor beta) | FOLR2 | 96T | FOLR2/beta-HFR/FR-beta/FR-P3/BETA-HFR/FBP/Folate receptor 2/folate receptor 2(fetal)/folate receptor, beta/Folate receptor, fetal/placental/folate-binding protein, fetal/placental/FR-BETA/Placental folate-binding protein |
| Human | EH2226 | Human B4GALT5(Beta-1,4-galactosyltransferase 5) | B4GALT5 | 96T | B4GALT5/Beta-1,4-GalTase 5/Beta4Gal-T5/b4Gal-T5/UDP-galactose:beta-N-acetylglucosamine beta-1,4-galactosyltransferase 5/Beta-1,4-GalT II/UDP-Gal:beta-GlcNAc beta-1,4-galactosyltransferase 5 |
| Human | EH2227 | Human CBLB(E3 ubiquitin-protein ligase CBL-B) | CBLB | 96T | CBLB/Signal transduction protein CBL-B/SH3-binding protein CBL-B/Casitas B-lineage lymphoma proto-oncogene b/RING finger protein 56 |
| Human | EH2228 | Human CAMKK2(Calcium/calmodulin-dependent protein kinase kinase 2) | CAMKK2 | 96T | CAMKK2/CaM-KK 2/CaM-kinase kinase 2/CaMKK 2/Calcium/calmodulin-dependent protein kinase kinase beta/CaM-KK beta/CaM-kinase kinase beta/CaMKK beta |
| Human | EH2229 | Human CD5L(CD5 antigen-like) | CD5L | 96T | CD5L/AIM/API6/CT-2/SP-alpha/apoptosis inhibitor 6/CD5 antigen-like(scavenger receptor cysteine rich family)/CD5 molecule-like/IgM-associated peptide/PRO229/Spalpha/SP-ALPHA |
| Human | EH2230 | Human CFHR1(Complement factor H-related protein 1) | CFHR1 | 96T | CFHR1/BTA/FHR1/CFHL1FHR-1/CFHLCFHR1P/complement factor H-related 1/complement factor H-related 1 pseudogene/FHR1CFHL1P/H factor(complement)-like 1/H factor(complement)-like 2/H factor-like protein 1/H36-1/H36-2/H-factor-like 1/HFL1H36/HFL2 |
| Human | EH2231 | Human CLPP(Putative ATP-dependent Clp protease proteolytic subunit, mitochondrial) | CLPP | 96T | CLPP/Endopeptidase Clp |
| Human | EH2232 | Human CTCFL(Transcriptional repressor CTCFL) | CTCFL | 96T | CTCFL/Zinc finger protein CTCF-T/Cancer/testis antigen 27(CT27)/CTCF-like protein/CTCF paralog/Brother of the regulator of imprinted sites/CCCTC-binding factor |
| Human | EH2233 | Human DTX1(Protein deltex-1) | DTX1 | 96T | DTX1/Deltex1/Dx-1/deltex homolog 1(Drosophila)/deltex1/Deltex1/hDTX1/hDx-1/protein deltex-1 |
| Human | EH2234 | Human FAM3B(Protein FAM3B) | FAM3B | 96T | FAM3B/PANDER/PRED44/2-21/chromosome 21 open reading frame 11/Cytokine-like protein 2-21/family with sequence similarity 3, member B/ORF9/pancreatic derived factor/Pancreatic-derived factor |
| Human | EH2235 | Human MYOF(Myoferlin) | MYOF | 96T | MYOF/Fer-1-like protein 3 |
| Human | EH2236 | Human GFRA1(GDNF family receptor alpha-1) | GFRA1 | 96T | GFRA1/GDNF R alpha-1/GDNF family receptor alpha 1/GDNF family receptor alpha-1/GDNF receptor alpha-1/GDNFRAGFR-ALPHA-1/GDNFR-alpha-1/GFR-alpha-1/Glial cell line-derived neurotrophic factor receptor alpha/GPI-linked anchor protein/PI-linked cell-surface accessory protein/RET ligand 1/RET1L/TGF-beta related neurotrophic factor receptor 1/TGF-beta-related neurotrophic factor receptor 1 |
| Human | EH2237 | Human GLIPR1(Glioma pathogenesis-related protein 1) | GLIPR1 | 96T | GLIPR1/GLI pathogenesis-related 1/GLI pathogenesis-related 1(glioma)/GliPR/GliPR 1/GLIPRglioma pathogenesis-related protein 1/Protein RTVP-1/related to testis-specific, vespid, and pathogenesis proteins 1/RTVP1CRISP7/testes-specific vespid and pathogenesis protein 1 |
| Human | EH2238 | Human HSD3B1(3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase type 1) | HSD3B1 | 96T | HSD3B1/3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase type I(3-beta-HSD I)/Trophoblast antigen FDO161G/3BH/HSDB3A |
| Human | EH2239 | Human IFIH1(Interferon-induced helicase C domain-containing protein 1) | IFIH1 | 96T | IFIH1/RNA helicase-DEAD box protein 116(RLR-2)/Murabutide down-regulated protein/Melanoma differentiation-associated protein 5(MDA-5)/Interferon-induced with helicase C domain protein 1/RNA helicase-DEAD box protein 116/Clinically amyopathic dermatomyositis autoantigen 140 kDa(CADM-140 autoantigen)/Helicase with 2 CARD domains(Helicard) |
| Human | EH2240 | Human KIRREL(Kin of IRRE-like protein 1) | KIRREL | 96T | KIRREL/KIRREL1/NEPH1/kin of IRRE like(Drosophila)/nephrin-like protein 1 |
| Human | EH2241 | Human LYPD3(Ly6/PLAUR domain-containing protein 3) | LYPD3 | 96T | LYPD3/MIG-C4/C4.4A2310061G07Rik/GPI-anchored metastasis-associated protein C4.4A homolog/GPI-anchored metastasis-associated protein homolog/LY6/PLAUR domain containing 3/ly6/PLAUR domain-containing protein 3/Matrigel-induced gene C4 protein |
| Human | EH2242 | Human MAP1LC3A(Microtubule-associated proteins 1A/1B light chain 3A) | MAP1LC3A | 96T | MAP1LC3A/Apg8/APG8a/Apg8p3/ATG8E/MAP1ALC3/MLP3A/ATG8E/Autophagy-related protein LC3 A/Autophagy-related ubiquitin-like modifier LC3 A/LC3/LC3A/lc3-i, ii/MAP1A/1B light chain 3 A/MAP1ALC3MAP1A/MAP1B LC3 A/MAP1BLC3MAP1A/MAP1B light chain 3 A/microtubule-associated protein 1 light chain 3 alphaMAP1 light chain 3-like protein 1/microtubule-associated proteins 1A/1B light chain 3/microtubule-associated proteins 1A/1B light chain 3A |
| Human | EH2243 | Human MAP1LC3B(Microtubule-associated proteins 1A/1B light chain 3B) | MAP1LC3B | 96T | MAP1LC3B/Microtubule-associated protein 1 light chain 3 beta/MAP1A/MAP1B light chain 3 B(MAP1A/MAP1B LC3 B)/MAP1 light chain 3-like protein 2/Autophagy-related protein LC3 B/Autophagy-related ubiquitin-like modifier LC3 B |
| Human | EH2244 | Human TAB3(TGF-beta-activated kinase 1 and MAP3K7-binding protein 3) | TAB3 | 96T | TAB3/TGF-beta-activated kinase 1-binding protein 3/TAK1-binding protein 3(TAB-3)/Mitogen-activated protein kinase kinase kinase 7-interacting protein 3/NF-kappa-B-activating protein 1/MAP3K7IP3 |
| Human | EH2245 | Human TAB2(TGF-beta-activated kinase 1 and MAP3K7-binding protein 2) | TAB2 | 96T | TAB2/TGF-beta-activated kinase 1-binding protein 2/Mitogen-activated protein kinase kinase kinase 7-interacting protein 2/TAK1-binding protein 2(TAB-2) |
| Human | EH2246 | Human TAB1(TGF-beta-activated kinase 1 and MAP3K7-binding protein 1) | TAB1 | 96T | TAB1/mitogen-activated protein kinase kinase kinase 7 interacting protein 1Mitogen-activated protein kinase kinase kinase 7-interacting protein 1/TAK1-binding protein 1/TGF-beta activated kinase 1/MAP3K7 binding protein 1/TGF-beta-activated kinase 1 and MAP3K7-binding protein 1/TGF-beta-activated kinase 1-binding protein 1/transforming growth factor beta-activated kinase-binding protein 1 |
| Human | EH2247 | Human KAT8(Histone acetyltransferase KAT8) | KAT8 | 96T | KAT8/PP7073/MOF/MYST1/MYST-1/hMOF/Lysine acetyltransferase 8/MOZ, YBF2/SAS3, SAS2 and TIP60 protein 1 |
| Human | EH2248 | Human CTSC(Dipeptidyl peptidase 1) | CTSC | 96T | CTSC/DPPI/PALS/PLS/cathepsin C/EC 3.4.14.1/Cathepsin J/CPPIHMS/dipeptidyl peptidase 1/Dipeptidyl peptidase I/Dipeptidyl transferase/dipeptidyl-peptidase I/DPP1/DPPI/DPP-I/JP/JPD |
| Human | EH2249 | Human WNT4(Protein Wnt-4) | WNT4 | 96T | WNT4/protein Wnt-4/SERKAL/wingless-type MMTV integration site family, member 4/WNT-4 |
| Human | EH2250 | Human WNT2B(Protein Wnt-2b) | WNT2B | 96T | WNT2B/WNT13/Protein Wnt-13/XWNT2/protein Wnt-2b/wingless-type MMTV integration site family, member 2B/XWNT2, Xenopus, homolog of/XWNT2wingless-type MMTV integration site family, member 13 |
| Human | EH2251 | Human WNT2(Protein Wnt-2) | WNT2 | 96T | WNT2/NT1L1/IRP/Int-1-like protein 1/Int-1-related protein/secreted growth factor/Int-1-like protein 1/Int-1-related protein/IRPprotein Wnt-2/wingless-type MMTV integration site family member 2 |
| Human | EH2252 | Human WWC1(Protein KIBRA) | WWC1 | 96T | WWC1/KIAA0869/KIBRA/WW domain-containing protein 1/HBeAg-binding protein 3/Kidney and brain protein |
| Human | EH2253 | Human WIF1(Wnt inhibitory factor 1) | WIF1 | 96T | WIF1/WIF-1/WNT inhibitory factor 1 |
| Human | EH2254 | Human UACA(Uveal autoantigen with coiled-coil domains and ankyrin repeats) | UACA | 96T | UACA/KIAA1561 |
| Human | EH2255 | Human NUDT1(7,8-dihydro-8-oxoguanine triphosphatase) | NUDT1 | 96T | NUDT1/MTH1/Nudix motif 1/Nudix motif 1/Nucleoside diphosphate-linked moiety X motif 1/3.6.1.56/8-oxo-dGTPase/Nucleoside diphosphate-linked moiety X motif 1 |
| Human | EH2256 | Human PDLIM1(PDZ and LIM domain protein 1) | PDLIM1 | 96T | PDLIM1/CLIM1/CLP36/LIM domain protein CLP-36/C-terminal LIM domain protein 1/Elfin |
| Human | EH2257 | Human PEG10(Retrotransposon-derived protein PEG10) | PEG10 | 96T | PEG10/EDR/KIAA1051/MAR2/MART2/MEF3L1/RGAG3/MEF3-like protein 1/Retrotransposon-derived gag-like polyprotein/Retrotransposon gag domain-containing protein 3/Paternally expressed gene 10 protein/Myelin ｅxpression factor 3-like protein 1/Ty3/Gypsy-like protein/Embryonal carcinoma differentiation-regulated protein/Mammalian retrotransposon-derived protein 2 |
| Human | EH2258 | Human PREX1(Phosphatidylinositol 3,4,5-trisphosphate-dependent Rac exchanger 1 protein) | PREX1 | 96T | PREX1/KIAA1415/P-Rex1/PtdIns(3,4,5)-dependent Rac exchanger 1/phosphatidylinositol 34,5-trisphosphate-dependent Rac exchanger 1 protein/phosphatidylinositol-34,5-trisphosphate-dependent Rac exchange factor 1/ptdIns(34,5)-dependent Rac exchanger 1 |
| Human | EH2259 | Human PRKCSH(Glucosidase 2 subunit beta) | PRKCSH | 96T | PRKCSH/G19P1/PKCSH/Protein kinase C substrate 60.1 kDa protein heavy chain/80K-H protein/Glucosidase II subunit beta |
| Human | EH2260 | Human RAP1A(Ras-related protein Rap-1A) | RAP1A | 96T | RAP1A/KREV1/Ras-related protein Krev-1/GTP-binding protein smg p21A/C21KG/G-22K |
| Human | EH2261 | Human CRCP(DNA-directed RNA polymerase III subunit RPC9) | CRCP | 96T | CRCP/RNA polymerase III subunit C9/CGRP-RCP/CGRP-receptor component protein/CGRPRCP/HsC17/Calcitonin gene-related peptide-receptor component protein |
| Human | EH2262 | Human RECK(Reversion-inducing cysteine-rich protein with Kazal motifs) | RECK | 96T | ST15/hRECK/membrane-anchored glycoprotein(metastasis and invasion)/reversion-inducing-cysteine-rich protein with kazal motifs/ST15reversion-inducing cysteine-rich protein with Kazal motifs/suppression of tumorigenicity 15(reversion-inducing-cysteine-rich protein withkazal motifs)/suppression of tumorigenicity 5(reversion-inducing-cysteine-rich protein withkazal motifs)/Suppressor of tumorigenicity 15 protein |
| Human | EH2263 | Human ROBO4(Roundabout homolog 4) | ROBO4 | 96T | ECSM4/Magic roundabout/MRB/roundabout homolog 4/roundabout homolog 4, magic roundabout(Drosophila) |
| Human | EH2264 | Human RSPO1(R-spondin-1) | RSPO1 | 96T | Cristin 3/RSPO1/CRISTIN3/FLJ40906Roof plate-specific spondin-1/hRspo1/roof plate-specific spondin/RSPO/RSPONDIN/R-spondin homolog(Xenopus laevis)/R-spondin1/R-spondin-1 |
| Human | EH2265 | Human RUVBL1(RuvB-like 1) | RUVBL1 | 96T | RUVBL1/TIP49a/Pontin 52/Nuclear matrix protein 238(NMP 238)/INO80 complex subunit H/TIP60-associated protein 54-alpha(TAP54-alpha)/49 kDa TATA box-binding protein-interacting protein(49 kDa TBP-interacting protein)/54 kDa erythrocyte cytosolic protein(ECP-54)/ |
| Human | EH2266 | Human SAE1(SUMO-activating enzyme subunit 1) | SAE1 | 96T | SAE1/AOS1/SUA1/UBA2/UBLE1A/AOS1activator of SUMO1/FLJ3091/HSPC140/Sua1/SUA1sentrin/SUMO-activating protein AOS1/SUMO-1 activating enzyme E1 N subunit/SUMO1 activating enzyme subunit 1/SUMO-1 activating enzyme subunit 1/SUMO-activating enzyme subunit 1/Ubiquitin-like 1-activating enzyme E1A/ubiquitin-like protein SUMO-1 activating enzyme/UBLE1A |
| Human | EH2267 | Human SIVA1(Apoptosis regulatory protein Siva) | SIVA1 | 96T | SIVA1/Apoptosis regulatory protein Siva/CD27-binding protein(CD27BP |
| Human | EH2268 | Human SMC4(Structural maintenance of chromosomes protein 4) | SMC4 | 96T | SMC4/Structural maintenance of chromosomes protein 4(SMC protein 4/SMC-4)/Chromosome-associated polypeptide C(hCAP-C)/XCAP-C homolog |
| Human | EH2269 | Human SIK2(Serine/threonine-protein kinase SIK2) | SIK2 | 96T | SIK2/LOH11CR1I/QIK/KIAA0781SIK-2/LOH11CR1I/QIKSNF1LK2/Qin-induced kinase/salt-inducible kinase 2/Salt-inducible protein kinase 2/salt-inducible serine/threonine kinase 2/serine/threonine-protein kinase SIK2/Serine/threonine-protein kinase SNF1-like kinase 2/SNF1-like kinase 2 |
| Human | EH2270 | Human SORBS1(Sorbin and SH3 domain-containing protein 1) | SORBS1 | 96T | SORBS1/Sorbin and SH3 domain-containing protein 1/c-Cbl-associated protein(CAP)/SH3P12/Ponsin/SH3 domain protein 5 |
| Human | EH2271 | Human SPOCK2(Testican-2) | SPOCK2 | 96T | SPOCK2/KIAA0275/FLJ97039/KIAA0275CWCV, and Kazal-like domains proteoglycan 2/sparc/osteonectin, cwcv and kazal-like domains proteoglycan(testican) 2 |
| Human | EH2272 | Human ST6GAL1(Beta-galactoside alpha-2,6-sialyltransferase 1) | ST6GAL1 | 96T | ST6GAL1/Alpha 2,6-ST/B-cell antigen CD75/CD75/SIAT1/ST6N/B-cell antigen CD75/beta-galactoside alpha-2,6-sialyltransferase 1/CMP-N-acetylneuraminate beta-galactosamide alpha-2,6-sialyltransferase/CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,6-sialyltransferase 1/Sialyltransferase 1/sialyltransferase 1(beta-galactoside alpha-2,6-sialyltransferase)/sialyltransferase 1(beta-galactoside alpha-2,6-sialytransferase)/SIAT1Alpha 2,6-ST 1/ST6 beta-galactosamide alpha-2,6-sialyltranferase 1/ST6Gal I/ST6GalI/ST6N |
| Human | EH2273 | Human SWAP70(Switch-associated protein 70) | SWAP70 | 96T | SWAP70/SWAP switching B-cell complex 70kDa subunit/switch-associated protein 70 |
| Human | EH2274 | Human TARBP2(RISC-loading complex subunit TARBP2) | TARBP2 | 96T | TARBP2/RISC-loading complex subunit TARBP2/TAR RNA-binding protein 2/Trans-activation-responsive RNA-binding protein |
| Human | EH2275 | Human TBC1D1(TBC1 domain family member 1) | TBC1D1 | 96T | TBC1D1/TBC1 domain family member 1 |
| Human | EH2276 | Human TBPL1(TATA box-binding protein-like protein 1) | TBPL1 | 96T | TBPL1/TATA box-binding protein-like protein 1(TBP-like protein 1)/TBP-related protein/TBP-like factor/TATA box-binding protein-related factor 2(TBP-related factor 2)/21 kDa TBP-like protein/Second TBP of unique DNA protein(STUD)/ |
| Human | EH2277 | Human DRAM1(DNA damage-regulated autophagy modulator protein 1) | DRAM1 | 96T | DRAM1/DNA damage-regulated autophagy modulator protein 1/Damage-regulated autophagy modulator |
| Human | EH2278 | Human MBOAT4(Ghrelin O-acyltransferase) | MBOAT4 | 96T | MBOAT4/OACT4/EC 2.3.1.-/ghrelin O-acyltransferase/membrane bound O-acyltransferase domain containing 4/Membrane-bound O-acyltransferase domain-containing protein 4/OACT4/O-acyltransferase(membrane bound) domain containing 4/O-acyltransferase domain-containing protein 4 |
| Human | EH2279 | Human LRP5(Low-density lipoprotein receptor-related protein 5) | LRP5 | 96T | LRP5/BMND1/EVR1/EVR4/HBM/LRP7/OPPG/OPS/OPTA1/VBCH2/BMND1OPTA1/EVR1/EVR4/HBM/low density lipoprotein receptor-related protein 5/low density lipoprotein receptor-related protein 7/low-density lipoprotein receptor-related protein 5/LR3VBCH2/LRP-5/LRP7exudative vitreoretinopathy 1/OPPG/OPS/osteoporosis pseudoglioma syndrome |
| Human | EH2280 | Human ATP13A2(Probable cation-transporting ATPase 13A2) | ATP13A2 | 96T | ATP13A2/Probable cation-transporting ATPase 13A2 |
| Human | EH2281 | Human DNAJC27(DnaJ homolog subfamily C member 27) | DNAJC27 | 96T | DNAJC27/DnaJ homolog subfamily C member 27/Rab and DnaJ domain-containing protein/ |
| Human | EH2282 | Human MSMB(Beta-microseminoprotein) | MSMB | 96T | MSMB/PSP94/IGBF/MSPB/PIP/PN44/PRPS/PSP57 |
| Human | EH2283 | Human RSAD2(Radical S-adenosyl methionine domain-containing protein 2) | RSAD2 | 96T | RSAD2/Radical S-adenosyl methionine domain-containing protein 2/Virus inhibitory protein, endoplasmic reticulum-associated, interferon-inducible/Cytomegalovirus-induced gene 5 protein/Viperin |
| Human | EH2284 | Human TMEM132D(Transmembrane protein 132D) | TMEM132D | 96T | TMEM132D/Transmembrane protein 132D/Mature oligodendrocytes transmembrane protein(Mature OL transmembrane protein) |
| Human | EH2285 | Human NOTCH3(Neurogenic locus notch homolog protein 3) | NOTCH3 | 96T | NOTCH3/CADASIL/CASILneurogenic locus notch homolog protein 3/Notch(Drosophila) homolog 3/notch 3Notch homolog 3(Drosophila)/Notch homolog 3 |
| Human | EH2286 | Human SIRT1O(NAD-dependent deacetylase sirtuin-1) | SIRT1O | 96T | SIRT1O/NAD-dependent deacetylase sirtuin-1(hSIRT1)/SIR2-like protein 1(hSIR2) |
| Human | EH2287 | Human PSTK(L-seryl-tRNA(Sec) kinase) | PSTK | 96T | PSTK/L-seryl-tRNA(Sec) kinase/O-phosphoseryl-tRNA(Sec) kinase/ |
| Human | EH2288 | Human NAT8L(N-acetylaspartate synthetase) | NAT8L | 96T | NAT8L/N-acetylaspartate synthetase(NAA synthetase)/Camello-like protein 3/N-acetyltransferase 8-like protein |
| Human | EH2289 | Human TMEM126A(Transmembrane protein 126A) | TMEM126A | 96T | TMEM126A |
| Human | EH2290 | Human ENHO(Adropin) | ENHO | 96T | ENHO/Energy homeostasis-associated protein/Adropin |
| Human | EH2291 | Human THAP4(THAP domain-containing protein 4) | THAP4 | 96T | THAP4 |
| Human | EH2292 | Human PREX2(Phosphatidylinositol 3,4,5-trisphosphate-dependent Rac exchanger 2 protein) | PREX2 | 96T | PREX2/PtdIns(3/4/5)-dependent Rac exchanger 2/DEP domain-containing protein 2/PREX2/DEPDC2 |
| Human | EH2293 | Human PIM3(Serine/threonine-protein kinase pim-3) | PIM3 | 96T | PIM3/KID1/Pim-3/Serine/threonine kinase Pim-3 |
| Human | EH2294 | Human PORCN(Probable protein-cysteine N-palmitoyltransferase porcupine) | PORCN | 96T | PORCN/Protein MG61/PORCN/MG61/PORC/PPN/2.3.1.- |
| Human | EH2295 | Human GDF1(Embryonic growth/differentiation factor 1) | GDF1 | 96T | GDF1/GDF-1/DORV/DTGA3/embryonic growth/differentiation factor 1/GDF-1/growth differentiation factor 1 |
| Human | EH2296 | Human TIRAP(Toll/interleukin-1 receptor domain-containing adapter protein) | TIRAP | 96T | TIRAP/TIR domain-containing adapter protein/Adaptor protein Wyatt/MyD88 adapter-like protein/TIRAP/MAL/MyD88-2 |
| Human | EH2297 | Human ADAMTS18(A disintegrin and metalloproteinase with thrombospondin motifs 18) | ADAMTS18 | 96T | ADAMTS18/ADAM-TS 18/ADAM-TS18/ADAMTS-18/ADAMTS18/ADAMTS21/3.4.24.- |
| Human | EH2298 | Human HACE1(E3 ubiquitin-protein ligase HACE1) | HACE1 | 96T | HACE1/HECT domain and ankyrin repeat-containing E3 ubiquitin-protein ligase 1/HACE1/KIAA1320/6.3.2.- |
| Human | EH2299 | Human IFI44(Interferon-induced protein 44) | IFI44 | 96T | IFI44/Microtubule-associated protein 44/IFI44/MTAP44 |
| Human | EH2300 | Human FEM1A(Protein fem-1 homolog A) | FEM1A | 96T | FEM1A/FEM1a/FEM1-alpha/Prostaglandin E receptor 4-associated protein/FEM1A/EPRAP |
| Human | EH2301 | Human SORCS1(VPS10 domain-containing receptor SorCS1) | SORCS1 | 96T | SORCS1/hSorCS/SORCS1/SORCS |
| Human | EH2302 | Human C1orf106(Uncharacterized protein C1orf106) | C1orf106 | 96T | C1orf106 |
| Human | EH2303 | Human DKKL1(Dickkopf-like protein 1) | DKKL1 | 96T | DKKL1/Cancer/testis antigen 34/CT34/Protein soggy-1/SGY-1/DKKL1/SGY1/UNQ735/PRO1429 |
| Human | EH2304 | Human TRIM22(E3 ubiquitin-protein ligase TRIM22) | TRIM22 | 96T | TRIM22/50 kDa-stimulated trans-acting factor/RING finger protein 94/Staf-50/Tripartite motif-containing protein 22/TRIM22/RNF94/STAF50/6.3.2.- |
| Human | EH2306 | Human PRSS22(Brain-specific serine protease 4) | PRSS22 | 96T | PRSS22/BSSP-4/Serine protease 22/Serine protease 26/Tryptase epsilon/PRSS22/BSSP4/PRSS26/SP001LA/UNQ302/PRO343/3.4.21.- |
| Human | EH2307 | Human B7H6(B7 homolog 6) | B7H6 | 96T | B7H6 |
| Human | EH2308 | Human WNT10A(Protein Wnt-10a) | WNT10A | 96T | WNT10A |
| Human | EH2309 | Human RGS19(Regulator of G-protein signaling 19) | RGS19 | 96T | RGS19/G-alpha-interacting protein/GAIP/RGS19/GAIP/GNAI3IP |
| Human | EH2310 | Human ZFP36(Tristetraprolin) | ZFP36 | 96T | ZFP36/TTP/G0/G1 switch regulatory protein 24/Growth factor-inducible nuclear protein NUP475/Protein TIS11A/TIS11/Zinc finger protein 36 homolog/Zfp-36/ZFP36/G0S24/ |
| Human | EH2311 | Human WNT7B(Protein Wnt-7b) | WNT7B | 96T | WNT7B |
| Human | EH2312 | Human WNT7A(Protein Wnt-7a) | WNT7A | 96T | WNT7A |
| Human | EH2313 | Human WNT10B(Protein Wnt-10b) | WNT10B | 96T | WNT10B/Protein Wnt-12/WNT10B/WNT12 |
| Human | EH2314 | Human TTF2(Transcription termination factor 2) | TTF2 | 96T | TTF2/Lodestar homolog/RNA polymerase II termination factor/Transcription release factor 2/F2/HuF2/TTF2/3.6.4.- |
| Human | EH2315 | Human TCF7L2(Transcription factor 7-like 2) | TCF7L2 | 96T | TCF7L2/HMG box transcription factor 4/T-cell-specific transcription factor 4/T-cell factor 4/TCF-4/hTCF-4/TCF7L2/TCF4 |
| Human | EH2316 | Human TBX21(T-box transcription factor TBX21) | TBX21 | 96T | TBX21/T-box protein 21/T-cell-specific T-box transcription factor T-bet/Transcription factor TBLYM/TBX21/TBET/TBLYM |
| Human | EH2317 | Human KCNJ10(ATP-sensitive inward rectifier potassium channel 10) | KCNJ10 | 96T | KCNJ10/ATP-dependent inwardly rectifying potassium channel Kir4.1/Inward rectifier K(+) channel Kir1.2/Potassium channel/inwardly |
| Human | EH2318 | Human SORL1(Sortilin-related receptor) | SORL1 | 96T | SORL1/Low-density lipoprotein receptor relative with 11 ligand-binding repeats/LDLR relative with 11 ligand-binding repeats/LR11/SorLA-1/Sorting protein-related receptor |
| Human | EH2319 | Human RPL13(60S ribosomal protein L13) | RPL13 | 96T | RPL13/Breast basic conserved protein 1/RPL13/BBC1/OK/SW-cl.46 |
| Human | EH2320 | Human REPS2(RalBP1-associated Eps domain-containing protein 2) | REPS2 | 96T | REPS2/Partner of RalBP1/RalBP1-interacting protein 2/REPS2/POB1 |
| Human | EH2321 | Human HSD17B10(3-hydroxyacyl-CoA dehydrogenase type-2) | HSD17B10 | 96T | HSD17B10/17-beta-hydroxysteroid dehydrogenase 10/17-beta-HSD 10/3-hydroxy-2-methylbutyryl-CoA dehydrogenase/3-hydroxyacyl-CoA dehydrogenase type |
| Human | EH2322 | Human RAB10(Ras-related protein Rab-10) | RAB10 | 96T | RAB10 |
| Human | EH2323 | Human LILRB4(Leukocyte immunoglobulin-like receptor subfamily B member 4) | LILRB4 | 96T | LILRB4/CD85k/HM18/ILT3/LIR5/CD85 antigen-like family member K/CD85k/CD85k antigen/ILT-3/ILT3CD85K/leukocyte immunoglobulin-like receptor, subfamily B(with TM and ITIM domains)/LIR5LILRB5/LIR-5subfamily B, member 4 |
| Human | EH2324 | Human PPP1R14B(Protein phosphatase 1 regulatory subunit 14B) | PPP1R14B | 96T | PPP1R14B/Phospholipase C-beta-3 neighbouring gene protein |
| Human | EH2325 | Human LPPR4(Lipid phosphate phosphatase-related protein type 4) | LPPR4 | 96T | LPPR4/Brain-specific phosphatidic acid phosphatase-like protein 1/Plasticity-related gene 1 protein(PRG-1) |
| Human | EH2326 | Human NBR1(Next to BRCA1 gene 1 protein) | NBR1 | 96T | NBR1/Protein 1A1-3B/Neighbor of BRCA1 gene 1 protein/Cell migration-inducing gene 19 protein/Membrane component chromosome 17 surface marker 2 |
| Human | EH2327 | Human ILVBL(Acetolactate synthase-like protein) | ILVBL | 96T | ILVBL/IlvB-like protein |
| Human | EH2328 | Human HIST2H2BE(Histone H2B type 2-E) | HIST2H2BE | 96T | HIST2H2BE/Histone H2B-GL105/Histone H2B.q(H2B/q) |
| Human | EH2329 | Human DNAH17(Dynein heavy chain 17, axonemal) | DNAH17 | 96T | DNAH17/Dynein light chain 2, axonemal/Ciliary dynein heavy chain-like protein 1/Ciliary dynein heavy chain 17/Axonemal beta dynein heavy chain 17/Axonemal dynein heavy chain-like protein 1 |
| Human | EH2330 | Human MBLAC1(Metallo-beta-lactamase domain-containing protein 1) | MBLAC1 | 96T | MBLAC1 |
| Human | EH2331 | Human CYP2C19(Cytochrome P450 2C19) | CYP2C19 | 96T | CYP2C19/Cytochrome P450-11A/CYPIIC19/CYPIIC17/1.14.13.49/(S)-limonene 7-monooxygenase)/Mephenytoin 4-hydroxylase/Cytochrome P450-254C/1.14.13.80/(R)-limonene 6-monooxygenase)/1.14.13.48/(S)-limonene 6-monooxygenase)/ |
| Human | EH2332 | Human AOX1(Aldehyde oxidase) | AOX1 | 96T | AOX1/aldehyde oxidase/Azaheterocycle hydroxylase/aldehyde oxidase 1/AOAOH1/EC 1.2.3.1 |
| Human | EH2333 | Human ADAM29(Disintegrin and metalloproteinase domain-containing protein 29) | ADAM29 | 96T | ADAM29/Cancer/testis antigen 73(CT73)/ |
| Human | EH2334 | Human OPLAH(5-oxoprolinase) | OPLAH | 96T | OPLAH/5-oxo-L-prolinase(5-OPase)/Pyroglutamase |
| Human | EH2336 | Human APMAP(Adipocyte plasma membrane-associated protein) | APMAP | 96T | APMAP/Protein BSCv |
| Human | EH2337 | Human SAAL1(Protein SAAL1) | SAAL1 | 96T | SAAL1 |
| Human | EH2339 | Human SRF(Serum response factor) | SRF | 96T | SRF |
| Human | EH2340 | Human MTHFR(Methylenetetrahydrofolate reductase) | MTHFR | 96T | MTHFR |
| Human | EH2341 | Human DEFB119(Beta-defensin 119) | DEFB119 | 96T | DEFB119/ESC42-RELA/Defensin, beta 120/Defensin, beta 119/Beta-defensin 20(DEFB-20)/Beta-defensin 120/Beta-defensin 19(DEFB-19)/ |
| Human | EH2342 | Human DEFB124(Beta-defensin 124) | DEFB124 | 96T | DEFB124/Beta-defensin 24(DEFB-24)/Defensin, beta 124 |
| Human | EH2343 | Human SIPA1L1(Signal-induced proliferation-associated 1-like protein 1) | SIPA1L1 | 96T | SIPA1L1/High-risk human papilloma viruses E6 oncoproteins targeted protein 1(E6-targeted protein 1) |
| Human | EH2344 | Human F2RL3(Proteinase-activated receptor 4) | F2RL3 | 96T | F2RL3/Coagulation factor II receptor-like 3/Thrombin receptor-like 3/ |
| Human | EH2345 | Human TNN(Tenascin-N) | TNN | 96T | TNN |
| Human | EH2346 | Human HBP1(HMG box-containing protein 1) | HBP1 | 96T | HBP1/HMG box transcription factor 1/High mobility group box transcription factor 1/ |
| Human | EH2347 | Human TSPAN14(Tetraspanin-14) | TSPAN14 | 96T | TSPAN14/HMG box transcription factor 1/High mobility group box transcription factor 1/ |
| Human | EH2348 | Human NLGN4X(Neuroligin-4, X-linked) | NLGN4X | 96T | NLGN4X/ASPGX2/AUTSX2/HNLX/NL4/NLGN4/ASPGX2/HLNX/HNLX/KIAA1260AUTSX2/MGC22376/neuroligin 4, X-linked/NLGN/NLGN4neuroligin 4/X-linked |
| Human | EH2349 | Human PIP4K2C(Phosphatidylinositol-5-phosphate 4-kinase type-2 gamma) | PIP4K2C | 96T | PIP4K2C/Phosphatidylinositol-5-phosphate 4-kinase type II gamma(PI(5)P 4-kinase type II gamma/PIP4KII-gamma)/ |
| Human | EH2350 | Human CDK12(Cyclin-dependent kinase 12) | CDK12 | 96T | CDK12/Cell division protein kinase 12(hCDK12)/Cdc2-related kinase, arginine/serine-rich(CrkRS)/Cell division cycle 2-related protein kinase 7(CDC2-related protein kinase 7)/ |
| Human | EH2351 | Human LETMD1(LETM1 domain-containing protein 1) | LETMD1 | 96T | LETMD1/HCRR-2/HCCR-1/Cervical cancer 1 proto-oncogene protein p40/Cervical cancer proto-oncogene 2 protein/ |
| Human | EH2352 | Human PARM1(Prostate androgen-regulated mucin-like protein 1) | PARM1 | 96T | PARM1 |
| Human | EH2353 | Human SPINK7(Serine protease inhibitor Kazal-type 7) | SPINK7 | 96T | SPINK7/UNQ745/PRO1474/ECG2/ECRG-2/Esophagus cancer-related gene 2 protein |
| Human | EH2354 | Human FAF2(FAS-associated factor 2) | FAF2 | 96T | FAF2/ETEA/KIAA0887/UBXD8/UBXN3B/UBX domain-containing protein 8/Protein ETEA/UBX domain-containing protein 3B |
| Human | EH2355 | Human MTX3(Metaxin-3) | MTX3 | 96T | MTX3 |
| Human | EH2356 | Human FAM151A(Protein FAM151A) | FAM151A | 96T | FAM151A/UNQ3034/PRO9836/C1orf179 |
| Human | EH2357 | Human HOGA1(Probable 4-hydroxy-2-oxoglutarate aldolase, mitochondrial) | HOGA1 | 96T | HOGA1/DHDPSL/DHDPS-like protein/Probable KHG-aldolase/Protein 569272/Dihydrodipicolinate synthase-like/Probable 2-keto-4-hydroxyglutarate aldolase |
| Human | EH2358 | Human MTPAP(Poly(A) RNA polymerase, mitochondrial) | MTPAP | 96T | MTPAP/PAPD1/PAP/TUTase 1/mtPAP/Terminal uridylyltransferase 1/PAP-associated domain-containing protein 1/Polynucleotide adenylyltransferase |
| Human | EH2359 | Human ZNF654(Zinc finger protein 654) | ZNF654 | 96T | ZNF654/Melanoma-associated antigen |
| Human | EH2360 | Human ERN1(Serine/threonine-protein kinase/endoribonuclease IRE1) | ERN1 | 96T | ERN1/IRE1/IRE1a/Ire1-alpha/hIRE1p/Endoplasmic reticulum-to-nucleus signaling 1/Inositol-requiring protein 1/Serine,threonine-protein kinase/endoribonuclease IRE1 |
| Human | EH2361 | Human PIN1(Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1) | PIN1 | 96T | PIN1/dod/DOD/UBL5/peptidyl-prolyl cis,trans isomerase, NIMA-interacting/peptidylprolyl cis,trans isomerase, NIMA-interacting 1/peptidyl-prolyl cis-trans isomerase NIMA-interacting 1/Peptidyl-prolyl cis-trans isomerase Pin1/PPIase Pin1/prolyl isomerase/protein(peptidyl-prolyl cis,trans isomerase) NIMA-interacting 1/protein(peptidylprolyl cis,trans isomerase) NIMA-interacting 1/Rotamase Pin1 |
| Human | EH2362 | Human CES5A(Carboxylesterase 5A) | CES5A | 96T | CES5A/CES7/Cauxin/Carboxylesterase-like urinary excreted protein homolog |
| Human | EH2363 | Human COQ10A(Coenzyme Q-binding protein COQ10 homolog A, mitochondrial) | COQ10A | 96T | COQ10A |
| Human | EH2364 | Human METRNL(Meteorin-like protein) | METRNL | 96T | METRNL/meteorin, glial cell differentiation regulator-like/meteorin-like protein/MGC99788 |
| Human | EH2365 | Human C9orf140(Protein C9orf140) | C9orf140 | 96T | C9orf140/TS/MDEP/Tumor specificity and mitosis phase-dependent ｅxpression protein/p42.3 |
| Human | EH2367 | Human EFHD2(EF-hand domain-containing protein D2) | EFHD2 | 96T | EFHD2/SWS1/Swiprosin-1 |
| Human | EH2368 | Human CDH6(Cadherin-6) | CDH6 | 96T | CDH6/K-Cadherin/cadherin 6, type 2, K-cadherin(fetal kidney)/cadherin, fetal kidney/cadherin-6/KCAD/K-cadherin/K-cadherin(fetal kidney) |
| Human | EH2369 | Human MC5R(Melanocortin receptor 5) | MC5R | 96T | MC5R/MC5-R/MC-2/MC-2/MC5-R/melanocortin 5 receptor/melanocortin receptor 5/melanocortin-5 receptor |
| Human | EH2370 | Human ARC(Activity-regulated cytoskeleton-associated protein) | ARC | 96T | ARC/ARG3.1/mArc/Activity-regulated gene 3.1 protein homolog |
| Human | EH2371 | Human LILRB2(Leukocyte immunoglobulin-like receptor subfamily B member 2) | LILRB2 | 96T | LILRB2/CD85d/ILT4/LIR2/MIR10/CD85 antigen-like family member D/CD85d antigen/Ig-like transcript 4/ILT-4/Immunoglobulin-like transcript 4/Leukocyte immunoglobulin-like receptor 2/leukocyte immunoglobulin-like receptor subfamily B member 2/leukocyte immunoglobulin-like receptor subfamily B member 2 soluble isoform/leukocyte immunoglobulin-like receptor, subfamily B(with TM and ITIM domains)/LIR-2/subfamily A(with TM domain), member 6/member 2/LILRA6/Monocyte/macrophage immunoglobulin-like receptor 10 |
| Human | EH2372 | Human SUSD2(Sushi domain-containing protein 2) | SUSD2 | 96T | SUSD2 |
| Human | EH2373 | Human UNC5C(Netrin receptor UNC5C) | UNC5C | 96T | UNC5C/UNC5H3/netrin receptor UNC5C/Protein unc-5 homolog 3/Protein unc-5 homolog C/unc-5 homolog 3/unc-5 homolog C(C. elegans)/UNC5H3unc5(C.elegans homolog) c |
| Human | EH2374 | Human ADAL(Adenosine deaminase-like protein) | ADAL | 96T | ADAL |
| Human | EH2375 | Human ZAP70(Tyrosine-protein kinase ZAP-70) | ZAP70 | 96T | ZAP70/mrtle/mur/SRK/STD/TZK/70 kDa zeta-associated protein/EC 2.7.10/EC 2.7.10.2/SRKFLJ17679/STDFLJ17670/Syk-related tyrosine kinase/tyrosine-protein kinase ZAP-70/TZK/ZAP-70/zeta-chain(TCR) associated protein kinase(70 kD)/zeta-chain(TCR) associated protein kinase 70kDa/zeta-chain associated protein kinase, 70kD |
| Human | EH2376 | Human UTRN(Utrophin) | UTRN | 96T | UTRN/DMDL/DRP1/Dystrophin-related protein 1/DRP-1 |
| Human | EH2377 | Human ABCB1(Multidrug resistance protein 1) | ABCB1 | 96T | ABCB1/MDR1/PGY1/CD243/ATP-binding cassette sub-family B member 1/P-glycoprotein 1/ABC20/ABCB1B/CLCS/GP170/IBD13/ATP-binding cassette, sub-family B(MDR/TAP), member 1/CD243 antigen/CLCS/colchicin sensitivity/doxorubicin resistance/EC 3.6.3/EC 3.6.3.44/MDR1MGC163296/multidrug resistance protein 1/P-glycoprotein 1/P-gp/PGY1P-GP |
| Human | EH2378 | Human DNAJB3(DnaJ homolog subfamily B member 3) | DNAJB3 | 96T | DNAJB3/HCG3 |
| Human | EH2379 | Human SRSF1(Serine/arginine-rich splicing factor 1) | SRSF1 | 96T | SRSF1/ASF/SF2/SF2P33/SFRS1/ASF-1/pre-mRNA-splicing factor SF2, P33 subunit/Alternative-splicing factor 1/Splicing factor, arginine/serine-rich 1/OK/SW-cl.3/ |
| Human | EH2380 | Human PSCA(Prostate stem cell antigen) | PSCA | 96T | PSCA/RO232/prostate stem cell antigen |
| Human | EH2381 | Human EPX(Eosinophil peroxidase) | EPX | 96T | EPX/EPER/EPO/EPP |
| Human | EH2382 | Human TNFRSF12A(Tumor necrosis factor receptor superfamily member 12A) | TNFRSF12A | 96T | TNFRSF12A/Fn14/TNFRSF12/CD266/CD266 antigen/FGF-inducible 14/Fibroblast growth factor-inducible immediate-early response protein 14/FN14tumor necrosis factor receptor superfamily member 12A/tumor necrosis factor receptor superfamily, member 12A/TWEAKR/TweakR/Tweak-receptor/tweak-receptor/type I transmembrane protein Fn14 |
| Human | EH2383 | Human TEC(Tyrosine-protein kinase Tec) | TEC | 96T | TEC/PSCTK4/EC 2.7.10/EC 2.7.10.2/MGC126760/MGC126762/tyrosine-protein kinase Tec/tec protein tyrosine kinase |
| Human | EH2384 | Human MSH2(DNA mismatch repair protein Msh2) | MSH2 | 96T | MSH2/MSH2/COCA1/FCC1/HNPCC/HNPCC1/LCFS2/MutS protein homolog 2/LCFS2/DNA mismatch repair protein Msh2/hMSH2/HNPCC1mutS(E. coli) homolog 2(colon cancer, nonpolyposis type 1)/LCFS2/mutS homolog 2, colon cancer, nonpolyposis type 1(E. coli)/MutS protein homolog 2 |
| Human | EH2385 | Human NF1(Neurofibromin) | NF1 | 96T | NF1/Neurofibromatosis-related protein NF-1 |
| Human | EH2386 | Human TOP2A(DNA topoisomerase 2-alpha) | TOP2A | 96T | TOP2A/TOP2/TP2A/DNA topoisomerase II, alpha isozyme/DNA topoisomerase(ATP-hydrolyzing)/DNA topoisomerase 2-alpha/TOP2DNA gyrase/topoisomerase(DNA) II alpha(170kD)/topoisomerase(DNA) II alpha 170kDa |
| Human | EH2388 | Human NEFA(Nesfatin-1) | NEFA | 96T | NEFA |
| Human | EH2389 | Human MT-CO1(Cytochrome c oxidase subunit 1) | MT-CO1 | 96T | MT-CO1/Cytochrome c oxidase polypeptide I |
| Human | EH2390 | Human LAMB1(Laminin subunit beta-1) | LAMB1 | 96T | LAMB1/CLM/Laminin-6 subunit beta/Laminin-2 subunit beta/Laminin-12 subunit beta/Laminin-10 subunit beta/Laminin-8 subunit beta/Laminin B1 chain/Laminin-1 subunit beta |
| Human | EH2394 | Human FBN2(Fibrillin-2) | FBN2 | 96T | FBN2 |
| Human | EH2395 | Human TGFBR1(TGF-beta receptor type-1) | TGFBR1 | 96T | TGFBR1/AAT5/ALK5/MSSE/SKR4/ALK-5/LDS1A/LDS2A/TGFR-1/ACVRLK4/Transforming growth factor-beta receptor type I(TGF-beta receptor type I/TbetaR-I)/TGF-beta type I receptor/Serine/threonine-protein kinase receptor R4(SKR4)/Activin A receptor type II-like protein kinase of 53kD/Activin receptor-like kinase 5(ALK-5/ALK5)/Activin receptor-like kinase 5/ACVRLK4/ALK-5ALK5/LDS1A/LDS2A/Serine/threonine-protein kinase receptor R4/SKR4/tbetaR-I/TbetaR-I/TGF-beta receptor type I/TGF-beta type I receptor/TGFR-1/transforming growth factor beta receptor I/Transforming growth factor-beta receptor type I |
| Human | EH2396 | Human NRGN(Neurogranin) | NRGN | 96T | NRGN/RC3/hng |
| Human | EH2397 | Human PRKCG(Protein kinase C gamma type) | PRKCG | 96T | PRKCG/PKCC/PKCG/SCA14/PKC-gamma/ MGC57564/PKCCSCA14/PKCGprotein kinase C gamma type/protein kinase C, gamma |
| Human | EH2398 | Human PRKCE(Protein kinase C epsilon type) | PRKCE | 96T | PKCε(Protein Kinase C Epsilon )/PRKCE/PKCE/nPKC-epsilon/MGC125656/PKCEMGC125657/protein kinase C epsilon type/protein kinase C, epsilon |
| Human | EH2399 | Human DSG3(Desmoglein-3) | DSG3 | 96T | DSG3/CDHF6/DKFZp686P23184/PVA/130 kDa pemphigus vulgaris antigen(PVA)/Cadherin family member 6/Cadherin family member 6/CDHF6130-kD pemphigus vulgaris antigen/desmoglein 3/desmoglein 3(pemphigus vulgaris antigen)/desmoglein-3/DKFZp686P23184,130 kDa pemphigus vulgaris antigen/pemphigus vulgaris antigen |
| Human | EH2400 | Human IFITM10(Interferon-induced transmembrane protein 10) | IFITM10 | 96T | IFITM10/Dispanin subfamily A member 3 |
| Human | EH2401 | Human NOX1(NADPH oxidase 1) | NOX1 | 96T | NOX1/NOH-1/Mitogenic oxidase 1(MOX-1)/NADH/NADPH mitogenic oxidase subunit P65-MOX/Nicotinamide Adenine Dinucleotide Phosphate Oxidase 1 |
| Human | EH2402 | Human TRAF6(TNF receptor-associated factor 6) | TRAF6 | 96T | TRAF6/RNF85/MGC:3310/RING finger protein 85/E3 ubiquitin-protein ligase TRAF6/Interleukin-1 signal transducer/E3 ubiquitin-protein ligase TRAF6/EC 6.3.2.-/Interleukin-1 signal transducer/RING finger protein 85/RNF85MGC:3310/TNF receptor-associated factor 6 |
| Human | EH2403 | Human SCUBE1(Signal peptide, CUB and EGF-like domain-containing protein 1) | SCUBE1 | 96T | SCUBE1 |
| Human | EH2404 | Human SRY(Sex-determining region Y protein) | SRY | 96T | SRY/TDF/Sex-determining region Y protein/Testis-determining factor |
| Human | EH2405 | Human HEXB(Beta-hexosaminidase subunit beta) | HEXB | 96T | HEXB/ENC-1AS/N-acetyl-beta-glucosaminidase subunit beta/Beta-N-acetylhexosaminidase subunit beta(Hexosaminidase subunit B)/Cervical cancer proto-oncogene 7 protein(HCC-7)/ENC-1AS/HCC-7/HEL-248/beta-hexosaminidase subunit beta/Beta-N-acetylhexosaminidase subunit beta/Cervical cancer proto-oncogene 7 protein/hexosaminidase B(beta polypeptide)/Hexosaminidase subunit B/N-acetyl-beta-glucosaminidase subunit beta |
| Human | EH2406 | Human BCHE(Cholinesterase) | BCHE | 96T | BCHE/Cholinesterase/Pseudocholinesterase/Choline esterase II/Acylcholine acylhydrolase/Butyrylcholine esterase/CHE1/Pseudocholinesterase/butyrylcholinesterase/CHE1cholinesterase/cholinesterase 1/pseudocholinesterase/Pseudocholinesterase/ |
| Human | EH2407 | Human INPP5D(Phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase 1) | INPP5D | 96T | INPP5D/MGC104855/MGC142140/MGC142142/SHIP/SHIP1/SIP-145/hp51CN/p150Ship(hp51CN)/Inositol polyphosphate-5-phosphatase of 145 kDa(SIP-145)/SH2 domain-containing inositol-5'-phosphatase 1(SH2 domain-containing inositol phosphatase 1/SHIP-1)/Inositol polyphosphate-5-phosphatase of 145 kDa/inositol polyphosphate-5-phosphatase, MGC104855 |
| Human | EH2408 | Human SERPINA11(Serpin A11) | SERPINA11 | 96T | SERPINA11/Antiproteinase-Like 2/antiproteinase-like 2/antitrypsin), member 11/member 11/serine(or cysteine) proteinase inhibitor, clade A(alpha-1 antiproteinase/serpin A11/serpin peptidase inhibitor, clade A(alpha-1 antiproteinase, antitrypsin) |
| Human | EH2409 | Human PAF(PCNA-associated factor) | PAF | 96T | PAF/KIAA0101(PCNA-associated factor)/L5/NS5ATP9/PAF15/HCV NS5A-transactivated protein 9/OEATC-1/PCNA-associated factor of 15 kDa/Hepatitis C virus NS5A-transactivated protein 9/Overexpressed in anaplastic thyroid carcinoma 1 |
| Human | EH2410 | Human ABO(Histo-blood group ABO system transferase) | ABO | 96T | ABO/Histo-blood group B transferase(B transferase)/Histo-blood group A transferase(A transferase)/Glycoprotein-fucosylgalactoside alpha-galactosyltransferase)/Glycoprotein-fucosylgalactoside alpha-N-acetylgalactosaminyltransferase)/NAGAT/Fucosylglycoprotein 3-alpha-galactosyltransferase/Fucosylglycoprotein alpha-N-acetylgalactosaminyltransferase |
| Human | EH2412 | Human OGN(Mimecan) | OGN | 96T | OGN/Osteoglycin/Osteoinductive factor/KSPG25/OIF/SLRR3A/DKFZp586P2421/mimecan/mimecan proteoglycan/OIFOG/Osteoglycin/osteoglycin/osteoglycin(osteoinductive factor)/Osteoinductive factor/SLRR3Acorneal keratan sulfate proteoglycan |
| Human | EH2413 | Human PPP1R9B(Neurabin-2) | PPP1R9B | 96T | PPP1R9B/Spinophilin/Neurabin-II/Protein phosphatase 1 regulatory subunit 9B/Neurabin-2/PPP1R6/SPINO/Spinophilin/FLJ30345/neurabin II/neurabin-2/neurabin-II/Neurabin-II/PPP1R6/PPP1R9/Protein phosphatase 1 regulatory subunit 9B/protein phosphatase 1, regulatory(inhibitor) subunit 9B/protein phosphatase 1, regulatory subunit 9B, spinophilin/SPINO/spinophilin/Spinophilin/Spn |
| Human | EH2414 | Human AASDH(Acyl-CoA synthetase family member 4) | AASDH | 96T | AASDH/HSPC318/ACSF4/U26/Protein NRPS998/Protein NRPS998 |
| Human | EH2415 | Human TNFRSF10B(Tumor necrosis factor receptor superfamily member 10B) | TNFRSF10B | 96T | TNFRSF10B/CD262/DR5/CD262 antigen/death domain containing receptor for TRAIL,Apo-2L/Death receptor 5/DR5TRICK2B/Fas-like protein/KILLER,DR5/KILLERapoptosis inducing protein TRICK2A,2B/TNF-related apoptosis-inducing ligand receptor 2/TRAIL receptor 2/TRAIL-R2apoptosis inducing receptor TRAIL-R2/TRAILR2cytotoxic TRAIL receptor-2/TRICK2/TRICK2A/TRICKB/tumor necrosis factor receptor superfamily member 10B/tumor necrosis factor receptor superfamily, member 10b/tumor necrosis factor receptor-like protein ZTNFR9/ZTNFR9 |
| Human | EH2418 | Human PLA2G2A(Phospholipase A2, membrane associated) | PLA2G2A | 96T | PLA2G2A/Mom1/PLA2B/PLA2L/RASF-A/GIIC sPLA2/Group IIA phospholipase A2/MOM1/Non-pancreatic secretory phospholipase A2/NPS-PLA2/Phosphatidylcholine 2-acylhydrolase 2A/phospholipase A2, group IIA(platelets, synovial fluid)/phospholipase A2, membrane associated/PLA2BPLA2/PLA2LPLA2S/PLAS1/RASF-A/sPLA2 |
| Human | EH2420 | Human IK(Protein Red) | IK | 96T | IK/Protein RER/Cytokine IK/IK factor |
| Human | EH2421 | Human FCER1A(High affinity immunoglobulin epsilon receptor subunit alpha) | FCER1A | 96T | FCER1A/FCE1A/FcERI/Fc-epsilon RI-alpha/IgE Fc receptor subunit alpha/ |
| Human | EH2422 | Human BIN1(Myc box-dependent-interacting protein 1) | BIN1 | 96T | BIN1/Bridging integrator 1/Box-dependent myc-interacting protein 1/Amphiphysin II/Amphiphysin-like protein/ |
| Human | EH2423 | Human FUT3(Galactoside 3(4)-L-fucosyltransferase) | FUT3 | 96T | FUT3/CD174/FT3B/FucT-III/Les/Lewis FT |
| Human | EH2424 | Human HSF4(Heat shock factor protein 4) | HSF4 | 96T | HSF4/ATHSF4/AT-HSFB1/CTM/HSFB1/cataract, Marner/heat shock factor protein 4/heat shock transcription factor 4CTM/hHSF4/HSF 4/HSTF 4 |
| Human | EH2425 | Human TXLNA(Alpha-taxilin) | TXLNA | 96T | TXLNA/IL-14/alpha-taxilin/IL14/interleukin 14/taxilin alpha/TXLN |
| Human | EH2426 | Human GPC4(Glypican-4) | GPC4 | 96T | GPC4/K-glypican |
| Human | EH2427 | Human LAIR1(Leukocyte-associated immunoglobulin-like receptor 1) | LAIR1 | 96T | LAIR1/CD305/CD305 antigen/CD305leukocyte-associated Ig-like receptor 1/hLAIR1/LAIR-1/leukocyte-associated immunoglobulin-like receptor 1 |
| Human | EH2428 | Human RUNX2(Runt-related transcription factor 2) | RUNX2 | 96T | RUNX2/CBFA1/Acute myeloid leukemia 3 protein/AML3CCD/Core-binding factor subunit alpha-1/PEA2-alpha A/PEBP2A/PEBP2A1CCD1/PEBP2aA1/PEBP2-alpha A/runt domain, alpha subunit 1/runt-related transcription factor 2/SL3,AKV core-binding factor alpha A subunit/SL3-3 enhancer factor 1 alpha A subunit |
| Human | EH2429 | Human GPC1(Glypican-1) | GPC1 | 96T | GPC1/FLJ38078/glypican/glypican 1/glypican proteoglycan 1 |
| Human | EH2430 | Human DKK2(Dickkopf-related protein 2) | DKK2 | 96T | DKK2/dickkopf(Xenopus laevis) homolog 2/dickkopf 2/dickkopf homolog 2(Xenopus laevis)/dickkopf related protein-2/dickkopf-2/Dickkopf-2/dickkopf-related protein 2/DKK-2/Dkk-2/hDkk-2 |
| Human | EH2431 | Human PDX1(Pancreas/duodenum homeobox protein 1) | PDX1 | 96T | PDX1/IDX1/IPF1/Glucose-sensitive factor/IDX-1GSF/Insulin promoter factor 1/insulin promoter factor 1, homeodomain transcription factor/Insulin upstream factor 1/IPF1pancreas,duodenum homeobox protein 1/Islet,duodenum homeobox-1/MODY4IUF1/pancreatic and duodenal homeobox 1/pancreatic-duodenal homeobox factor 1/PDX-1IPF-1/somatostatin transcription factor 1/Somatostatin-transactivating factor 1/STF-1IUF-1 |
| Human | EH2432 | Human C19orf10(UPF0556 protein C19orf10) | C19orf10 | 96T | C19orf10/MYDGF/chromosome 19 open reading frame 10/IL-25/IL25IL27w/IL27/IL-27/interleukin 25/interleukin 27 working designation/Interleukin-25/SF20hypothetical protein LOC56005/stromal cell-derived growth factor/Stromal cell-derived growth factor SF20 |
| Human | EH2433 | Human UBE3A(Ubiquitin-protein ligase E3A) | UBE3A | 96T | UBE3A/ANCR/EPVE6AP/HPVE6A/ANCREPVE6AP/AS/CTCL tumor antigen se37-2/E6AP/E6-AP/E6AP ubiquitin-protein ligase/HPVE6A/human papilloma virus E6-associated protein/Human papillomavirus E6-associated protein/oncogenic protein-associated protein E6-AP/Renal carcinoma antigen NY-REN-54/ubiquitin protein ligase E3A/ubiquitin-protein ligase E3A |
| Human | EH2434 | Human CHIA(Acidic mammalian chitinase) | CHIA | 96T | CHIA/Lung-specific protein TSA1902/AMCase |
| Human | EH2435 | Human ENTPD1(Ectonucleoside triphosphate diphosphohydrolase 1) | ENTPD1 | 96T | ENTPD1/ADPase/ATP-diphosphatase/CD39/NTPD1/ATPDase/CD39 antigen/ecto-apyrase/Ecto-apyrase/Ecto-ATP diphosphohydrolase 1/Ecto-ATPase 1/Ecto-ATPDase 1/ectonucleoside triphosphate diphosphohydrolase 1/FLJ40921/FLJ40959/Lymphoid cell activation antigen/NTPDase 1/NTPDase-1 |
| Human | EH2436 | Human MAPK8(Mitogen-activated protein kinase 8) | MAPK8 | 96T | MAPK8/PRKM8/SAPK1/c-Jun N-terminal kinase 1/JNK1 alpha protein kinase/JNK1 beta protein kinase/JNK1JNK1A2/JNK-46/JUN N-terminal kinase/MAP kinase 8/MAPK 8/mitogen-activated protein kinase 8/mitogen-activated protein kinase 8 isoform JNK1 alpha1/mitogen-activated protein kinase 8 isoform JNK1 beta2/PRKM8JNK/protein kinase JNK1/SAPK1JNK21B1,2/Stress-activated protein kinase 1/Stress-activated protein kinase JNK1 |
| Human | EH2437 | Human MAPK14(Mitogen-activated protein kinase 14) | MAPK14 | 96T | MAPK14/SAPK2A/SAPK2a/Mitogen-activated protein kinase p38 alpha/MAP kinase p38 alpha/MAX-interacting protein 2/Cytokine suppressive anti-inflammatory drug-binding protein/CSAID-binding protein/CSBP/MAP kinase MXI2 |
| Human | EH2438 | Human DDIT3(DNA damage-inducible transcript 3 protein) | DDIT3 | 96T | DDIT3/CEBP zeta/CHOP/CHOP10/C,EBP-homologous protein/C,EBP-homologous protein 10/CCAAT,enhancer-binding protein homologous protein/CHOP-10/CHOP10 CEBPZ/CHOPC,EBP zeta/DDIT-3/DNA damage-inducible transcript 3 protein/DNA-damage-inducible transcript 3/GADD153/Growth arrest and DNA damage-inducible protein GADD153 |
| Human | EH2439 | Human GZMK(Granzyme K) | GZMK | 96T | GZMK/NK-tryptase-2/NK-Tryp-2/Fragmentin-3/Granzyme-3 |
| Human | EH2440 | Human AVPR1B(Vasopressin V1b receptor) | AVPR1B | 96T | AVPR1B/AVPR3/V1bR/VPR3/Antidiuretic hormone receptor 1b/arginine vasopressin receptor 1B/AVPR V1b/AVPR V3/AVPR3arginine vasopressin receptor 3/pituitary vasopressin receptor 3/V1bR/vasopressin V1b receptor/Vasopressin V3 receptor/VPR3 |
| Human | EH2441 | Human AVPR1A(Vasopressin V1a receptor) | AVPR1A | 96T | AVPR1A/AVPR V1a/V1aR/Antidiuretic hormone receptor 1a/arginine vasopressin receptor 1A/AVPR V1a/AVPR1/SCCL vasopressin subtype 1a receptor/V1a vasopressin receptor/V1aR/V1-vascular vasopressin receptor AVPR1A/Vascular,hepatic-type arginine vasopressin receptor/vasopressin V1a receptor |
| Human | EH2442 | Human JAK2(Tyrosine-protein kinase JAK2) | JAK2 | 96T | JAK2/JAK-1/JAK1Atyrosine-protein kinase JAK1/JAK1B/Janus kinase 1/JTK3 |
| Human | EH2443 | Human LAD1(Ladinin-1) | LAD1 | 96T | LAD1/Lad-1/Linear IgA disease antigen/LADA |
| Human | EH2444 | Human XBP1(X-box-binding protein 1) | XBP1 | 96T | XBP1/HTF/TREB5/XBP2/TREB5/X-box binding protein 1/X-box-binding protein 1/XBP-1/XBP2Tax-responsive element-binding protein 5 |
| Human | EH2445 | Human ITGA5(Integrin alpha-5) | ITGA5 | 96T | ITGA5/CD49e/VLA-5 alpha/CD49 antigen-like family member E/CD49e/CD49e antigen/Fibronectin receptor subunit alpha/fibronectin receptor, alpha subunit/FNRAVLA5A/integrin alpha-5/Integrin alpha-F/integrin, alpha 5(fibronectin receptor, alpha polypeptide)/very late activation protein 5, alpha subunit/VLA-5 |
| Human | EH2447 | Human HLA-DRB1-15(HLA class II histocompatibility antigen, DRB1-15 beta chain) | HLA-DRB1-15 | 96T | HLA-DRB1-15/MHC class II antigen DRB1-15 |
| Human | EH2449 | Human PEPD(Xaa-Pro dipeptidase) | PEPD | 96T | PEPD/Proline dipeptidase(Prolidase)/Imidodipeptidase/Peptidase D/PRD |
| Human | EH2450 | Human EBI3(Interleukin-27 subunit beta) | EBI3 | 96T | EBI3/Epstein-Barr virus-induced gene 3 protein(EBV-induced gene 3 protein)/IL-27 subunit beta/IL-27B/IL-27/IL-27 p28 subunit/ |
| Human | EH2451 | Human LILRA2(Leukocyte immunoglobulin-like receptor subfamily A member 2) | LILRA2 | 96T | LILRA2/Leukocyte immunoglobulin-like receptor 7(LIR-7)/CD85 antigen-like family member H/Immunoglobulin-like transcript 1(ILT-1)/CD85H/ILT1/LIR-7/LIR7/CD85h/ILT1/LIR7/CD85 antigen-like family member H/CD85h/CD85h antigen/ILT-1/Leukocyte immunoglobulin-like receptor 7/leukocyte immunoglobulin-like receptor subfamily A member 2/leukocyte immunoglobulin-like receptor subfamily A member 2 soluble/leukocyte immunoglobulin-like receptor, subfamily A(with TM domain), member 2/LIR7/LIR-7Immunoglobulin-like transcript 1 |
| Human | EH2452 | Human LILRB1(Leukocyte immunoglobulin-like receptor subfamily B member 1) | LILRB1 | 96T | LILRB1/Monocyte/macrophage immunoglobulin-like receptor 7(MIR-7)/CD85 antigen-like family member J/Immunoglobulin-like transcript 2(ILT-2)/LIR-1/Leukocyte immunoglobulin-like receptor 1/CD85j/ILT2/LIR1/MIR7/CD85 antigen-like family member J/CD85j/CD85j antigen/Ig-like transcript 2/ILT-2/ILT2FLJ37515/Immunoglobulin-like transcript 2/leukocyte Ig-like receptor-1/Leukocyte immunoglobulin-like receptor 1/leukocyte immunoglobulin-like receptor subfamily B member 1/leukocyte immunoglobulin-like receptor subfamily B member 1 soluble isoform/leukocyte immunoglobulin-like receptor, subfamily B(with TM and ITIM domains)/Monocyte/macrophage immunoglobulin-like receptor 7 |
| Human | EH2453 | Human EGFL7(Epidermal growth factor-like protein 7) | EGFL7 | 96T | EGFL7/Zneu1/Vascular endothelial statin(VE-statin)/Multiple epidermal growth factor-like domains protein 7(Multiple EGF-like domains protein 7)/NOTCH4-like protein/EGF-like protein 7/EGFL7/MEGF7/NOTCH4-like protein/ZNEU1/EGF-like protein 7/EGF-like-domain, multiple 7/epidermal growth factor-like protein 7/MEGF7/Multiple EGF-like domains protein 7/Multiple epidermal growth factor-like domains protein 7/NEU1 protein/NOTCH4-like protein/RP11-251M1.2/Vascular endothelial statin/VE-STATIN/VE-statin/Zneu1/ZNEU1 |
| Human | EH2454 | Human ECE1(Endothelin-converting enzyme 1) | ECE1 | 96T | ECE1/ECE/ECE-1/endothelin converting enzyme 1/endothelin-converting enzyme 1 |
| Human | EH2455 | Human NDNF(Protein NDNF) | NDNF | 96T | NDNF/Neuron-derived neurotrophic factor |
| Human | EH2456 | Human ATP2A3(Sarcoplasmic/endoplasmic reticulum calcium ATPase 3) | ATP2A3 | 96T | ATP2A3/Calcium pump 3/SERCA3/SR Ca(2+)-ATPase 3 |
| Human | EH2457 | Human IFNA14(Interferon alpha-14) | IFNA14 | 96T | IFNA14/Interferon alpha-H(LeIF H)/Interferon lambda-2-H/IFN-alpha-14 |
| Human | EH2458 | Human CXCR7(C-X-C chemokine receptor type 7) | CXCR7 | 96T | CXCR7/G-protein coupled receptor RDC1 homolog(RDC-1)/Chemokine orphan receptor 1/G-protein coupled receptor 159/CXC-R7/CXCR-7/ACKR3/CMKOR1/CXCR7/GPR159/RDC-1/chemokine(C-X-C motif) receptor 7/Chemokine orphan receptor 1CMKOR1C-X-C chemokine receptor type 7/CXC-R7/CXCR-7/G protein-coupled receptor/GPR159G-protein coupled receptor 159/RDC-1/RDC1G-protein coupled receptor RDC1 homolog |
| Human | EH2459 | Human IL3RA(Interleukin-3 receptor) | IL3RA | 96T | IL3RA/IL-3 receptor subunit alpha/IL-3R subunit alpha/IL-3R-alpha/IL-3RA/CD123/IL3RA/CD123/CD123 antigen/hIL3Ra/hIL-3Ra/IL-3 receptor subunit alpha/IL3R/IL-3R subunit alpha/IL-3RA/IL-3R-alpha/IL3RAY/IL3RX/IL3RY/interleukin 3 receptor, alpha(low affinity)/interleukin-3 receptor subunit alpha |
| Human | EH2460 | Human IL2RG(Cytokine receptor common subunit gamma) | IL2RG | 96T | IL2RG/p64/Interleukin-2 receptor subunit gamma(IL-2 receptor subunit gamma/IL-2R subunit gamma/IL-2RG)/gammaC/CD132/IL-2 R gamma/IL2RG/CD132/CD132 antigen/CIDX/combined immunodeficiency, X-linked/common cytokine receptor gamma chain/common gamma-chain/cytokine receptor common subunit gamma/gamma(c)/IL-2 receptor subunit gamma/IL-2R subunit gamma/IL-2RG/IMD4/interleukin 2 receptor, gamma/Interleukin-2 receptor subunit gamma/P64/p64/SCIDX/SCIDX1/severe combined immunodeficiency |
| Human | EH2461 | Human IRAK3(Interleukin-1 receptor-associated kinase 3) | IRAK3 | 96T | IRAK3/IL-1 receptor-associated kinase M(IRAK-M)/ASRT5/IRAK-M/ASRT5/EC 2.7.11.1/IL-1 receptor-associated kinase M/interleukin-1 receptor-associated kinase 3/IRAK-3/IRAKM/IRAK-M |
| Human | EH2462 | Human COMT(Catechol O-methyltransferase) | COMT | 96T | COMT/catechol O-methyltransferase/catechol-O-methyltransferase/EC 2.1.1.6/ |
| Human | EH2463 | Human DHFR(Dihydrofolate reductase) | DHFR | 96T | DHFR/DHFR/DHFRP1/DYR/DHFRP1/dihydrofolate reductase/DYR/EC 1.5.1.3 |
| Human | EH2464 | Human IFNA10(Interferon alpha-10) | IFNA10 | 96T | IFNA10/IFN-alpha-10/IFN-alphaC/interferon alpha-10/Interferon alpha-6L/Interferon alpha-C/interferon, alpha 10/LeIF C/Interferon alpha-6L/Interferon alpha-C(LeIF C) |
| Human | EH2465 | Human IFNA8(Interferon alpha-8) | IFNA8 | 96T | IFNA8/IFN-alpha-8/IFN-alphaB/interferon alpha type 201/interferon alpha-8/Interferon alpha-B/interferon alpha-B'/Interferon alpha-B2/interferon, alpha 8/LeIF B/Interferon alpha-B(LeIF B)/Interferon alpha-B2 |
| Human | EH2467 | Human S100A10(Protein S100-A10) | S100A10 | 96T | S100A10/annexin II ligand, calpactin I, light polypeptide/ANX2L/ANX2LG/CAL1LGP11,42C/Calpactin I light chain/Calpactin-1 light chain/Cellular ligand of annexin II/CLP11Ca[1]/MGC111133/p10/p10 protein/p11/P11/protein S100-A10/S100 calcium binding protein A10/S100 calcium binding protein A10(annexin II ligand, calpactin I, lightpolypeptide(p11))/S100 calcium-binding protein A10/S100 calcium-binding protein A10(annexin II ligand, calpactin I, lightpolypeptide(p11)) |
| Human | EH2468 | Human KAP(Kidney androgen-regulated protein) | KAP | 96T | KAP/ARP/KAP |
| Human | EH2469 | Human PRNP(Major prion protein) | PRNP | 96T | PRNP/PrP33-35C/ASCR/PrP27-30/CJD/GSS/PrP/ASCR/KURU/PRIP/PrPc/CD230/AltPrP/p27-30/PrP33-35C |
| Human | EH2470 | Human STAT5B(Signal transducer and activator of transcription 5B) | STAT5B | 96T | STAT5B/signal transducer and activator of transcription 5B/STAT5/transcription factor STAT5B |
| Human | EH2471 | Human FZD4(Frizzled-4) | FZD4 | 96T | FZD4/FzE4/CD344/FZD4/CD344/CD344 antigen/EVR1/exudative vitreoretinopathy 1/FEVR/frizzled(Drosophila) homolog 4/frizzled homolog 4(Drosophila)/frizzled-4/Fz-4/FZD4S/FzE4/GPCR/hFz4/MGC34390/WNT receptor frizzled-4 |
| Human | EH2472 | Human UBQLN1(Ubiquilin-1) | UBQLN1 | 96T | UBQLN1/DA41/DSK2/PLIC-1/UBQLN1/UBQN/XDRP1/DA41FLJ90054/DSK2/hPLIC-1/PLIC1/PLIC-1UBQN/Protein linking IAP with cytoskeleton 1/ubiquilin 1/ubiquilin-1/XDRP1 |
| Human | EH2473 | Human NFKB2(Nuclear factor NF-kappa-B p100 subunit) | NFKB2 | 96T | NFKB2/oncogene Lyt-10(Lyt10)/Nuclear factor of kappa light polypeptide gene enhancer in B-cells 2/Lymphocyte translocation chromosome 10 protein/DNA-binding factor KBF2/H2TF1/LYT10 |
| Human | EH2474 | Human APOC4(Apolipoprotein C-IV) | APOC4 | 96T | APOC4(Apolipoprotein C4)/Apo-CIV/ApoC-IV/Apolipoprotein C-IV |
| Human | EH2475 | Human CCDC82(Coiled-coil domain-containing protein 82) | CCDC82 | 96T | CCDC82/Coiled-coil domain-containing protein 82/HT025 |
| Human | EH2476 | Human HMGN1(Non-histone chromosomal protein HMG-14) | HMGN1 | 96T | HMGN1/HMG14/High mobility group nucleosome-binding domain-containing protein 1/high-mobility group(nonhistone chromosomal) protein 14/high-mobility group nucleosome binding 1/high-mobility group nucleosome binding domain 1//non-histone chromosomal protein HMG-14/nonhistone chromosomal protein HMG-14 |
| Human | EH2477 | Human IGIP(IgA-inducing protein homolog) | IGIP | 96T | IGIP |
| Human | EH2478 | Human STS(Steryl-sulfatase) | STS | 96T | STS/Steryl-sulfate sulfohydrolase/Arylsulfatase C(ASC)/Steroid sulfatase/ARSC1 |
| Human | EH2479 | Human S100A2(Protein S100-A2) | S100A2 | 96T | S100A2/CAN19/S100L/CAN19protein S100-A2/S100 calcium binding protein A2/S100 calcium-binding protein A2Protein S-100L/S100L |
| Human | EH2480 | Human CCT8L1P(Putative T-complex protein 1 subunit theta-like 1) | CCT8L1P | 96T | CCT8L1P |
| Human | EH2481 | Human HMMR(Hyaluronan mediated motility receptor) | HMMR | 96T | HMMR/Intracellular hyaluronic acid-binding protein/Receptor for hyaluronan-mediated motility/CD168/IHABP/RHAMM |
| Human | EH2482 | Human DUOX2(Dual oxidase 2) | DUOX2 | 96T | DUOX2/Thyroid oxidase 2/NADPH thyroid oxidase 2/NADPH oxidase/peroxidase DUOX2/NADH/NADPH thyroid oxidase p138-tox/p138 thyroid oxidase/Large NOX 2/Long NOX 2/LNOX2/THOX2 |
| Human | EH2483 | Human ITGA9(Integrin alpha-9) | ITGA9 | 96T | ITGA9/ITGA4L/RLC-alpha/ALPHA-RLC/integrin alpha-9/Integrin alpha-RLC/integrin, alpha 9/ITGA4L/RLC |
| Human | EH2484 | Human RHOA(Transforming protein RhoA) | RHOA | 96T | RHOA/Rho cDNA clone 12/h12//ARH12/ARHA |
| Human | EH2485 | Human ADC(Arginine decarboxylase) | ADC | 96T | ADC/ODC-paralogue/ODC-p/Ornithine decarboxylase-like protein/ARGDC |
| Human | EH2486 | Human NRTN(Neurturin) | NRTN | 96T | NRTN/NTN |
| Human | EH2487 | Human AXIN2(Axin-2) | AXIN2 | 96T | AXIN2/Axis Inhibitor 2/AXIL/Conductin/MGC10366/MGC126582/Axil/axin 2/axin-2/Axin-like protein/Axis inhibition protein 2/conductin |
| Human | EH2488 | Human PPP1CA(Serine/threonine-protein phosphatase PP1-alpha catalytic subunit) | PPP1CA | 96T | PPP1CA/PPP1A/PP-1A |
| Human | EH2489 | Human VASP(Vasodilator-stimulated phosphoprotein) | VASP | 96T | VASP |
| Human | EH2490 | Human TRIM3(Tripartite motif-containing protein 3) | TRIM3 | 96T | TRIM3/RING finger protein 97/Brain-expressed RING finger protein/RING finger protein 22/BERP/RNF22/RNF97 |
| Human | EH2491 | Human TOP1(DNA topoisomerase 1) | TOP1 | 96T | TOP1/DNA topoisomerase I |
| Human | EH2492 | Human PTPRF(Receptor-type tyrosine-protein phosphatase F) | PTPRF | 96T | PTPRF/Leukocyte common antigen related/LAR) |
| Human | EH2493 | Human AFM(Afamin) | AFM | 96T | AFM/ALB2 ALBAALF afamin ALB2alpha-Alb/ALBAalpha-albumin/ALF/Alpha-Alb/Alpha-albumin |
| Human | EH2494 | Human ASS1(Argininosuccinate synthase) | ASS1 | 96T | ASS1/Citrulline--aspartate ligase/ASS |
| Human | EH2495 | Human TNFAIP2(Tumor necrosis factor alpha-induced protein 2) | TNFAIP2 | 96T | TNFAIP2/TNF alpha-induced protein 2/Primary response gene B94 protein |
| Human | EH2496 | Human CDA(Cytidine deaminase) | CDA | 96T | CDA/Cytidine aminohydrolase/CDD |
| Human | EH2497 | Human AXIN1(Axin-1) | AXIN1 | 96T | AXIN1/axin 1/axin-1/AXINaxis inhibitor 1/Axis inhibition protein 1/fused, mouse, homolog of/hAxin/MGC52315 |
| Human | EH2498 | Human DPEP1(Dipeptidase 1) | DPEP1 | 96T | DPEP1/Renal dipeptidase/hRDP/Dehydropeptidase-I/Microsomal dipeptidase/MDP/RDP |
| Human | EH2499 | Human SERPINB1(Leukocyte elastase inhibitor) | SERPINB1 | 96T | SERPINB1/Serpin B1/Monocyte/neutrophil elastase inhibitor/EI/Peptidase inhibitor 2(PI-2)/LEI/ELANH2/MNEI/PI2 |
| Human | EH2500 | Human PADI2(Protein-arginine deiminase type-2) | PADI2 | 96T | PADI2/PAD2/PAD-H19/PDI2/Peptidylarginine Deiminase II/EC 3.5.3.15/KIAA0994PDI2PAD2/PAD-H19/peptidlyarginine deiminase type II/peptidyl arginine deiminase, type II/Peptidylarginine deiminase II/protein arginine deiminase/Protein-arginine deiminase type II/protein-arginine deiminase type-2 |
| Human | EH2501 | Human GFM1(Elongation factor G, mitochondrial) | GFM1 | 96T | GFM1/Elongation factor G 1, mitochondrial(mEF-G 1)/Elongation factor G1(hEFG1)/EF-Gmt/EFG/EFG1/GFM |
| Human | EH2502 | Human FGF20(Fibroblast growth factor 20) | FGF20 | 96T | FGF20/FGF-20/fibroblast growth factor 20 |
| Human | EH2503 | Human PRKAA1(5'-AMP-activated protein kinase catalytic subunit alpha-1) | PRKAA1 | 96T | PRKAA1/2.7.11.26/Tau-protein kinase PRKAA1)/2.7.11.27/Tau-protein kinase PRKAA1(ACACA kinase)/2.7.11.31/Hydroxymethylglutaryl-CoA reductase kinase(HMGCR kinase)/AMPK1/AMPK subunit alpha-1 |
| Human | EH2504 | Human HAS1(Hyaluronan synthase 1) | HAS1 | 96T | HAS1/Hyaluronate synthase 1/Hyaluronic acid synthase 1/HA synthase 1/HAS |
| Human | EH2505 | Human HDLBP(Vigilin) | HDLBP | 96T | HDLBP/HBP/VGL/High density lipoprotein-binding protein(HDL-binding protein) |
| Human | EH2506 | Human JAK1(Tyrosine-protein kinase JAK1) | JAK1 | 96T | JAK1/Janus Kinase 1/EC 2.7.10/JAK-1/JAK1Atyrosine-protein kinase JAK1/JAK1B/Janus kinase 1EC 2.7.10.2/JTK3 |
| Human | EH2507 | Human LMAN1(Protein ERGIC-53) | LMAN1 | 96T | LMAN1/Lectin mannose-binding 1/Intracellular mannose-specific lectin MR60/ER-Golgi intermediate compartment 53 kDa protein/Gp58/ERGIC53/F5F8D |
| Human | EH2508 | Human LPAR1(Lysophosphatidic acid receptor 1) | LPAR1 | 96T | LPAR1/Lysophosphatidic acid receptor Edg-2/LPA receptor 1/LPA-1/EDG2/LPA1 |
| Human | EH2509 | Human OVOS1(Ovostatin homolog 1) | OVOS1 | 96T | OVOS1 |
| Human | EH2510 | Human MTX1(Metaxin-1) | MTX1 | 96T | MTX1/Mitochondrial outer membrane import complex protein 1 |
| Human | EH2511 | Human MAOB(Amine oxidase [flavin-containing] B) | MAOB | 96T | MAOB/Amine oxidase [flavin-containing] B/Monoamine oxidase type B(MAO-B) |
| Human | EH2512 | Human OPRL1(Nociceptin receptor) | OPRL1 | 96T | OPRL1/Nociceptin receptor/Kappa-type 3 opioid receptor(KOR-3)/Orphanin FQ receptor |
| Human | EH2513 | Human IL17D(Interleukin-17D) | IL17D | 96T | IL17D/interleukin 17D |
| Human | EH2514 | Human PKD1(Polycystin-1) | PKD1 | 96T | PKD1/Polycystic kidney disease protein 1-like 1/PC1-like 1 protein/Polycystin-1L1 |
| Human | EH2515 | Human RGN(Regucalcin) | RGN | 96T | RGN/Regucalcin(RC)/Gluconolactonase(GNL)/Senescence marker protein 30(SMP-30)/ |
| Human | EH2516 | Human RPE65(Retinoid isomerohydrolase) | RPE65 | 96T | RPE65/Retinoid isomerohydrolase/Retinol isomerase/All-trans-retinyl-palmitate hydrolase/Retinal pigment epithelium-specific 65 kDa protein |
| Human | EH2517 | Human OVOS2(Ovostatin homolog 2) | OVOS2 | 96T | OVOS2/Ovostatin homolog 2 |
| Human | EH2518 | Human TNFAIP3(Tumor necrosis factor alpha-induced protein 3) | TNFAIP3 | 96T | TNFAIP3/OTUD7C/TNFA1P2/A20TNFA1P2/EC 3.4.19.12/EC 6.3.2.-/OTU domain-containing protein 7C/Putative DNA-binding protein A20/TNF alpha-induced protein 3/tumor necrosis factor alpha-induced protein 3/tumor necrosis factor inducible protein A20/tumor necrosis factor, alpha-induced protein 3/Zinc finger protein A20 |
| Human | EH2519 | Human TRIB3(Tribbles homolog 3) | TRIB3 | 96T | TRIB3/Tribbles homolog 3(TRB-3)/p65-interacting inhibitor of NF-kappa-B/Neuronal cell death-inducible putative kinase/SINK |
| Human | EH2520 | Human TSHR(Thyrotropin receptor) | TSHR | 96T | TSHR/CHNG1/LGR3/CHNG1/LGR3hTSHR-I/seven transmembrane helix receptor/thyroid stimulating hormone receptor/Thyroid-stimulating hormone receptor/thyrotropin receptor/thyrotropin receptor-I, hTSHR-I/TSH-R |
| Human | EH2521 | Human SCAMP1(Secretory carrier-associated membrane protein 1) | SCAMP1 | 96T | SCAMP1/Secretory carrier-associated membrane protein 1(Secretory carrier membrane protein 1) |
| Human | EH2522 | Human SCG5(Neuroendocrine protein 7B2) | SCG5 | 96T | SCG5/Secretory granule endocrine protein I/Secretogranin-5/Pituitary polypeptide/Secretogranin V |
| Human | EH2523 | Human IKBKG(NF-kappa-B essential modulator) | IKBKG | 96T | IKBKG/NF-kappa-B essential modulator(NEMO)/ NF-kappa-B essential modifier/Inhibitor of nuclear factor kappa-B kinase subunit gamma(I-kappa-B kinase subunit gamma/IKK-gamma/IKKG/IkB kinase subunit gamma)/FIP-3/IkB kinase-associated protein 1(IKKAP1) |
| Human | EH2524 | Human SKP2(S-phase kinase-associated protein 2) | SKP2 | 96T | SKP2/FBL1/FBXL1/p45skp2/CDK2/cyclin A-associated protein p45/cyclin A/CDK2-associated protein p45/Cyclin-A/CDK2-associated protein p45/FBL1/F-box protein Skp2/F-box/LRR-repeat protein 1/FLB1/p45skp2/S-phase kinase-associated protein 2/S-phase kinase-associated protein 2(p45) |
| Human | EH2525 | Human SPAG1(Sperm-associated antigen 1) | SPAG1 | 96T | SPAG1/HSD-3.8/Infertility-related sperm protein Spag-1 |
| Human | EH2526 | Human CHID1(Chitinase domain-containing protein 1) | CHID1 | 96T | CHID1/Chitinase domain-containing protein 1/Stabilin-1-interacting chitinase-like protein(SI-CLP) |
| Human | EH2527 | Human DUSP1(Dual specificity protein phosphatase 1) | DUSP1 | 96T | DUSP1/Dual specificity protein phosphatase 1/Protein-tyrosine phosphatase CL100/Dual specificity protein phosphatase hVH1/Mitogen-activated protein kinase phosphatase 1(MAP kinase phosphatase 1/MKP-1)/ |
| Human | EH2528 | Human CTSF(Cathepsin F) | CTSF | 96T | CTSF/cathepsin F/CATSFEC 3.4.22.41/EC 3.4.22 |
| Human | EH2530 | Human PARP2(Poly [ADP-ribose] polymerase 2) | PARP2 | 96T | PARP2/Poly [ADP-ribose] polymerase 2(PARP-2/hPARP-2)/Poly[ADP-ribose] synthase 2(pADPRT-2)/NAD(+) ADP-ribosyltransferase 2(ADPRT-2)/Poly[ADP-ribose] synthase 2(pADPRT-2) |
| Human | EH2531 | Human GPX3(Glutathione peroxidase 3) | GPX3 | 96T | GPX3/GPX-P/EC 1.11.1/EC 1.11.1.9/Extracellular glutathione peroxidase/glutathione peroxidase 3/glutathione peroxidase 3(plasma)/GPx-3/GPXP/GPx-P/GSHPx-3/GSHPx-P/Plasma glutathione peroxidase |
| Human | EH2532 | Human MYBPC3(Myosin-binding protein C, cardiac-type) | MYBPC3 | 96T | MYBPC3/CMH4/C-protein, cardiac muscle isoform/FHC/MYBP-C/Cardiac MyBP-C/CMH4/C-protein, cardiac muscle isoform/DKFZp779E1762/FHC/MYBP-C/myosin binding protein C, cardiac/myosin-binding protein C, cardiac/myosin-binding protein C, cardiac-type |
| Human | EH2533 | Human HSPA2(Heat shock-related 70 kDa protein 2) | HSPA2 | 96T | HSPA2/HSP70-2/Heat shock 70 kDa protein 2/heat shock 70kD protein 2/heat shock 70kDa protein 2/heat shock-related 70 kDa protein 2/HSP70-2/HSP70-3 |
| Human | EH2534 | Human 14-3-3 protein eta(YWHAH) | 14-3-3 protein eta | 96T | YWHA1/Protein AS1 |
| Human | EH2550 | Human GLDC(Glycine Dehydrogenase) | GLDC | 96T | GLDC/GCSP/Glycine dehydrogenase(aminomethyl-transferring)/Glycine cleavage system P protein/Glycine decarboxylase/Glycine dehydrogenase [decarboxylating], mitochondrial |
| Human | EH2552 | Human his(Histamine) | his | 96T | |
| Human | EH2564 | Human Sphingosine 1 Phosphate(Sphingosine 1 Phosphate) | Sphingosine 1 Phosphate | 96T | / |
| Human | EH2583 | Human Ang1-7(Angiotensin 1-7) | Ang1-7 | 96T | Ang1-7 |
| Human | EH2585 | Human ACVB (Activin B) | ACVB | 96T | ACVB/Human ACVB(Activin B) |
| Human | EH2586 | Human ADAMTS12 (A Disintegrin And Metalloproteinase With Thrombospondin 12) | ADAMTS12 | 96T | ADAMTS12/Human ADAMTS12(A Disintegrin And Metalloproteinase With Thrombospondin 12) |
| Human | EH2587 | Human ADCY2 (Adenylate Cyclase 2) | ADCY2 | 96T | ADCY2/HBAC2/ATP pyrophosphate-lyase 2/Adenylate cyclase type II |
| Human | EH2590 | Human ADH (Antidiuretic Hormone) | ADH | 96T | ADH/VP/AVP |
| Human | EH2592 | Human ADIPOR2 (Adiponectin Receptor 2) | ADIPOR2 | 96T | ADIPOR2 |
| Human | EH2593 | Human ADP(Adiponectin) | ADP | 96T | Adiponectin/AdipoQ/ADP/Acrp30/GBP28/ACDC/ADPN |
| Human | EH2594 | Human ADRP (Adipose Differentiation Related Protein) | ADRP | 96T | ADRP(Adipose Differentiation Related Protein)/PLIN2/Perilipin-2/Adipophilin/Adipose differentiation-related protein/ADRP |
| Human | EH2599 | Human AGC (Aggrecan) | AGC | 96T | AGC |
| Human | EH2600 | Human AGGF1 (Angiogenic Factor with G Patch and FHA Domains 1) | AGGF1 | 96T | AGGF1 |
| Human | EH2601 | Human A-GHR (Acylated Ghrelin) | A-GHR | 96T | A-GHR |
| Human | EH2603 | Human AGR2 (Anterior Gradient Protein 2) | AGR2 | 96T | AGR2 |
| Human | EH2604 | Human AhpC(Alkyl hydroperoxide reductase) | AhpC | 96T | AhpC |
| Human | EH2605 | Human AICAR (AICA Riboside) | AICAR | 96T | AICAR |
| Human | EH2606 | Human AIF (Apoptosis Inducing Factor) | AIF | 96T | AIF/AIFM1/COXPD6/PDCD8/AIFapoptosis-inducing factor 1, mitochondrial/apoptosis-inducing factor, mitochondrion-associated, 1/COXPD6/MGC111425/PDCD8striatal apoptosis-inducing factor/programmed cell death 8(apoptosis-inducing factor)/Programmed cell death protein 8 |
| Human | EH2608 | Human AIMP1 (Aminoacyl tRNA Synthetase Complex Interacting Multifunctional Protein 1) | AIMP1 | 96T | AIMP1/SCYE1/EMAP-II/aminoacyl tRNA synthetase complex-interacting multifunctional protein 1/EMAP-2/EMAPII member 1(endothelialmonocyte-activating)/endothelial-monocyte activating polypeptide II/Multisynthase complex auxiliary component p43/multisynthetase complex auxiliary component p43 |
| Human | EH2609 | Human AIRA (Anti-Insulin Receptor Antibody) | AIRA | 96T | AIRA |
| Human | EH2612 | Human AKAP12(A Kinase Anchor Protein 12) | AKAP12 | 96T | AKAP12 |
| Human | EH2613 | Human ALB (Albumin) | ALB | 96T | ALB(Albumin)/cell growth inhibiting protein 42/growth-inhibiting protein 20/serum albumin |
| Human | EH2614 | Human ALDH (Aldehyde Dehydrogenase, Mitochondrial) | ALDH | 96T | ALDH/ALDH2(Aldehyde dehydrogenase, mitochondrial)/ALDHI/ALDH class 2/ALDH-E2/ALDM/Aldehyde Dehydrogenase 2 |
| Human | EH2615 | Human ALDOA (Aldolase A, Fructose Bisphosphate) | ALDOA | 96T | ALDOA |
| Human | EH2616 | Human Alk-Smase (Alkaline Sphingomyelinase) | Alk-Smase | 96T | Alk-Smase |
| Human | EH2617 | Human ALOXE3 (Arachidonate Lipoxygenase 3) | ALOXE3 | 96T | ALOXE3 |
| Human | EH2618 | Human ALP (Alkaline Phosphatase) | ALP | 96T | ALP(Alkaline Phosphatase) |
| Human | EH2620 | Human AMA IgA (Anti-Myelin antibody IgA) | AMA IgA | 96T | AMA IgA |
| Human | EH2621 | Human AMPH(anti amphiphysin) | AMPH | 96T | AMPH |
| Human | EH2622 | Human AMPK (Phosphorylated Adenosine Monophosphate Activated Protein Kinase) | AMPK | 96T | AMPK |
| Human | EH2626 | Human ANG I (Angiotensin I) | ANG I | 96T | ANG I |
| Human | EH2627 | Human ANG II (Angiotensin II) | ANG II | 96T | ANG II |
| Human | EH2629 | Human ANG II R1-Ab (Angiotensin II Receptor 1 Antibody) | ANG II R1-Ab | 96T | ANG II R1-Ab |
| Human | EH2630 | Human C4BP(C4 Binding Protein Beta) | C4BP | 96T | C4BPB |
| Human | EH2631 | Human Ang III (Angiotensin III) | Ang III | 96T | Ang III |
| Human | EH2632 | Human ANGPTL1 (Angiopoietin Like Protein 1) | ANGPTL1 | 96T | ANGPTL1 |
| Human | EH2633 | Human ANGPTL6 (Angiopoietin Like Protein 6) | ANGPTL6 | 96T | ANGPTL6/Angiopoietin-like protein 6/Angiopoietin-related growth factor/Angiopoietin-related protein 5/ANGPTL6/AGF/ARP5/UNQ152/PRO178 |
| Human | EH2634 | Human ANG-R-Tie1 (Angiopoietin Receptor Tie1) | ANG-R-Tie1 | 96T | ANG-R-Tie1 |
| Human | EH2635 | Human ANG-R-Tie2 (Angiopoietin Receptor Tie2) | ANG-R-Tie2 | 96T | ANG-R-Tie2 |
| Human | EH2637 | Human ANKRD1 (Ankyrin Repeat Domain 1) | ANKRD1 | 96T | ANKRD1 |
| Human | EH2638 | Human ANNA1(Anti-Neuronal Nuclear Antibody 1) | ANNA1 | 96T | ANNA1 |
| Human | EH2639 | Human ANP (Atrial Natriuretic Peptide) | ANP | 96T | ANP/NPPA/ANF/Cardionatrin/NPPA/PND/ANF/ANPatriopeptin/ATFB6/atrial natriuretic factor/Atrial natriuretic peptide/CDD-ANF/natriuretic peptide A/natriuretic peptide precursor A/PNDcardionatrin/prepronatriodilatin/Prepronatriodilatin |
| Human | EH2640 | Human Anti-AChR (Anti-Acetylcholine Receptor Antibody) | Anti-AChR | 96T | Anti-AChR |
| Human | EH2643 | Human Anti-CRP (Anti-C Reactive Protein Antibody) | Anti-CRP | 96T | Anti-CRP |
| Human | EH2645 | Human Anti-MPO (Anti-Myeloperoxidase Antibody) | Anti-MPO | 96T | Anti-MPO |
| Human | EH2646 | Human Anti-Surv (Anti-Survivin Antibody) | Anti-Surv | 96T | Anti-Surv |
| Human | EH2647 | Human AP (Aprotinin) | AP | 96T | AP/BPTI/Trasylol/Pancreatic Trypsin Inhibitor/Basic protease inhibitor |
| Human | EH2648 | Human AP (Allopregnanolone) | AP | 96T | AP/3α,5α-tetrahydroprogesterone/3α-hydroxy-5α-pregnan-20-one |
| Human | EH2649 | Human AP13 (Apelin 13) | AP13 | 96T | AP13(Apelin 13) |
| Human | EH2650 | Human AP17 (Apelin 17) | AP17 | 96T | AP17(Apelin 17) |
| Human | EH2651 | Human AP36 (Apelin 36) | AP36 | 96T | AP36(Apelin 36) |
| Human | EH2652 | Human Amylase AlphaFALSE | Amylase Alpha | 96T | / |
| Human | EH2653 | Human APA (Anti-Phospholipid Antibody) | APA | 96T | APA |
| Human | EH2654 | Human APAF1 (Apoptosis Protease Activating Factor 1) | APAF1 | 96T | APAF1/APAF-1apoptotic protease activating factor 1/apoptotic peptidase activating factor/apoptotic peptidase activating factor 1/apoptotic protease activating factor/apoptotic protease-activating factor 1/CED4/DKFZp781B1145/KIAA0413 |
| Human | EH2655 | Human Apo A1-Ab (Anti-Apolipoprotein A1 Antibody) | Apo A1-Ab | 96T | Apo A1-Ab |
| Human | EH2657 | Human ApoF (Apolipoprotein F) | ApoF | 96T | ApoF(Apolipoprotein F)/Apo-F/LTIP/Lipid transfer inhibitor protein |
| Human | EH2659 | Human APT (Abnormal Prothrombin) | APT | 96T | APT |
| Human | EH2664 | Human ARHGDIα (Rho GDP Dissociation Inhibitor Alpha ) | ARHGDIα | 96T | ARHGDIα |
| Human | EH2665 | Human ARO (Aromatase) | ARO | 96T | ARO/CYP19A1/ARO1/CPV1/CYAR/CYP19/CYPXIX/P-450AROM/estrogen synthetase/Cytochrome P-450AROM/Aromatase/CYPXIX |
| Human | EH2666 | Human ARRβ1 (Arrestin Beta 1) | ARRβ1 | 96T | ARRβ1/ARR1/ARRB1/ARB1/ARR1/arrestin 2/Arrestin beta-1/arrestin, beta 1/beta-arrestin-1 |
| Human | EH2669 | Human ASGR2 (Asialoglycoprotein Receptor 2) | ASGR2 | 96T | ASGR2 |
| Human | EH2670 | Human ASK-1 (Apoptosis Signal Regulating Kinase 1) | ASK-1 | 96T | ASK-1/MAP3K5/MEKK5/Apoptosis signal-regulating kinase 1/ASK-1/ASK1MEKK 5/EC 2.7.11/MAP/ERK kinase kinase 5/MAPK/ERK kinase kinase 5/MAPKKK5EC 2.7.11.25/MEK kinase 5/MEKK5apoptosis signal regulating kinase 1/mitogen-activated protein kinase kinase kinase 5 |
| Human | EH2671 | Human AST (Aspartate Aminotransferase) | AST | 96T | AST |
| Human | EH2672 | Human AT (AntiThrombin) | AT | 96T | AT |
| Human | EH2673 | Human ATA (Angiotensinase A) | ATA | 96T | ATA |
| Human | EH2674 | Human ATF-1 (Activating Transcription Factor 1) | ATF-1 | 96T | ATF-1 |
| Human | EH2675 | Human ATF-2 (Activating Transcription Factor 2) | ATF-2 | 96T | ATF-2 |
| Human | EH2676 | Human ATF-3 (Activating Transcription Factor 3) | ATF-3 | 96T | ATF-3/JDP1/JUNDM1/SNFT/basic leucine zipper transcription factor, ATF-like 3/basic leucine zipper transcriptional factor ATF-like 3/B-ATF-3/FLJ36352/FLJ37535,21 kDa small nuclear factor isolated from T-cells/JDP1/Jun dimerization protein 1/Jun dimerization protein p21SNFT/JUNDM1/SNFT21-kD small nuclear factor isolated from T cells |
| Human | EH2677 | Human ATF-4 (Activating Transcription Factor 4) | ATF-4 | 96T | ATF-4/TAXREB67/TXREB/Activating transcription factor 4/activating transcription factor 4(tax-responsive enhancer element B67)/cAMP-dependent transcription factor ATF-4/cAMP-responsive element-binding protein 2/CREB-2DNA-binding protein TAXREB67/cyclic AMP-dependent transcription factor ATF-4/Cyclic AMP-responsive element-binding protein 2/TaxREB67/TAXREB67CREB2cAMP response element-binding protein 2/Tax-responsive enhancer element-binding protein 67/TXREB |
| Human | EH2679 | Human ATF-6 (Activating Transcription Factor 6) | ATF-6 | 96T | ATF-6 |
| Human | EH2681 | Human ATGA/TGAB (Anti-Thyroid-Globulin Antibody) | ATGA/TGAB | 96T | ATGA/TGAB |
| Human | EH2682 | Human ATXN1 (Ataxin 1) | ATXN1 | 96T | ATXN1 |
| Human | EH2684 | Human Aβ40 (Amyloid Beta 40) | Aβ40 | 96T | Aβ40(Amyloid Beta 40)/Abeta 40/Beta-amyloid protein 40/Aβ(1-40) |
| Human | EH2685 | Human Aβ42 (Amyloid Beta 42) | Aβ42 | 96T | Aβ42(Amyloid Beta 42)/Aβ(1-42)/Aβ1-42 |
| Human | EH2687 | Human BACE1 (Beta-site APP Cleaving Enzyme 1) | BACE1 | 96T | BACE1/APP beta-secretase/ASP2/Aspartyl protease 2/BACEAsp 2/beta-secretase 1/beta-secretase 1 precursor variant 1/beta-site amyloid beta A4 precursor protein-cleaving enzyme/Beta-site amyloid precursor protein cleaving enzyme 1/Beta-site APP cleaving enzyme 1/beta-site APP-cleaving enzyme/beta-site APP-cleaving enzyme 1/EC 3.4.23/EC 3.4.23.46/FLJ90568/HSPC104/KIAA1149/memapsin-2/Memapsin-2/Membrane-associated aspartic protease 2/transmembrane aspartic proteinase Asp2 |
| Human | EH2689 | Human BAG3 (Bcl2 Associated Athanogene 3) | BAG3 | 96T | BAG3/BAG-3/BIS/CAIR-1/BAG family molecular chaperone regulator 3 |
| Human | EH2690 | Human BAK1 (Bcl2 Antagonist/Killer 1) | BAK1 | 96T | BAK1/BAK/BCL2L7/Apoptosis regulator BAK/BAK-LIKE/BAKMGC3887/BCL2-antagonist/killer 1/Bcl2-L-7/bcl2-L-7/BCL2L7bcl-2 homologous antagonist/killer/BCL2-like 7 protein/Bcl-2-like protein 7/CDN1/MGC117255/pro-apoptotic protein BAK |
| Human | EH2691 | Human BALP (Bone Alkaline Phosphatase) | BALP | 96T | BALP(Bone Alkaline Phosphatase)/ALPL/BSAP/HOPS/AP-TNAP/TNSALP |
| Human | EH2692 | Human BANP (BTG3 Associated Nuclear Protein) | BANP | 96T | BANP/BEND1/SMAR1/Scaffold/matrix-associated region-1-binding protein/BEN domain-containing protein 1/Btg3-associated nuclear protein |
| Human | EH2693 | Human BCAN (Brevican) | BCAN | 96T | BCAN/ALPBRE/BEHAB/CSPG7/brevican core protein/Brain-enriched hyaluronan-binding protein/brevican/Chondroitin sulfate proteoglycan 7/chondroitin sulfate proteoglycan BEHAB/chondroitin sulfate proteoglycan BEHAB/brevican/brevican proteoglycan/MGC13038 |
| Human | EH2694 | Human BCAR1 (Breast Cancer Anti Estrogen Resistance 1) | BCAR1 | 96T | BCAR1/CASS1/CRKAS/breast cancer estrogen resistance 1/Cas scaffolding protein family member 1/CAS1/CASFLJ45059/CASS1CRKASbreast cancer estrogen resistance protein 1/Crkas/CRK-associated substrate/Crk-associated substrate p130Cas/FLJ12176/P130Cas/p130cas |
| Human | EH2698 | Human BCL2L1/BCL-X (Bcl-2 Like Protein 1/Bcl2 Associated X Protein) | BCL2L1/BCL-X | 96T | BCL2L1/BCL-X/BCL-XL/S/BCLX/BCLXL/BCLXS/PPP1R52 |
| Human | EH2699 | Human Bcl2L11 (Bcl-2 Like Protein 11) | Bcl2L11 | 96T | Bcl2L11/BAM/BIM/BOD/BimL/BimEL/BIM Long |
| Human | EH2701 | Human BF (Factor B) | BF | 96T | BF/CFB/AHUS4/ARMD14/BFD/CFAB/CFBD/FBI12/GBG/H2-Bf/PBF2 |
| Human | EH2704 | Human BIRC7(Baculoviral IAP repeat-containing protein 7) | BIRC7 | 96T | BIRC7/Livin/KIAP/ML-IAP/baculoviral IAP repeat containing 7/baculoviral IAP repeat-containing 7/KIAPRING finger protein 50/Kidney inhibitor of apoptosis protein/Livin/livin inhibitor-of-apoptosis/Melanoma inhibitor of apoptosis protein/MLIAPlivin inhibitor of apoptosis/ML-IAPmLiap/RNF50LIVINbaculoviral IAP repeat-containing protein 7 |
| Human | EH2705 | Human BK (Bradykinin) | BK | 96T | BK |
| Human | EH2708 | Human BLVRA(Biliverdin Reductase A) | BLVRA | 96T | BLVRA/BLVRA/BVR/BVRA/biliverdin reductase A/Biliverdin-IX alpha-reductase/BLVR/BVR/BVR A/BVRA/EC 1.3.1.24 |
| Human | EH2709 | Human BLVRB (Biliverdin Reductase B) | BLVRB | 96T | BLVRB/BVRB/FLR/GHBP/Biliverdin reductase B/biliverdin reductase B(flavin reductase(NADPH))/Biliverdin-IX beta-reductase/BVR-B/flavin reductase/flavin reductase(NADPH)/FLRBVRB/FR/GHBP/Green heme-binding protein/NADPH-dependent diaphorase/NADPH-flavin reductase/SDR43U1/short chain dehydrogenase/reductase family 43U, member 1 |
| Human | EH2711 | Human BMF (Bcl-2 Modifying Factor) | BMF | 96T | BMF |
| Human | EH2715 | Human BMP-3 (Bone Morphogenetic Protein 3) | BMP-3 | 96T | BMP-3(Bone Morphogenetic Protein 3)/Osteogenin/BMP3A/BMP-3A/bone morphogenetic protein 3/Bone morphogenetic protein 3A |
| Human | EH2718 | Human BNP (Brain Natriuretic Peptide) | BNP | 96T | BNP(Brain Natriuretic Peptide)/NPPB/GC-B/B-Type Natriuretic Peptide/Natriuretic Peptide Precursor B |
| Human | EH2720 | Human BSP (Bone Sialoprotein) | BSP | 96T | BSP/IBSP/BNSP/BSP/BSP-II/SP-II/Integrin-Binding Bone Sialoprotein |
| Human | EH2721 | Human BTA (Bladder Tumor Antigen) | BTA | 96T | BTA/N/A |
| Human | EH2722 | Human C/EBPα (CCAAT/Enhancer Binding Protein Alpha) | C/EBPα | 96T | C/EBPα |
| Human | EH2723 | Human C/EBPβ (CCAAT/Enhancer Binding Protein Beta) | C/EBPβ | 96T | C/EBPβ |
| Human | EH2726 | Human C1INH (Complement 1 Inhibitor) | C1INH | 96T | C1INH/SERPING1/C1IN/C1INH/C1NH/HAE1/HAE2/C1 Inhibitor/C1IN/C1INH/C1NH/HAE1/HAE2/SERPING1 serpin peptidase inhibitor, clade G(C1 inhibitor), member 1/Plasma protease C1 inhibitor/Serpin G1/C1 esterase inhibitor/C1-inhibiting factor |
| Human | EH2727 | Human C1q (Complement 1q) | C1q | 96T | C1q |
| Human | EH2728 | Human C1q-Ab (Anti-Complement 1q Antibody) | C1q-Ab | 96T | C1q-Ab |
| Human | EH2730 | Human C1QTNF12(C1q and Tumor Necrosis Factor Related Protein 12) | C1QTNF12 | 96T | FAM132A,Adipolin,C1QDC2,C1q/TNF-related protein 12,CTRP12,C1q domain containing 2 |
| Human | EH2731 | Human C1QTNF2(C1q and Tumor Necrosis Factor Related Protein 2) | C1QTNF2 | 96T | C1QTNF2 |
| Human | EH2732 | Human C1QTNF9(C1q and Tumor Necrosis Factor Related Protein 9) | C1QTNF9 | 96T | C1QTNF9/Complement C1q tumor necrosis factor-related protein 9A/AQL1/CTRP9/AQL1/C1QTNF9AComplement C1q tumor necrosis factor-related protein 9/complement C1q tumor necrosis factor-related protein 9A/CTRP9/MGC48915 |
| Human | EH2734 | Human C3a (Complement Component 3a) | C3a | 96T | C3a/C3a-desArg/ASP/Anaphylatoxin/C3 |
| Human | EH2735 | Human C3b (Complement Fragment 3b) | C3b | 96T | C3b |
| Human | EH2737 | Human C3c (Complement Fragment 3c) | C3c | 96T | C3c |
| Human | EH2739 | Human C3d(Complement Fragment 3d) | C3d | 96T | C3d |
| Human | EH2740 | Human C4 (Complement Component 4) | C4 | 96T | C4 |
| Human | EH2741 | Human C4BPβ(C4 Binding Protein Beta) | C4BPβ | 96T | C4BPβ/C4BPB |
| Human | EH2742 | Human C4BPα (C4 Binding Protein Alpha) | C4BPα | 96T | C4BPα/C4BPA |
| Human | EH2744 | Human C4d (Complement Fragment 4d) | C4d | 96T | C4d |
| Human | EH2746 | Human C5b (Complement Fragment 5b) | C5b | 96T | C5b |
| Human | EH2747 | Human C5c (Complement C5 Convertase) | C5c | 96T | C5c |
| Human | EH2748 | Human CA5B (Carbonic Anhydrase VB, Mitochondrial) | CA5B | 96T | CA5B/CA-VB/CAVB/CA5B/CAVB/Carbonate dehydratase VB/carbonic anhydrase 5B, mitochondrial/Carbonic anhydrase VB/carbonic anhydrase VB, mitochondrial/carbonic dehydratase/CA-VB/EC 4.2.1.1/MGC39962 |
| Human | EH2749 | Human CA6 (Carbonic Anhydrase VI) | CA6 | 96T | CA6/CA-VI/CAVI/Gustin/Gustin/Carbonate dehydratase VI/carbonic anhydrase 6/carbonic anhydrase VIGUSTIN/CA-VI/EC 4.2.1.1/MGC21256/Salivary carbonic anhydrase/Secreted carbonic anhydrase |
| Human | EH2752 | Human CALD (Caldesmon) | CALD | 96T | CALD/CDM/H-CAD/HCAD/L-CAD/LCAD/NAG22/CALD1/HCAD/ CAD/caldesmon/caldesmon 1/CDMH-CAD/MGC21352 |
| Human | EH2755 | Human CAMK2N2(Calcium/Calmodulin Dependent Protein Kinase II Inhibitor 2) | CAMK2N2 | 96T | CAMK2N2 |
| Human | EH2756 | Human CAMK2α (Calcium/Calmodulin-Dependent Protein Kinase II Alpha) | CAMK2α | 96T | CAMK2α/CAMKA |
| Human | EH2757 | Human CaN (Calcineurin) | CaN | 96T | CaN |
| Human | EH2761 | Human CAPN1 (calpain 1) | CAPN1 | 96T | CAPN1 |
| Human | EH2762 | Human CAPS (Calcyphosine) | CAPS | 96T | CAPS/Calcyphosin/CAPS1 |
| Human | EH2764 | Human CASP10 (Caspase 10) | CASP10 | 96T | CASP10/FLICE2/Mch4/Apoptotic protease Mch-4/CASP-10/caspase 10, apoptosis-related cysteine peptidase/caspase 10, apoptosis-related cysteine protease/caspase-10/FADD-like ICE2/FAS-associated death domain protein interleukin-1B-converting enzyme 2/FLICE2/ICE-like apoptotic protease 4/interleukin-1B-converting enzyme 2/MCH4ALPS2 |
| Human | EH2766 | Human CASP4 (Caspase 4) | CASP4 | 96T | CASP4/ICE(rel)II/ICH-2/Mih1,TX/TX/apoptotic cysteine protease Mih1,TX/CASP-4/caspase 4, apoptosis-related cysteine peptidase/caspase 4, apoptosis-related cysteine protease/caspase-4/ICE(rel)II/ICE(rel)-II/ICEREL-II/ICH2/ICH-2/Mih1,TX/Protease ICH-2/Protease TX/TX |
coresciences 코아사이언스 면역학 시약 키트 ELISA kit antibody 항체
'ELISA,항체,단백질' 카테고리의 다른 글
공지사항
최근에 올라온 글
최근에 달린 댓글
- Total
- Today
- Yesterday
링크
TAG
- 바이오헤저드백
- 미니멸균백
- Funakoshi
- time release pellets
- 코아사이언스
- solar cells
- 후나코시
- 고수용성 콘드로이틴
- material science
- 연속절편
- 조직절편제작
- matrix-driven delivery pellet
- 콘드로이틴 황산 올리고당
- 파라핀 블럭
- Sterlitech
- OPV
- 바이오하자드백
- allview PAGE buffer
- filter
- 오토클레이브백
- gradient gel
- 건스터바이오텍
- 조직염색절편제작
- 조직절편
- 파라핀 블록
- 막필터
- 면역화학분석
- 형광염색
- Coresciences
- OLED
| 일 | 월 | 화 | 수 | 목 | 금 | 토 |
|---|---|---|---|---|---|---|
| 1 | 2 | 3 | 4 | 5 | 6 | 7 |
| 8 | 9 | 10 | 11 | 12 | 13 | 14 |
| 15 | 16 | 17 | 18 | 19 | 20 | 21 |
| 22 | 23 | 24 | 25 | 26 | 27 | 28 |
| 29 | 30 |
글 보관함