티스토리 뷰
ELISA,항체,단백질
FineTest ELISA kit Product List #4_Wuhan Fine Biological Technology Korea - 코아사이언스
코피디 2016. 6. 28. 18:11FineTest ELISA kit Product List #4
| Species | Cat. No. | Full name | Short name | Size | Alias |
| Human | EH1587 | Human SH3GL1(Endophilin-A2) | SH3GL1 | 96T | SH3GL1/Endophilin-A2/SH3 domain-containing GRB2-like protein 1/SH3 domain protein 2B/Extra eleven-nineteen leukemia fusion gene protein/EEN/EEN fusion partner of MLL/Endophilin-2/CNSA1/SH3P8/SH3D2B |
| Human | EH1588 | Human IKZF1(DNA-binding protein Ikaros) | IKZF1 | 96T | IKZF1/DNA-binding protein Ikaros/Ikaros family zinc finger protein 1/Lymphoid transcription factor LyF-1/IK1/IKAROS/LYF1/PRO0758/ZNFN1A1/hIk-1/ZNFN1A1CLL-associated antigen KW-6 |
| Human | EH1589 | Human KRT2(Keratin, type II cytoskeletal 2 epidermal) | KRT2 | 96T | KRT2/Keratin, type II cytoskeletal 2 epiderma/Type-II keratin Kb2/Keratin-2e/K2e/Keratin-2 epidermis/Cytokeratin-2e/CK-2e/Epithelial keratin-2e/KRT2A/KRT2E/KRTE |
| Human | EH1590 | Human DBH(Dopamine beta-hydroxylase) | DBH | 96T | DBH/Dopamine beta-hydroxylase/Dopamine beta-monooxygenase/DBM/DOPBHY/dopamine beta-monooxygenase |
| Human | EH1591 | Human YWHAQ(14-3-3 protein theta) | YWHAQ | 96T | YWHAQ/14-3-3 protein theta/Protein HS1/14-3-3 protein T-cell/14-3-3 protein tau |
| Human | EH1592 | Human LHCGR(Lutropin-choriogonadotropic hormone receptor) | LHCGR | 96T | LHCGR/Lutropin-choriogonadotropic hormone receptor/Luteinizing hormone receptor/LHR/LSH-R |
| Human | EH1593 | Human NME1(Nucleoside diphosphate kinase A) | NME1 | 96T | NME1/Nucleoside diphosphate kinase A/NDK A/NDP kinase A/nm23-H1/Tumor metastatic process-associated protein/Granzyme A-activated Dnase/GAAD/Metastasis inhibition factor nm23 |
| Human | EH1594 | Human PIK3CA(Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit alpha isoform) | PIK3CA | 96T | PIK3CA/Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit alpha isoform/PI3-kinase subunit alpha/PI3K-alpha/PI3Kalpha/PtdIns-3-kinase subunit alpha/Phosphatidylinositol-4,5-bisphosphate 3-kinase 110 kDa catalytic subunit alpha/PtdIns-3-kinase subunit p110-alpha/p110alpha/Phosphoinositide-3-kinase catalytic alpha polypeptide |
| Human | EH1595 | Human PIK3CD(Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit delta isoform) | PIK3CD | 96T | PIK3CD/Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit delta isoform/PI3-kinase subunit delta/PI3K-delta/PI3Kdelta/PtdIns-3-kinase subunit delta/Phosphatidylinositol-4,5-bisphosphate 3-kinase 110 kDa catalytic subunit delta/PtdIns-3-kinase subunit p110-delta/p110delta |
| Human | EH1596 | Human GPX2(Glutathione peroxidase 2) | GPX2 | 96T | GPX2/Glutathione peroxidase 2/GPx-2/GSHPx-2/Glutathione peroxidase-related protein 2/GPRP-2/Gastrointestinal glutathione peroxidase/Glutathione peroxidase-gastrointestinal/GPx-GI/GSHPx-GI |
| Human | EH1597 | Human S1PR1(Sphingosine 1-phosphate receptor 1) | S1PR1 | 96T | S1PR1/Sphingosine 1-phosphate receptor 1/S1P receptor 1/S1P1/Endothelial differentiation G-protein coupled receptor 1/Sphingosine 1-phosphate receptor Edg-1/S1P receptor Edg-1 |
| Human | EH1598 | Human SFRP5(Secreted frizzled-related protein 5) | SFRP5 | 96T | SFRP5(Secreted frizzled-related protein 5)/FRP1B/SARP3/frizzled-related protein 1b/FRP-1b/SARP-3/secreted apoptosis related protein 3/secreted apoptosis-related protein 3/sFRP-5 |
| Human | EH1599 | Human RYR1(Ryanodine receptor 1) | RYR1 | 96T | RYR1/Ryanodine receptor 1/RYR-1/RyR1/Type 1 ryanodine receptor/Skeletal muscle-type ryanodine receptor/Skeletal muscle calcium release channel |
| Human | EH1600 | Human PLIN1(Perilipin-1) | PLIN1 | 96T | PLIN1/Perilipin-1/Lipid droplet-associated protein/PERI/PLIN/perilipin/perilipin 1/PLINLipid droplet-associated protein |
| Human | EH1601 | Human OGG1(N-glycosylase/DNA lyase) | OGG1 | 96T | OGG1/N-glycosylase/DNA lyase/8-hydroxyguanine DNA glycosylase/8-oxoguanine DNA glycosylase/AP lyase/DNA-apurinic or apyrimidinic site lyase/HOGG1/MMH/MUTMOGH1HMMH |
| Human | EH1602 | Human TH(Tyrosine 3-monooxygenase) | TH | 96T | TH(Tyrosine Hydroxylase)/TYH/DYT14/DYT5b/dystonia 14/Tyrosine 3-hydroxylase/Tyrosine 3-monooxygenase |
| Human | EH1603 | Human SIK1(Serine/threonine-protein kinase SIK1) | SIK1 | 96T | SIK1(Serine/threonine-protein kinase SIK1)/SIK/SIK-1/SNF1LK/Salt-inducible protein kinase 1/Serine,threonine-protein kinase SNF1-like kinase 1/Serine,threonine-protein kinase SNF1LK |
| Human | EH1604 | Human OPTC(Opticin) | OPTC | 96T | OPTC(Opticin)/Oculogylcan/OPTC/OPT |
| Human | EH1606 | Human MTDH(Protein LYRIC) | MTDH | 96T | MTDH(Protein LYRIC)/3D3/AEG1/LYRIC/AEG-13D3,LYRIC/AEG1LYRIC,3D3/Astrocyte elevated gene-1 protein/Metastasis adhesion protein/Lysine-rich CEACAM1 co-isolated protein/Metadherin |
| Human | EH1607 | Human VNN1(Pantetheinase) | VNN1 | 96T | VNN1(Pantetheinase)/HDLCQ8/Pantetheine hydrolase/Tiff66/vanin 1/Vanin-1/Vascular non-inflammatory molecule 1 |
| Human | EH1608 | Human MNX1(Motor neuron and pancreas homeobox protein 1) | MNX1 | 96T | MNX1(Motor neuron and pancreas homeobox protein 1)/HLXB9/Homeobox protein HB9 |
| Human | EH1609 | Human NANOG(Homeobox protein NANOG) | NANOG | 96T | NANOG(Homeobox protein NANOG)/hNanog/Homeobox transcription factor Nanog/homeobox transcription factor Nanog-delta 48/Nanog homeobox |
| Human | EH1610 | Human OTX2(Homeobox protein OTX2) | OTX2 | 96T | OTX2/homeobox protein OTX2/MCOPS5/orthodenticle homeobox 2/Orthodenticle homolog 2/orthodenticle homolog 2(Drosophila) |
| Human | EH1611 | Human RNH1(Ribonuclease inhibitor) | RNH1 | 96T | RNH1/RAI/RNH/PRI/Placental RNase inhibitor/Placental ribonuclease inhibitor/Ribonuclease,angiogenin inhibitor 1 |
| Human | EH1612 | Human UCN2(Urocortin-2) | UCN2 | 96T | UCN2/Urocortin-2/Urocortin-related peptide/Stresscopin-related peptide/Urocortin II/Ucn II/SRP/URP/UII/U-II |
| Human | EH1613 | Human ITPA(Inosine triphosphate pyrophosphatase) | ITPA | 96T | ITPA/Inosine triphosphate pyrophosphatase/ITPase/Inosine triphosphatase/Putative oncogene protein hlc14-06-p/Nucleoside-triphosphate pyrophosphatase/NTPase/Nucleoside-triphosphate diphosphatase/Non-canonical purine NTP pyrophosphatase/Non-standard purine NTP pyrophosphatase/My049/OK/SW-cl.9/C20orf37 |
| Human | EH1615 | Human RAB8A(Ras-related protein Rab-8A) | RAB8A | 96T | RAB8A/Ras-related protein Rab-8A/oncogene c-mel/MEL/RAB8 |
| Human | EH1616 | Human GBA(Glucosylceramidase) | GBA | 96T | GBA/Glucosylceramidase/Imiglucerase/D-glucosyl-N-acylsphingosine glucohydrolase/Beta-glucocerebrosidase/Beta-GC/Acid beta-glucosidase/Alglucerase/GC/GLUC/GBA1/glucosidase, beta, acid/acid(includes glucosylceramidase)/lysosomal glucocerebrosidase |
| Human | EH1617 | Human NDRG1(Protein NDRG1) | NDRG1 | 96T | NDRG1/Protein NDRG1/Rit42/Reducing agents and tunicamycin-responsive protein/RTP/Nickel-specific induction protein Cap43/Differentiation-related gene 1 protein/DRG-1/N-myc downstream-regulated gene 1 protein/CAP43/DRG1/GC4/NDR1/NMSL/TDD5/CMT4D/HMSNL/RIT42/TARG1/PROXY1/tunicamycin-responsive protein |
| Human | EH1618 | Human VSNL1(Visinin-like protein 1) | VSNL1 | 96T | VSNL1/Visinin-like protein 1/VILIP/VLP-1/Hippocalcin-like protein 3/HLP3/HPCAL3/HUVISL1/VILIP-1 |
| Human | EH1619 | Human FASN(Fatty acid synthase) | FASN | 96T | FASN/Fatty acid synthase/FAS/OA-519/SDR27X1 |
| Human | EH1620 | Human PNLIP(Pancreatic triacylglycerol lipase) | PNLIP | 96T | PNLIP/Pancreatic triacylglycerol lipase/PL/PTL/Pancreatic lipase/PNLIPD |
| Human | EH1621 | Human CRYAA(Alpha-crystallin A chain) | CRYAA | 96T | CRYAA/Alpha-crystallin A chain/Heat shock protein beta-4/HspB4/CRYA1/HSPB4/10HspB4/crystallin, alpha A |
| Human | EH1622 | Human CPM(Carboxypeptidase M) | CPM | 96T | CPM/Carboxypeptidase M |
| Human | EH1623 | Human Anti-GM1(Anti-Ganglioside M1 Antibody) | Anti-GM1 | 96T | Anti-GM1/Anti-Ganglioside M1 Antibody |
| Human | EH1624 | Human C1QTNF1(Complement C1q tumor necrosis factor-related protein 1) | C1QTNF1 | 96T | C1QTNF1/Complement C1q tumor necrosis factor-related protein 1/G protein-coupled receptor-interacting protein/GIP/UNQ310/PRO353/CTRP1/C1q and tumor necrosis factor related protein 1 |
| Human | EH1625 | Human ANXA6(Annexin A6) | ANXA6 | 96T | ANXA6/Annexin A6/Lipocortin VI/Chromobindin-20/Calphobindin-II/CPB-II/Annexin-6/p70/p68/Protein III/67 kDa calelectrin/Annexin VI/CBP68/Calelectrin/ANX6 |
| Human | EH1626 | Human BTG3(Protein BTG3) | BTG3 | 96T | BTG3/Protein BTG3/Protein Tob5/Abundant in neuroepithelium area protein/BTG family member 3/ANA/TOB5/TOB55/TOFA |
| Human | EH1627 | Human ACTN4(Alpha-actinin-4) | ACTN4 | 96T | ACTN4/Alpha-actinin-4/F-actin cross-linking protein/Non-muscle alpha-actinin 4/ACTININ-4/FSGS/FSGS1 |
| Human | EH1628 | Human ADAM28(Disintegrin and metalloproteinase domain-containing protein 28) | ADAM28 | 96T | ADAM28/Disintegrin and metalloproteinase domain-containing protein 28/ADAM 28/Epididymial metalloproteinase-like, disintegrin-like, and cysteine-rich protein II/eMDC II/Metalloproteinase-like, disintegrin-like, and cysteine-rich protein L/MDC-L/ADAM23/MDCL/MDC-Lm/MDC-Ls/eMDCII |
| Human | EH1629 | Human ADAMTS6(A disintegrin and metalloproteinase with thrombospondin motifs 6) | ADAMTS6 | 96T | ADAMTS6/A disintegrin and metalloproteinase with thrombospondin motifs 6/ADAM-TS 6/ADAM-TS6/ADAMTS-6 |
| Human | EH1631 | Human DSG2(Desmoglein-2) | DSG2 | 96T | DSG2/Desmoglein-2/Cadherin family member 5/HDGC/CDHF5/ARVC10/ARVD10/CMD1BB/desmoglein 2 |
| Human | EH1632 | Human NDUFA6(NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 6) | NDUFA6 | 96T | NDUFA6/NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 6/NADH-ubiquinone oxidoreductase B14 subunit/Complex I-B14/CI-B14/LYR motif-containing protein 6/B14/LYRM6/CI-B14/NADHB14 |
| Human | EH1633 | Human LAMP2(Lysosome-associated membrane glycoprotein 2) | LAMP2 | 96T | LAMP2/Lysosome-associated membrane glycoprotein 2/CD107 antigen-like family member B/LAMPB/LGP110/CD107b/CD107b antigen/LAMP-2/LAMPB |
| Human | EH1634 | Human ARID4B(AT-rich interactive domain-containing protein 4B) | ARID4B | 96T | ARID4B/AT-rich interactive domain-containing protein 4B/ARID domain-containing protein 4B/Retinoblastoma-binding protein 1-like 1/Histone deacetylase complex subunit SAP180/180 kDa Sin3-associated polypeptide/Sin3-associated polypeptide p180/Breast cancer-associated antigen BRCAA1/BRCAA1/RBBP1L1/RBP1L1/SAP180 |
| Human | EH1635 | Human COL9A3(Collagen alpha-3(IX) chain) | COL9A3 | 96T | COL9A3/Collagen alpha-3(IX) chain/COL9α3/EDM3/IDD/MED |
| Human | EH1636 | Human COL27A1(Collagen alpha-1(XXVII) chain) | COL27A1 | 96T | COL27A1/Collagen alpha-1(XXVII) chain/FLJ11895/MGC11337/KIAA1870 |
| Human | EH1637 | Human COL10A1(Collagen alpha-1(X) chain) | COL10A1 | 96T | COL10A1/Collagen alpha-1(X) chain/COL10-A1/Collagen Type X/COL10 |
| Human | EH1638 | Human COL7A1(Collagen alpha-1(VII) chain) | COL7A1 | 96T | COL7A1/Collagen alpha-1(VII) chain/Long-chain collagen/LC collagen/EBD1/EBDCT/EBR1 |
| Human | EH1639 | Human BMP-15(Bone morphogenetic protein 15) | BMP-15 | 96T | BMP-15(Bone morphogenetic protein 15)/GDF-9B/GDF9B/ODG2/POF4/Growth/differentiation factor 9B |
| Human | EH1640 | Human LAMC2(Laminin subunit gamma-2) | LAMC2 | 96T | LAMC2/Laminin subunit gamma-2/Laminin B2t chain/Ladsin 140 kDa subunit/Kalinin/nicein/epiligrin 100 kDa subunit/Kalinin subunit gamma/Nicein subunit gamma/Large adhesive scatter factor 140 kDa subunit/Laminin-5 subunit gamma/Cell-scattering factor 140 kDa subunit/CSF 140 kDa subunit/Epiligrin subunit gamma/LAMB2T/LAMNB2/B2T/BM600/CSF/EBR2/EBR2A |
| Human | EH1641 | Human LAMB3(Laminin subunit beta-3) | LAMB3 | 96T | LAMB3/Laminin subunit beta-3/Nicein subunit beta/Laminin-5 subunit beta/Laminin B1k chain/Kalinin subunit beta/Epiligrin subunit bata/Kalinin B1 chain/LAM5/LAMNB1/BM600-125KDA |
| Human | EH1642 | Human LAMB2(Laminin subunit beta-2) | LAMB2 | 96T | LAMB2/Laminin subunit beta-2/Laminin-4 subunit beta/Laminin-3 subunit beta/Laminin-15 subunit beta/Laminin-14 subunit beta/S-laminin subunit beta/S-LAM beta/Laminin-9 subunit beta/Laminin-7 subunit beta/Laminin B1s chain/Laminin-11 subunit beta |
| Human | EH1643 | Human LAMB4(Laminin subunit beta-4) | LAMB4 | 96T | LAMB4/Laminin subunit beta-4/Laminin beta-1-related protein |
| Human | EH1644 | Human FAM3A(Protein FAM3A) | FAM3A | 96T | FAM3A/Protein FAM3A/Cytokine-like protein 2-19/2-19/2.19/XAP-7/family with sequence similarity 3, member A/DLD/DXS560S |
| Human | EH1645 | Human LAMA5(Laminin subunit alpha-5) | LAMA5 | 96T | LAMA5/Laminin subunit alpha-5/Laminin-15 subunit alpha/Laminin-10 subunit alpha/Laminin-11 subunit alpha/KIAA0533/KIAA1907 |
| Human | EH1646 | Human FAM20B(Glycosaminoglycan xylosylkinase) | FAM20B | 96T | FAM20B/Glycosaminoglycan xylosylkinase/Protein FAM20B/Xylose kinase/gxk1/XYLK |
| Human | EH1647 | Human BTN2A1(Butyrophilin subfamily 2 member A1) | BTN2A1 | 96T | BTN2A1/Butyrophilin subfamily 2 member A1 |
| Human | EH1648 | Human HMGB2(High mobility group protein B2) | HMGB2 | 96T | HMGB2/High mobility group protein B2/High mobility group protein 2/HMG-2 |
| Human | EH1649 | Human MGP(Matrix Gla protein) | MGP | 96T | MGP(Matrix Gla Protein)/Cell growth-inhibiting gene 36 protein |
| Human | EH1650 | Human HMGA1(High mobility group protein HMG-I/HMG-Y) | HMGA1 | 96T | HMGA1/High mobility group protein HMG-I/HMG-Y/HMG-I(Y))/High mobility group AT-hook protein 1/High mobility group protein A1/High mobility group protein R/HMGIY/HMG-R/HMG-Y |
| Human | EH1651 | Human LARP7(La-related protein 7) | LARP7 | 96T | LARP7/La-related protein 7/La ribonucleoprotein domain family member 7/P-TEFb-interaction protein for 7SK stability/PIP7S/HDCMA18P |
| Human | EH1652 | Human DDX42(ATP-dependent RNA helicase DDX42) | DDX42 | 96T | DDX42/ATP-dependent RNA helicase DDX42/Splicing factor 3B-associated 125 kDa protein/SF3b125/SF3b DEAD box protein/RNA helicase-related protein/RNAHP/DEAD box protein 42/RNA helicase-like protein/RHELP |
| Human | EH1653 | Human BDG(beta-D-glucan) | BDG | 96T | / |
| Human | EH1654 | Human AMY1(Alpha-amylase 1) | AMY1 | 96T | AMY1/Alpha-amylase 1/Amylase Alpha 1, Salivary/1,4-alpha-D-glucan glucanohydrolase 1/Salivary alpha-amylase |
| Human | EH1655 | Human CELA1(Chymotrypsin-like elastase family member 1) | CELA1 | 96T | CELA1/Chymotrypsin-like elastase family member 1/Elastase-1/Pancreatic elastase 1/ELA1 |
| Human | EH1656 | Human TRUB1(Probable tRNA pseudouridine synthase 1) | TRUB1 | 96T | TRUB1/Probable tRNA pseudouridine synthase 1/PUS4 |
| Human | EH1657 | Human S100A7(Protein S100-A7) | S100A7 | 96T | S100A7/S100 Calcium Binding Protein A7/Protein S100-A7/Psoriasin/PSOR1/S100A7C/HID 5/HID5/HID-5/psoriasin 1 |
| Human | EH1658 | Human HIST1H4A(Histone H4) | HIST1H4A | 96T | HIST1H4A/Histone H4/H4/A/H4FA/H4F2/histone cluster 4, H4 |
| Human | EH1659 | Human CALR(Calreticulin) | CALR | 96T | CALR/CRT/Calreticulin/grp60/HACBP/Endoplasmic reticulum resident protein60/ERp60/CRP55/CRTC/calprotectin/calregulin/CaBP3/calsequestrin-like protein/endoplasmic reticulum resident protein 60 |
| Human | EH1661 | Human PTEN(Phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN) | PTEN | 96T | PTEN/Phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN/Mutated in multiple advanced cancers 1/Phosphatase and tensin homolog/MMAC1/TEP1 |
| Human | EH1662 | Human NOX4(NADPH oxidase 4) | NOX4 | 96T | NOX4/NADPH oxidase 4/Renal NAD(P)H-oxidase/Kidney oxidase-1/KOX-1/Kidney superoxide-producing NADPH oxidase/RENOX |
| Human | EH1663 | Human SULT1A1(Sulfotransferase 1A1) | SULT1A1 | 96T | SULT1A1/Sulfotransferase 1A1/ST1A1/Thermostable phenol sulfotransferase/Ts-PST/ST1A3/Phenol-sulfating phenol sulfotransferase 1/P-PST 1/Phenol sulfotransferase 1/Aryl sulfotransferase 1/HAST1/HAST2/STP/STP1 |
| Human | EH1664 | Human NDP(Norrin) | NDP | 96T | NDP/Norrin/Norrie disease protein/pseudoglioma/X-linked exudative vitreoretinopathy 2 protein/EVR2/exudative vitreoretinopathy 2(X-linked)/FEVR/ND |
| Human | EH1665 | Human MMP19(Matrix metalloproteinase-19) | MMP19 | 96T | MMP19/Matrix metalloproteinase-19/MMP-19/Matrix metalloproteinase RASI/Matrix metalloproteinase-18/MMP-18/MMP18/RASI/RASI-1 |
| Human | EH1666 | Human QDPR(Dihydropteridine reductase) | QDPR | 96T | QDPR/DHPR/HDHPR/PKU2/SDR33C1/DHPR member 1/Dihydropteridine reductase/Quinoid Dihydropteridine Reductase |
| Human | EH1667 | Human BPIFA2(BPI fold-containing family A member 2) | BPIFA2 | 96T | BPIFA2/BPI fold-containing family A member 2/C20orf70/SPLUNC2/chromosome 20 open reading frame 70/Parotid secretory protein/PSP/short palate, lung and nasal epithelium carcinoma associated 2/short palate, lung and nasal epithelium carcinoma-associated protein 2 |
| Human | EH1668 | Human GUCY2C(Heat-stable enterotoxin receptor) | GUCY2C | 96T | GUCY2C/Heat-stable enterotoxin receptor/STA receptor/hSTAR/GUC2C/STAR/Guanylyl cyclase C/GC-C/Intestinal guanylate cyclase |
| Human | EH1669 | Human IRF3(Interferon regulatory factor 3) | IRF3 | 96T | IRF3/Interferon regulatory factor 3/IRF-3 |
| Human | EH1670 | Human MST1P9(Putative macrophage-stimulating protein MSTP9) | MST1P9 | 96T | MST1P9/Putative macrophage-stimulating protein MSTP9/Brain rescue factor 1/BRF-1/Hepatocyte growth factor-like protein homolog |
| Human | EH1671 | Human UTS2D(Urotensin-2B) | UTS2D | 96T | UTS2D/Urotensin-2B/Urotensin-2 domain-containing protein/Urotensin II-related peptide/Urotensin IIB/U-IIB/UIIB |
| Human | EH1672 | Human OTC(Ornithine carbamoyltransferase, mitochondrial) | OTC | 96T | OTC/Ornithine carbamoyltransferase, mitochondrial/Ornithine transcarbamylase/OTCase |
| Human | EH1673 | Human ISG15(Ubiquitin-like protein ISG15) | ISG15 | 96T | ISG15(Interferon Stimulated Gene 15)/UCRP/G1P2/IFI15/IP17/G1P2interferon-induced 17-kDa/15-kDa protein/interferon, alpha-inducible protein(clone IFI-15K)/Interferon-induced 15 kDa protein/Interferon-induced 17 kDa protein/interferon-stimulated protein, 15 kDa/ISG15 ubiquitin-like modifier/Ubiquitin cross-reactive protein/ubiquitin-like protein ISG15/UCRPIP17 |
| Human | EH1674 | Human OCLN(Occludin) | OCLN | 96T | OCLN(Occludin)/BLCPMG |
| Human | EH1675 | Human GPC2(Glypican-2) | GPC2 | 96T | GPC2/Glypican-2/Glypican 2/Cerebroglycan |
| Human | EH1676 | Human FBN3(Fibrillin-3) | FBN3 | 96T | FBN3(Fibrillin 3)/Fibrillin-3 |
| Human | EH1677 | Human MSRB2(Methionine-R-sulfoxide reductase B2, mitochondrial) | MSRB2 | 96T | MSRB2/Methionine-R-sulfoxide reductase B2, mitochondrial/MsrB2 |
| Human | EH1678 | Human GATA5(Transcription factor GATA-5) | GATA5 | 96T | GATA5/GATA binding factor-5/GATA binding protein 5/GATA-binding factor 5/GATA-binding protein 5/transcription factor GATA-5 |
| Human | EH1679 | Human LOXL2(Lysyl oxidase homolog 2) | LOXL2 | 96T | LOXL2/Lysyl Oxidase Homolog 2/LOL2/LOR2/lysyl oxidase related 2/lysyl oxidase-like 2/Lysyl oxidase-like protein 2/Lysyl oxidase-related protein 2/Lysyl oxidase-related protein WS9-14/WS9-14 |
| Human | EH1680 | Human FMOD(Fibromodulin) | FMOD | 96T | FMOD(Fibromodulin)/FM/SLRR2E/Collagen-binding 59 kDa protein/fibromodulin proteoglycan/Keratan sulfate proteoglycan fibromodulin |
| Human | EH1681 | Human FAM132B(Protein FAM132B) | FAM132B | 96T | FAM132B/Protein FAM132B/Complement C1q tumor necrosis factor-related protein 15/Myonectin/C1QTNF15/CTRP15 |
| Human | EH1682 | Human EBLN1(Endogenous Bornavirus-like nucleoprotein 1) | EBLN1 | 96T | EBLN1/Endogenous Bornavirus-like nucleoprotein 1/Endogenous Borna-like N element-1/EBLN-1 |
| Human | EH1683 | Human SORD(Sorbitol dehydrogenase) | SORD | 96T | SORD/SDH/Sorbitol dehydrogenase/L-iditol 2-dehydrogenase |
| Human | EH1685 | Human DTNBP1(Dysbindin) | DTNBP1 | 96T | DTNBP1/Dysbindin/Hermansky-Pudlak syndrome 7 protein/HPS7 protein/Hermansky-Pudlak syndrome 7 protein/HPS7 protein/Dysbindin-1/BLOC-1 subunit 8/Dystrobrevin-binding protein 1/My031/BLOC1S8/DBND/HPS7 |
| Human | EH1686 | Human MTOR(Serine/threonine-protein kinase mTOR) | MTOR | 96T | MTOR/Serine/threonine-protein kinase mTOR/Rapamycin target protein 1/Rapamycin target protein 1/RAPT1/Mechanistic target of rapamycin/Mammalian target of rapamycin/mTOR/FK506-binding protein 12-rapamycin complex-associated protein 1/FKBP12-rapamycin complex-associated protein/FRAP/FRAP1/FRAP2 |
| Human | EH1687 | Human ZEB1(Zinc finger E-box-binding homeobox 1) | ZEB1 | 96T | ZEB1/Zinc finger E-box-binding homeobox 1/Transcription factor 8/TCF-8/NIL-2-A zinc finger protein/Negative regulator of IL2/AREB6/TCF8/BZP/DELTAEF1/FECD6/NIL2A/PPCD3/ZFHEP/delta-crystallin enhancer binding factor 1/Negative regulator of IL2/posterior polymorphous corneal dystrophy 3/TCF8BZP/represses interleukin 2 ｅxpression/ZEB/Zfhep/ZFHEP/ZFHX1A/Zfhx1a |
| Human | EH1688 | Human ZEB2(Zinc finger E-box-binding homeobox 2) | ZEB2 | 96T | ZEB2/Zinc finger E-box-binding homeobox 2/Smad-interacting protein 1/SMADIP1/Zinc finger homeobox protein 1b/SIP1/SIP-1/ZFHX1B/HSPC082/HRIHFB2411/KIAA0569/ZFHX1B/ZFX1B |
| Human | EH1689 | Human CA3(Carbonic anhydrase 3) | CA3 | 96T | CA3/Carbonic Anhydrase III, Muscle Specific/Carbonic anhydrase 3 |
| Human | EH1690 | Human AMFR(E3 ubiquitin-protein ligase AMFR) | AMFR | 96T | AMFR/E3 ubiquitin-protein ligase AMFR/gp78/Autocrine motility factor receptor/AMF receptor/RING finger protein 45/GP78/RNF45 |
| Human | EH1691 | Human TCF3(Transcription factor E2-alpha) | TCF3 | 96T | TCF3/Transcription factor E2-alpha/Transcription factor ITF-1/Transcription factor 3/TCF-3/Kappa-E2-binding factor/Immunoglobulin transcription factor 1/Class B basic helix-loop-helix protein 21/bHLHb21/Immunoglobulin enhancer-binding factor E12/E47/BHLHB21/E2A/ITF1 |
| Human | EH1692 | Human IKBKE(Inhibitor of nuclear factor kappa-B kinase subunit epsilon) | IKBKE | 96T | IKBKE/Inhibitor of nuclear factor kappa-B kinase subunit epsilon/I-kappa-B kinase epsilon/IKK-E/IKK-epsilon/IkBKE/Inducible I kappa-B kinase/IKK-i/IKKE/IKKI/KIAA0151 |
| Human | EH1693 | Human HARS(Histidyl-tRNA synthetase, cytoplasmic) | HARS | 96T | HARS/Histidyl-tRNA synthetase, cytoplasmic/Histidine--tRNA ligase/HisRS/HRS |
| Human | EH1694 | Human PKD2(Polycystin-2) | PKD2 | 96T | PKD2/Polycystin-2/Polycystwin/Autosomal dominant polycystic kidney disease type II protein/Polycystic kidney disease 2 protein |
| Human | EH1695 | Human ICAM-4(Intercellular adhesion molecule 4) | ICAM-4 | 96T | ICAM-4/Intercellular adhesion molecule 4/LW/Landsteiner-Weiner blood system/Landsteiner-Wiener blood group/Landsteiner-Wiener blood group glycoprotein/LW blood group protein/CD242 |
| Human | EH1697 | Human IFIT1(Interferon-induced protein with tetratricopeptide repeats 1) | IFIT1 | 96T | IFIT1/Interferon-induced protein with tetratricopeptide repeats 1/IFIT-1/Interferon-induced 56 kDa protein/IFI-56K/G10P1/IFI56/IFNAI1/ISG56/GARG-16/IFI-56/ISG56/RNM561 |
| Human | EH1698 | Human SDCBP(Syntenin-1) | SDCBP | 96T | SDCBP/Syntenin-1/Syndecan-binding protein 1/Scaffold protein Pbp1/Melanoma differentiation-associated protein 9/MDA-9/Pro-TGF-alpha cytoplasmic domain-interacting protein 18/TACIP18/MDA9/SYCL/ST1 |
| Human | EH1699 | Human SERPINA2(Putative alpha-1-antitrypsin-related protein) | SERPINA2 | 96T | SERPINA2/Putative alpha-1-antitrypsin-related protein/Serpin A2/ARGS/ATR/PIL |
| Human | EH1700 | Human MTR(Methionine synthase) | MTR | 96T | MTR/Methionine synthase/5-methyltetrahydrofolate--homocysteine methyltransferase/Vitamin-B12 dependent methionine synthase/MS |
| Human | EH1701 | Human CD109(CD109 antigen) | CD109 | 96T | CD109/CPAMD7/150 kDa TGF-beta-1-binding protein/activated T-cell marker CD109/C3 and PZP-like alpha-2-macroglobulin domain-containing protein 7/CD109 antigen/CD109 molecule/CPAMD7r150/Gov platelet alloantigens/Platelet-specific Gov antigen/r150/p180 |
| Human | EH1702 | Human RAB14(Ras-related protein Rab-14) | RAB14 | 96T | RAB14/Ras-related protein Rab-14/FBP/RAB-14 |
| Human | EH1703 | Human TACR3(Neuromedin-K receptor) | TACR3 | 96T | TACR3(Tachykinin Receptor 3)/Neuromedin-K receptor/NKR/NK-3 receptor/NK-3R/Neurokinin B receptor |
| Human | EH1705 | Human FAM214A(Protein FAM214A) | FAM214A | 96T | FAM214A/Protein FAM214A |
| Human | EH1706 | Human PTGDR(Prostaglandin D2 receptor) | PTGDR | 96T | PTGDR/Prostaglandin D2 receptor/PGD receptor/PGD2 receptor/Prostanoid DP receptor |
| Human | EH1708 | Human ABCA7(ATP-binding cassette sub-family A member 7) | ABCA7 | 96T | ABCA7/ATP-binding cassette sub-family A member 7/Macrophage ABC transporter/ABCA-SSN/Autoantigen SS-N |
| Human | EH1709 | Human PLEKHO1(Pleckstrin homology domain-containing family O member 1) | PLEKHO1 | 96T | PLEKHO1/Pleckstrin homology domain-containing family O member 1/PH domain-containing family O member 1/Osteoclast maturation-associated gene 120 protein/C-Jun-binding protein/JBP/Casein kinase 2-interacting protein 1/CK2-interacting protein 1/CKIP-1 |
| Human | EH1710 | Human GALC(Galactocerebrosidase) | GALC | 96T | GALC/Galactocerebrosidase/Galactocerebroside beta-galactosidase/Galactosylceraminidase/galactosylceramidase(Krabbe disease)/Galactosylceramide beta-galactosidase/GALCERase |
| Human | EH1711 | Human SERPINB13(Serpin B13) | SERPINB13 | 96T | SERPINB13/Serpin B13/Proteinase inhibitor 13/Peptidase inhibitor 13/PI-13/HaCaT UV-repressible serpin/Hurpin/Headpin |
| Human | EH1712 | Human TTPAL(Alpha-tocopherol transfer protein-like) | TTPAL | 96T | TTPAL/Alpha-tocopherol transfer protein-like |
| Human | EH1713 | Human HSPE1(10 kDa heat shock protein, mitochondrial) | HSPE1 | 96T | HSPE1/10 kDa heat shock protein, mitochondrial/Hsp10/Early-pregnancy factor/EPF/10 kDa chaperonin/Chaperonin 10/CPN10/Chaperonin 10 Homolog/GroES/GROES/heat shock 10kD protein 1 |
| Human | EH1715 | Human LIG3(DNA ligase 3) | LIG3 | 96T | LIG3/DNA ligase 3/DNA ligase III/Polydeoxyribonucleotide synthase [ATP] 3 |
| Human | EH1716 | Human C1S(Complement C1s subcomponent) | C1S | 96T | C1S/Complement C1s subcomponent/C1 esterase/Complement component 1 subcomponent s |
| Human | EH1717 | Human PGLYRP2(N-acetylmuramoyl-L-alanine amidase) | PGLYRP2 | 96T | PGLYRP2/N-acetylmuramoyl-L-alanine amidase/PGRP-L/Peptidoglycan recognition protein 2/Peptidoglycan recognition protein long |
| Human | EH1718 | Human COLEC11(Collectin-11) | COLEC11 | 96T | COLEC11(Collectin Sub-Family Member 11)/Collectin-11/CL-K1/Dual specificity protein kinase CLK1/Protein tyrosine kinase STY/STY |
| Human | EH1719 | Human CNTN1(Contactin-1) | CNTN1 | 96T | CNTN1(Contactin 1)/Contactin-1/Glycoprotein gp135/Neural cell surface protein F3 |
| Human | EH1720 | Human MCTS1(Malignant T cell-amplified sequence 1) | MCTS1 | 96T | MCTS1(Malignant T-Cell-Amplified Sequence 1)/MCT1/SLC16A1/HHF7/malignant T cell amplified sequence 1/MCT-1/Multiple Copies T-Cell Malignancies |
| Human | EH1721 | Human SLC25A4(ADP/ATP translocase 1) | SLC25A4 | 96T | SLC25A4/ADP/ATP translocase 1/Solute carrier family 25 member 4/Adenine nucleotide translocator 1/ANT 1/ADP,ATP carrier protein 1/ADP,ATP carrier protein, heart/skeletal muscle isoform T1/T1/ANT/AAC1/PEO2/PEO3 |
| Human | EH1722 | Human ALDH4A1(Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial) | ALDH4A1 | 96T | ALDH4A1/Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial/P5C dehydrogenase/Aldehyde dehydrogenase family 4 member A1/L-glutamate gamma-semialdehyde dehydrogenase/ALDH4/P5CDH/P5CD/P5CDh/P5CDhL/P5CDhS |
| Human | EH1723 | Human NFE2L1(Nuclear factor erythroid 2-related factor 1) | NFE2L1 | 96T | NFE2L1/Nuclear factor erythroid 2-related factor 1/NF-E2-related factor 1/NFE2-related factor 1/Transcription factor LCR-F1/Transcription factor HBZ17/Transcription factor 11/TCF-11/Locus control region-factor 1/Nuclear factor, erythroid derived 2, like 1/NRF1/TCF11/LCR-F1/HBZ17/Alpha palindromic-binding protein/Alpha-pal/ALPHA-PAL/EWG/NRF-1/nuclear respiratory factor 1 |
| Human | EH1724 | Human CHAD(Chondroadherin) | CHAD | 96T | CHAD/Chondroadherin/Cartilage leucine-rich protein/SLRR4A |
| Human | EH1725 | Human YIF1B(Protein YIF1B) | YIF1B | 96T | YIF1B/Protein YIF1B/YIP1-interacting factor homolog B |
| Human | EH1726 | Human DMD(Dystrophin) | DMD | 96T | DMD/Dystrophin |
| Human | EH1727 | Human SLC50A1(Sugar transporter SWEET1) | SLC50A1 | 96T | SLC50A1/Sugar transporter SWEET1/HsSWEET1/Stromal cell protein/RAG1-activating protein 1/Solute carrier family 50 member 1/RAG1AP1/SCP |
| Human | EH1728 | Human PSIP1(PC4 and SFRS1-interacting protein) | PSIP1 | 96T | PSIP1/PC4 and SFRS1-interacting protein/Transcriptional coactivator p75/p52/Lens epithelium-derived growth factor/CLL-associated antigen KW-7/Dense fine speckles 70 kDa protein/DFS 70/DFS70/LEDGF/PSIP2 |
| Human | EH1729 | Human ATG5(Autophagy protein 5) | ATG5 | 96T | ATG5/Autophagy protein 5/APG5-like/Apoptosis-specific protein/APG5L/ASP/hAPG5/ATG5 autophagy related 5 homolog |
| Human | EH1730 | Human CNP(2',3'-cyclic-nucleotide 3'-phosphodiesterase) | CNP | 96T | CNP/2',3'-cyclic-nucleotide 3'-phosphodiesterase/CNPase |
| Human | EH1731 | Human TAGLN3(Transgelin-3) | TAGLN3 | 96T | TAGLN3/Transgelin-3/Neuronal protein 22/NP22/Neuronal protein NP25/NP25 |
| Human | EH1732 | Human ATP7A(Copper-transporting ATPase 1) | ATP7A | 96T | ATP7A/Copper-transporting ATPase 1/Copper pump 1/Menkes disease-associated protein/MC1/MNK/DSMAX/SMAX3/MK |
| Human | EH1733 | Human NEDD9(Enhancer of filamentation 1) | NEDD9 | 96T | NEDD9/Enhancer of filamentation 1/hEF1/p105/Renal carcinoma antigen NY-REN-12/Neural precursor cell expressed developmentally down-regulated protein 9/NEDD-9/CRK-associated substrate-related protein/CAS-L/CasL/Cas scaffolding protein family member 2/CASS2/CAS2 |
| Human | EH1734 | Human HLA-DRB5(HLA class II histocompatibility antigen, DR beta 5 chain) | HLA-DRB5 | 96T | HLA-DRB5/HLA class II histocompatibility antigen, DR beta 5 chain/MHC class II antigen DRB5/Dw2/DR beta-5/DR2-beta-2/HLA-DRB |
| Human | EH1735 | Human S100A12(Protein S100-A12) | S100A12 | 96T | S100A12/Protein S100-A12/S100 Calcium Binding Protein A12/S100 calcium-binding protein A12/Neutrophil S100 protein/MRP-6/Extracellular newly identified RAGE-binding protein/EN-RAGE/Calgranulin-C/CAGC/p6/CGRP/Calcium-binding protein in amniotic fluid 1/CAAF1/MRP6/CAAF1/MRP-6/ENRAGE |
| Human | EH1736 | Human BAD(Bcl2 antagonist of cell death) | BAD | 96T | BAD/Bcl2 antagonist of cell death/Bcl-XL/Bcl-2-associated death promoter/Bcl-2-binding component 6/Bcl-2-like protein 8/Bcl2-L-8/Bcl2 Associated Death Promoter/BBC2/BCL2L8 |
| Human | EH1737 | Human NNMT(Nicotinamide N-methyltransferase) | NNMT | 96T | NNMT/Nicotinamide N-methyltransferase |
| Human | EH1738 | Human TES(Testin) | TES | 96T | TES/Testin/TESS |
| Human | EH1739 | Human DDR2(Discoidin domain-containing receptor 2) | DDR2 | 96T | DDR2/Discoidin domain-containing receptor 2/Discoidin domain receptor 2/Tyrosine-protein kinase TYRO10/Receptor protein-tyrosine kinase TKT/Neurotrophic tyrosine kinase, receptor-related 3/CD167 antigen-like family member B/Discoidin domain-containing receptor tyrosine kinase 2/NTRKR3/TKT/TYRO10/Trk3/CD167b antigen |
| Human | EH1740 | Human PTGES(Prostaglandin E synthase) | PTGES | 96T | PTGES/Prostaglandin E synthase/p53-induced gene 12 protein/Microsomal glutathione S-transferase 1-like 1/MGST1-L1/Microsomal prostaglandin E synthase 1/MPGES-1/MGST1L1/MPGES1/PGES/PIG12/MGST-IV/MGST1-L1/MPGES/PP102/PP1294/TP53I12/mPGES-1 |
| Human | EH1742 | Human GLS(Glutaminase kidney isoform, mitochondrial) | GLS | 96T | GLS/Glutaminase kidney isoform, mitochondrial/GLS/K-glutaminase/L-glutamine amidohydrolase/GLS1 |
| Human | EH1743 | Human SEPT3(Neuronal-specific septin-3) | SEPT3 | 96T | SEPT3/Neuronal-specific septin-3/SEP3 |
| Human | EH1744 | Human SNAP25(Synaptosomal-associated protein 25) | SNAP25 | 96T | SNAP25/Synaptosomal-associated protein 25/SNAP-25/Super protein/SUP/Synaptosomal-associated 25 kDa protein/SNAP/RIC4/SEC9/SNAP/RIC-4/SNAP-25 |
| Human | EH1745 | Human MELK(Maternal embryonic leucine zipper kinase) | MELK | 96T | MELK/Maternal embryonic leucine zipper kinase/hMELK/Tyrosine-protein kinase MELK/Protein kinase Eg3/pEg3 kinase/Protein kinase PK38/hPK38 |
| Human | EH1747 | Human PPA1(Inorganic pyrophosphatase) | PPA1 | 96T | PPA1/Inorganic pyrophosphatase/Pyrophosphate phospho-hydrolase/PPase/IOPPP/PP/PP1/inorganic diphosphatase/cytosolic inorganic pyrophosphatase |
| Human | EH1750 | Human RET(Proto-oncogene tyrosine-protein kinase receptor Ret) | RET | 96T | RET/Proto-oncogene tyrosine-protein kinase receptor Ret/Cadherin family member 12/Proto-oncogene c-Ret/Hirschsprung disease 1/multiple endocrine neoplasia and medullary thyroid carcinoma 1/ret proto-oncogene/RET transforming sequence/CDHR16/MEN2A/MEN2B/CDHF12/CDHR16/PTC/RET51 |
| Human | EH1751 | Human MCFD2(Multiple coagulation factor deficiency protein 2) | MCFD2 | 96T | MCFD2/Multiple coagulation factor deficiency protein 2/Neural stem cell-derived neuronal survival protein/SDNSF |
| Human | EH1752 | Human CD177(CD177 antigen) | CD177 | 96T | CD177/CD177 antigen/Polycythemia rubra vera protein 1/PRV-1/Human neutrophil alloantigen 2a/HNA-2a/NB1 glycoprotein/NB1 GP/NB1/PRV1/HNA2A/PRV-1/HNA-2a/NB1 GP |
| Human | EH1753 | Human ITGB3(Integrin beta-3) | ITGB3 | 96T | ITGB3/Integrin beta-3/Platelet membrane glycoprotein IIIa/GPIIIa/GP3A/CD61/INGRB3/ITG B3 |
| Human | EH1754 | Human MPP6(MAGUK p55 subfamily member 6) | MPP6 | 96T | MPP6/MAGUK p55 subfamily member 6/Veli-associated MAGUK 1/VAM-1/VAM1 |
| Human | EH1755 | Human HADH(Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial) | HADH | 96T | HADH/Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial/HCDH/Medium and short-chain L-3-hydroxyacyl-coenzyme A dehydrogenase/Short-chain 3-hydroxyacyl-CoA dehydrogenase/HAD/HADHSC/SCHAD/HADH1/HHF4/M/SCHAD |
| Human | EH1756 | Human DMBT1(Deleted in malignant brain tumors 1 protein) | DMBT1 | 96T | DMBT1/Deleted in malignant brain tumors 1 protein/Surfactant pulmonary-associated D-binding protein/Salivary agglutinin/SAG/Glycoprotein 340/Gp-340/Hensin/GP340/muclin |
| Human | EH1757 | Human CDK5R1(Cyclin-dependent kinase 5 activator 1) | CDK5R1 | 96T | CDK5R1/Cyclin-dependent kinase 5 activator 1/CDK5 activator 1/Cyclin-dependent kinase 5 regulatory subunit 1/TPKII regulatory subunit/CDK5R/NCK5A |
| Human | EH1758 | Human CES2(Cocaine esterase) | CES2 | 96T | CES2/Cocaine esterase/Carboxylesterase 2/CE-2/hCE-2/Methylumbelliferyl-acetate deacetylase 2/ICE/CES2A1/PCE-2 |
| Human | EH1759 | Human WTAP(Pre-mRNA-splicing regulator WTAP) | WTAP | 96T | WTAP/Pre-mRNA-splicing regulator WTAP/Wilms tumor 1-associating protein/Female-lethal(2)D homolog/hFL(2)D/WT1-associated protein/KIAA0105 |
| Human | EH1760 | Human SNX1(Sorting nexin-1) | SNX1 | 96T | SNX1/Sorting nexin-1 |
| Human | EH1761 | Human LGALS3BP(Galectin-3-binding protein) | LGALS3BP | 96T | LGALS3BP/Galectin-3-binding protein/Tumor-associated antigen 90K/Mac-2-binding protein/MAC2BP/Mac-2 BP/Basement membrane autoantigen p105/Lectin galactoside-binding soluble 3-binding protein/M2BP |
| Human | EH1762 | Human CFLAR(CASP8 and FADD-like apoptosis regulator) | CFLAR | 96T | CFLAR/CASP8 and FADD-like apoptosis regulator/Inhibitor of FLICE/I-FLICE/FADD-like antiapoptotic molecule 1/FLAME-1/Cellular FLICE-like inhibitory protein/c-FLIP/Caspase-like apoptosis regulatory protein/CLARP/Usurpin/MACH-related inducer of toxicity/MRIT/Caspase homolog/CASH/Caspase-eight-related protein/Casper/CASP8AP1 |
| Human | EH1764 | Human CASR(Extracellular calcium-sensing receptor) | CASR | 96T | CASR/Extracellular calcium-sensing receptor/CaSR/Parathyroid cell calcium-sensing receptor/PCaR1/GPRC2A/CAR/EIG8/FHH/FIH/HHC, HHC1/NSHPT |
| Human | EH1765 | Human ADCYAP1R1(Pituitary adenylate cyclase-activating polypeptide type I receptor) | ADCYAP1R1 | 96T | ADCYAP1R1/Pituitary adenylate cyclase-activating polypeptide type I receptor/PACAP type I receptor/PACAP-R-1/PACAP-R1/PAC1/PAC1R/PACAPR/PACAPRI |
| Human | EH1766 | Human VIPR1(Vasoactive intestinal polypeptide receptor 1) | VIPR1 | 96T | VIPR1/Vasoactive intestinal polypeptide receptor 1/VIP-R-1/Pituitary adenylate cyclase-activating polypeptide type II receptor/PACAP type II receptor/PACAP-R-2/PACAP-R2/VPAC1 |
| Human | EH1767 | Human VIPR2(Vasoactive intestinal polypeptide receptor 2) | VIPR2 | 96T | VIPR2/Vasoactive intestinal polypeptide receptor 2/VIP-R-2/VPAC2/Helodermin-preferring VIP receptor/Pituitary adenylate cyclase-activating polypeptide type III receptor/PACAP type III receptor/PACAP-R-3/PACAP-R3/VIP2R |
| Human | EH1768 | Human DDR1(Epithelial discoidin domain-containing receptor 1) | DDR1 | 96T | DDR1/Epithelial discoidin domain-containing receptor 1/Epithelial discoidin domain receptor 1/Protein-tyrosine kinase 3A/Mammary carcinoma kinase 10/MCK-10/HGK2/Discoidin receptor tyrosine kinase/Tyrosine kinase DDR/TRK E/Protein-tyrosine kinase RTK-6/Tyrosine-protein kinase CAK/CD167 antigen-like family member A/Cell adhesion kinase/CAK/EDDR1/NEP/NTRK4/PTK3A/RTK6/TRKE |
| Human | EH1769 | Human DVL1(Segment polarity protein dishevelled homolog DVL-1) | DVL1 | 96T | DVL1/Segment polarity protein dishevelled homolog DVL-1/Dishevelled-1/DSH homolog 1/DVL/dishevelled, dsh homolog 1/Drosophila/dishevelled 1/homologous to Drosophila dsh/ |
| Human | EH1770 | Human PLEC(Plectin) | PLEC | 96T | PLEC/Plectin/PCN/PLTN/Hemidesmosomal protein 1/HD1/Plectin-1/PLEC1/EBS1/EBSO/LGMD2Q/PLEC1b |
| Human | EH1771 | Human SFN(14-3-3 protein sigma) | SFN | 96T | SFN/14-3-3 protein sigma/Epithelial cell marker protein 1/Stratifin/HME1/YWHAS |
| Human | EH1772 | Human JUP(Junction plakoglobin) | JUP | 96T | JUP/Junction plakoglobin/Desmoplakin-3/Catenin gamma/Desmoplakin III |
| Human | EH1773 | Human CA12(Carbonic anhydrase 12) | CA12 | 96T | CA12/Carbonate dehydratase XII/carbonic anhydrase 12/carbonic dehydratase/CA-XII |
| Human | EH1774 | Human ITGA4(Integrin alpha-4) | ITGA4 | 96T | ITGA4/Integrin alpha 4/CD49d/VLA-4/269C wild type/CD49 antigen-like family member D/CD49d antigen/IA4/integrin alpha-4/integrin alpha-4 subunit/Integrin alpha-IV/very late activation protein 4 receptor, alpha 4 subunit/VLA-4 subunit alpha |
| Human | EH1775 | Human MPEG1(Macrophage-expressed gene 1 protein) | MPEG1 | 96T | MPEG1/Macrophage-expressed gene 1 protein/Macrophage gene 1 protein/Mpg-1 |
| Human | EH1776 | Human SEMA5A(Semaphorin-5A) | SEMA5A | 96T | SEMA5A/Semaphorin-5A/Semaphorin-F/Sema F/SEMAF/semaphorin F/SEMF/transmembrane domain(TM) and short cytoplasmic domain,(semaphorin) 5A |
| Human | EH1777 | Human ACTN2 (Actinin Alpha 2) | ACTN2 | 96T | ACTN2(Actinin Alpha 2)/CMD1AA |
| Human | EH1778 | Human IRAK1(Interleukin-1 receptor-associated kinase 1) | IRAK1 | 96T | IRAK1/Interleukin-1 Receptor-Associated Kinase 1/Il1rak/Pelle/Plpk/IRAK-1/IRAKPelle homolog |
| Human | EH1779 | Human LRRK2(Leucine-rich repeat serine/threonine-protein kinase 2) | LRRK2 | 96T | LRRK2/AURA17/Dardarin/PARK8/ROCO2/augmented in rheumatoid arthritis 17/leucine-rich repeat kinase 2/leucine-rich repeat serine,threonine-protein kinase 2/RIPK7 |
| Human | EH1780 | Human HTN3(Histatin-3) | HTN3 | 96T | HTN3/Histatin-3/PB/Basic histidine-rich protein/Hst/Histidine-rich protein 3 |
| Human | EH1781 | Human EPCA2(Early Prostate Cancer Antigen 2) | EPCA2 | 96T | |
| Human | EH1782 | Human NEO1(Neogenin) | NEO1 | 96T | NEO1/Neogenin/NEO/NGN/Immunoglobulin superfamily DCC subclass member 2/neogenin 1/neogenin homolog 1 |
| Human | EH1783 | Human NFATC1(Nuclear factor of activated T-cells, cytoplasmic 1) | NFATC1 | 96T | NFATC1/NFAT2/NFAT transcription complex cytosolic component/NFATC/NF-ATC/NF-ATc1/nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 1/Nuclear Factor of Activated T Cells C1 |
| Human | EH1784 | Human MADCAM1(Mucosal addressin cell adhesion molecule 1) | MADCAM1 | 96T | MADCAM1/MACAM1/MAdCAM-1/mucosal addressin cell adhesion molecule 1/mucosal addressin cell adhesion molecule-1/mucosal vascular addressin cell adhesion molecule 1 |
| Human | EH1785 | Human PACRG(Parkin coregulated gene protein) | PACRG | 96T | PACRG/Parkin coregulated gene protein/Molecular chaperonin-binding protein/PARK2 coregulated gene protein |
| Human | EH1786 | Human CX3CR1(CX3C chemokine receptor 1) | CX3CR1 | 96T | CX3CR1/CMKbRL1/V28/Beta chemokine receptor-like 1/chemokine(C-C) receptor-like 1/CMKBRL1/CMK-BRL1/CMK-BRL-1/CMKDR1/CX3C chemokine receptor 1/Fractalkine receptor/G protein-coupled receptor 13/GPR13G-protein coupled receptor 13/GPRV28/V28C-X3-C CKR-1 |
| Human | EH1787 | Human NAIP(Baculoviral IAP repeat-containing protein 1) | NAIP | 96T | NAIP(Neuronal Apoptosis Inhibitory Protein)/BIRC1/NLRB1/baculoviral IAP repeat-containing 1/NLR family, apoptosis inhibitory protein/NLR family, BIR domain containing 1/nucleotide-binding oligomerization domain, leucine rich repeat and BIR domaincontaining 1/psi neuronal apoptosis inhibitory protein/psiNAIP |
| Human | EH1788 | Human CFL1(Cofilin-1) | CFL1 | 96T | CFL1(Cofilin 1, Non-Muscle)/Cofilin-1/18 kDa phosphoprotein/p18/Cofilin, non-muscle isoform |
| Human | EH1789 | Human POU2F2(POU domain, class 2, transcription factor 2) | POU2F2 | 96T | POU2F2/POU domain, class 2, transcription factor 2/Octamer Binding Transcription Factor 2/OCT2/OTF2/Oct-2/OTF-2/Lymphoid-restricted immunoglobulin octamer-binding protein NF-A2/Octamer-binding protein 2 |
| Human | EH1790 | Human RASD1(Dexamethasone-induced Ras-related protein 1) | RASD1 | 96T | RASD1/Dexamethasone-induced Ras-related protein 1/Activator of G-protein signaling 1 |
| Human | EH1791 | Human SCARB1(Scavenger receptor class B member 1) | SCARB1 | 96T | SCARB1/CD36L1/CLA1/HDLQTL6/SR-B1/CD36L1/CLA1 CD36 antigen-like 1/CLA-1/Collagen type I receptor, thrombospondin receptor-like 1/scavenger receptor class B type III/scavenger receptor class B, member 1/SRB1 scavenger receptor class B member 1/SRBI |
| Human | EH1792 | Human SRD5A1(3-oxo-5-alpha-steroid 4-dehydrogenase 1) | SRD5A1 | 96T | SRD5A1/3-oxo-5-alpha-steroid 4-dehydrogenase 1/SR type 1/Steroid 5-alpha-reductase 1/S5AR 1 |
| Human | EH1793 | Human ADAMTS20(A disintegrin and metalloproteinase with thrombospondin motifs 20) | ADAMTS20 | 96T | ADAMTS20/A disintegrin and metalloproteinase with thrombospondin motifs 20/ADAM-TS 20/ADAM-TS20/ADAMTS-20 |
| Human | EH1794 | Human POU5F1(POU domain, class 5, transcription factor 1) | POU5F1 | 96T | OCT4(Octamer Binding Transcription Factor 4)/POU5F1/POU domain, class 5, transcription factor 1/Octamer-binding transcription factor 3/OTF-3/Octamer-binding protein 3/Oct-3/Octamer-binding protein 4/Oct-4/OCT3/OTF3/OTF4 |
| Human | EH1796 | Human NLRC4(NLR family CARD domain-containing protein 4) | NLRC4 | 96T | NLRC4/NLR family CARD domain-containing protein 4/Ice protease-activating factor/Ipaf/CARD, LRR, and NACHT-containing protein/Clan protein/Caspase recruitment domain-containing protein 12 |
| Human | EH1797 | Human AQP12A(Aquaporin-12A) | AQP12A | 96T | AQP12A/AQP12/AQPX2/Aquaporin-12A/AQP-12 |
| Human | EH1798 | Human ZMAT3(Zinc finger matrin-type protein 3) | ZMAT3 | 96T | ZMAT3/Zinc finger matrin-type protein 3/Zinc finger protein WIG-1/p53-activated gene 608 protein |
| Human | EH1799 | Human CTH(Cystathionine gamma-lyase) | CTH | 96T | CTH/Cystathionine gamma-lyase/Gamma-cystathionase |
| Human | EH1800 | Human LIN28A(Protein lin-28 homolog A) | LIN28A | 96T | LIN28A/LIN-28A/CSDD1/LIN28/Tex17/ZCCHC1/CSDD1lin-28A/LIN-28/lin-28 homolog A/LIN28RNA-binding protein LIN-28/ZCCHC1protein lin-28 homolog A/Zinc finger CCHC domain-containing protein 1/zinc finger, CCHC domain containing 1 |
| Human | EH1801 | Human HSPA5(78 kDa glucose-regulated protein) | HSPA5 | 96T | GRP78(Glucose Regulated Protein 78)/HSPA5/BIP/GRP-78/HSP70-5/MIF2/78 kDa glucose-regulated protein/Endoplasmic reticulum lumenal Ca(2+)-binding protein grp78/Heat shock 70 kDa protein 5/heat shock 70kD protein 5(glucose-regulated protein, 78kD)/Immunoglobulin heavy chain-binding protein |
| Human | EH1802 | Human MRC1(Macrophage mannose receptor 1) | MRC1 | 96T | MRC1(Mannose Receptor C Type 1 )/CD206/CLEC13D/MMR/CD206 antigen/C-type lectin domain family 13 member D/mannose receptor, C type 1/Macrophage mannose receptor 1 |
| Human | EH1803 | Human ZFAND6(AN1-type zinc finger protein 6) | ZFAND6 | 96T | ZFAND6(AN1-type zinc finger protein 6)/HT032/AWP1/ZA20D3/Associated with PRK1 protein/Zinc finger A20 domain-containing protein 3 |
| Human | EH1804 | Human MACC1(Metastasis-associated in colon cancer protein 1) | MACC1 | 96T | MACC1(Metastasis-associated in colon cancer protein 1)/SH3 domain-containing protein 7a5 |
| Human | EH1805 | Human IDO1(Indoleamine 2,3-dioxygenase 1) | IDO1 | 96T | IDO1/IDO/INDO/IDO-1/Indoleamine-pyrrole 2,3-dioxygenase |
| Human | EH1806 | Human DNTT(DNA nucleotidylexotransferase) | DNTT | 96T | DNTT(DNA nucleotidylexotransferase)/TDT/Terminal addition enzyme/Terminal deoxynucleotidyltransferase/Terminal transferase |
| Human | EH1807 | Human DUT(Deoxyuridine 5'-triphosphate nucleotidohydrolase, mitochondrial) | DUT | 96T | DUT/dUTPase/dUTP pyrophosphatase |
| Human | EH1808 | Human RAG1(V(D)J recombination-activating protein 1) | RAG1 | 96T | RAG-1(Recombination Activating Gene 1)/RAG1/RNF74/RING finger protein 74/V(D)J recombination-activating protein 1 |
| Human | EH1809 | Human RAG2(V(D)J recombination-activating protein 2) | RAG2 | 96T | RAG-2(Recombination Activating Gene 2)/RAG2 |
| Human | EH1810 | Human RPTOR(Regulatory-associated protein of mTOR) | RPTOR | 96T | RPTOR(Regulatory-associated protein of mTOR)/KIAA1303/Raptor/RAPTOR/p150 target of rapamycin(TOR)-scaffold protein containing WD-repeats/KOG1/Mip1/p150 target of rapamycin(TOR)-scaffold protein/regulatory associated protein of MTOR, complex 1 |
| Human | EH1811 | Human NARG2(NMDA receptor-regulated protein 2) | NARG2 | 96T | NARG2(NMDA receptor-regulated protein 2)/BRCC1 |
| Human | EH1812 | Human NMES1(Normal mucosa of esophagus-specific gene 1 protein) | NMES1 | 96T | NMES1(Normal mucosa of esophagus-specific gene 1 protein)/Protein FOAP-11 |
| Human | EH1813 | Human IZUMO1(Izumo sperm-egg fusion protein 1) | IZUMO1 | 96T | IZUMO1(Izumo sperm-egg fusion protein 1)/OBF/Oocyte binding/fusion factor/Sperm-specific protein izumo |
| Human | EH1814 | Human CYP21A2(Steroid 21-hydroxylase) | CYP21A2 | 96T | CYP21A2/CYP21/CYP21B/CAH1/CPS1/CA21H/P450c21B/Cytochrome P450-C21B/Cytochrome P450-C21/Cytochrome P450 XXI/Cytochrome P450 21/21-OHase/Cytochrome P-450c21 |
| Human | EH1815 | Human WNT5B(Protein Wnt-5b) | WNT5B | 96T | WNT5B(Protein Wnt-5b) |
| Human | EH1816 | Human NOTUM(Protein notum homolog) | NOTUM | 96T | NOTUM(Protein notum homolog) |
| Human | EH1817 | Human HLA-E(HLA class I histocompatibility antigen, alpha chain E) | HLA-E | 96T | MHCE/HLA-E(Major Histocompatibility Complex Class I E)/HLA-6.2/HLAE/MHC class I antigen E/HLA class I histocompatibility antigen, alpha chain E |
| Human | EH1818 | Human PIBF(Progesterone-induced-blocking factor) | PIBF | 96T | PIBF1(Progesterone-induced-blocking factor 1)/C13orf24/chromosome 13 open reading frame 24/KIAA1008/PIBF/progesterone immunomodulatory binding factor 1/progesterone-induced blocking factor 1/RP11-505F3.1 |
| Human | EH1819 | Human RPRM(Protein reprimo) | RPRM | 96T | RPRM(Protein reprimo) |
| Human | EH1820 | Human KLHL17(Kelch-like protein 17) | KLHL17 | 96T | KLHL17(Kelch-like protein 17)/Actinfilin |
| Human | EH1821 | Human ARHGAP21(Rho GTPase-activating protein 21) | ARHGAP21 | 96T | ARHGAP21/Rho GTPase-activating protein 21/Rho GTPase-activating protein 10/Rho-type GTPase-activating protein 21 |
| Human | EH1822 | Human ITGAL(Integrin alpha-L) | ITGAL | 96T | ITGAL/Integrin alpha-L/Leukocyte function-associated molecule 1 alpha chain/CD11 antigen-like family member A/Leukocyte adhesion glycoprotein LFA-1 alpha chain/LFA-1A/CD11A/LFA-1/LFA1A |
| Human | EH1823 | Human ACTα2 (Actin Alpha 2, Smooth Muscle) | ACTα2 | 96T | ACTα2/Actin Alpha 2, Smooth Muscle/ACTA2/AAT6/ACTSA/MYMY5 |
| Human | EH1828 | Human FNDC5(Fibronectin type III domain-containing protein 5) | FNDC5 | 96T | FNDC5/Fibronectin type III domain-containing protein 5/Fibronectin type III repeat-containing protein 2/Irisin/FRCP2 |
| Human | EH1829 | Human GBA3(Cytosolic beta-glucosidase) | GBA3 | 96T | GBA3/Cytosolic beta-glucosidase/Cytosolic beta-glucosidase-like protein 1/CBG/CBGL1/CBGL1/GLUC/KLrP/klotho-related protein/glucosidase, beta, acid 3(cytosolic) |
| Human | EH1830 | Human CFC1(Cryptic protein) | CFC1 | 96T | CFC1/Cryptic protein/Cryptic family protein 1/CRYPTIC/HTX2/cripto, FRL-1,cryptic family 1/CFC1B |
| Human | EH1831 | Human GREM2(Gremlin-2) | GREM2 | 96T | GREM2/Gremlin-2/Protein related to DAN and cerberus/Cysteine knot superfamily 1, BMP antagonist 2/DAN domain family member 3/CKTSF1B2/DAND3/PRDC/Protein related to DAN and cerberus/gremlin 2, cysteine knot superfamily, homolog |
| Human | EH1832 | Human ANKRD30A(Ankyrin repeat domain-containing protein 30A) | ANKRD30A | 96T | ANKRD30A/Ankyrin repeat domain-containing protein 30A/Serologically defined breast cancer antigen NY-BR-1 |
| Human | EH1833 | Human LCE3D(Late cornified envelope protein 3D) | LCE3D | 96T | LCE3D/Late cornified envelope protein 3D/Small proline-rich-like epidermal differentiation complex protein 6B/Late envelope protein 16/Small proline-rich-like epidermal differentiation complex protein 6A |
| Human | EH1834 | Human ADAM33(Disintegrin and metalloproteinase domain-containing protein 33) | ADAM33 | 96T | ADAM33/Disintegrin and metalloproteinase domain-containing protein 33/ADAM 33/ADAM metallopeptidase domain 33/C20orf153/chromosome 20 open reading frame 153/disintegrin and metalloproteinase domain-containing protein 33/disintegrin and reprolysin metalloproteinase family protein |
| Human | EH1835 | Human OR51E2(Olfactory receptor 51E2) | OR51E2 | 96T | OR51E2/Olfactory receptor 51E2/Prostate-specific G-protein coupled receptor/HPRAJ/Olfactory receptor OR11-16/PSGR |
| Human | EH1836 | Human CLEC4E(C-type lectin domain family 4 member E) | CLEC4E | 96T | CLEC4E/C-type lectin domain family 4 member E/C-type lectin superfamily member 9/Macrophage-inducible C-type lectin/MINCLE/CLECSF9 |
| Human | EH1837 | Human LY6G6F(Lymphocyte antigen 6 complex locus protein G6f) | LY6G6F | 96T | LY6G6F/Lymphocyte antigen 6 complex locus protein G6f/C6orf21/G6F/LY6G6D/NG32 |
| Human | EH1838 | Human FCGBP(IgGFc-binding protein) | FCGBP | 96T | FCGBP/IgGFc-binding protein/Fcgamma-binding protein antigen/FcgammaBP |
| Human | EH1839 | Human PYY2(Putative peptide YY-2) | PYY2 | 96T | PYY2/Putative peptide YY-2/Putative peptide YY2 |
| Human | EH1840 | Human NDUFS8(NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial) | NDUFS8 | 96T | NDUFS8/NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial/TYKY subunit/Complex I-23kD/CI-23kD/NADH-ubiquinone oxidoreductase 23 kDa subunit/TYKY/CI-23k/CI23KD |
| Human | EH1842 | Human NDUFS7(NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial) | NDUFS7 | 96T | NDUFS7/NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial/PSST subunit/Complex I-20kD/CI-20kD/NADH-ubiquinone oxidoreductase 20 kDa subunit/PSST/CI-20/MY017 |
| Human | EH1843 | Human CXCL14(C-X-C motif chemokine 14) | CXCL14 | 96T | CXCL14/C-X-C motif chemokine 14/Small-inducible cytokine B14/Chemokine BRAK/MIP-2G/UNQ240/PRO273/PSEC0212/MIP2G/NJAC/SCYB14 |
| Human | EH1844 | Human NR3C1(Glucocorticoid receptor) | NR3C1 | 96T | NR3C1/Glucocorticoid receptor/GR/Nuclear receptor subfamily 3 group C member 1/GRL/GCR/GCCR |
| Human | EH1845 | Human PTMA(Prothymosin alpha) | PTMA | 96T | PTMA/Prothymosin alpha/TMSA |
| Human | EH1846 | Human DSCR6(Protein ripply3) | DSCR6 | 96T | DSCR6/Protein ripply3/Down syndrome critical region protein 6/RIPPLY3 |
| Human | EH1847 | Human CYP2C9(Cytochrome P450 2C9) | CYP2C9 | 96T | CYP2C9/Cytochrome P450 2C9/Cytochrome P450 MP-4/Cytochrome P-450MP/CYPIIC9/(S)-limonene 7-monooxygenase/S-mephenytoin 4-hydroxylase/Cytochrome P450 PB-1/Cytochrome P450 MP-8/(R)-limonene 6-monooxygenase/(S)-limonene 6-monooxygenase/CYP2C10/CPC9/CYP2C |
| Human | EH1848 | Human GOT2(Aspartate aminotransferase, mitochondrial) | GOT2 | 96T | GOT2/Aspartate aminotransferase, mitochondrial/mAspAT/Kynurenine--oxoglutarate transaminase IV/Kynurenine--oxoglutarate transaminase 4/Transaminase A/Plasma membrane-associated fatty acid-binding protein/FABPpm/Transaminase A/Plasma membrane-associated fatty acid-binding protein/FABPpm/Fatty acid-binding protein/FABP-1/Glutamate oxaloacetate transaminase 2/KAT4/KATIV/mitAAT |
| Human | EH1849 | Human OSGIN2(Oxidative stress-induced growth inhibitor 2) | OSGIN2 | 96T | OSGIN2/Oxidative stress-induced growth inhibitor 2/hT41/C8orf1 |
| Human | EH1850 | Human PCDH1(Protocadherin-1) | PCDH1 | 96T | PCDH1/Protocadherin-1/Cadherin-like protein 1/Protocadherin-42/PC42/PCDH42/protocadherin 42/Protocadherin-42/cadherin-like 1 |
| Human | EH1851 | Human DEXI(Dexamethasone-induced protein) | DEXI | 96T | DEXI/MYLE(Dexamethasone-induced protein)/Protein MYLE |
| Human | EH1852 | Human MEP1B(Meprin A subunit beta) | MEP1B | 96T | MEP1B(Meprin A subunit beta)/Endopeptidase-2/PABA peptide hydrolase/PPH beta/Meprin beta Subunit/meprin A, beta/Meprin B/N-benzoyl-L-tyrosyl-p-amino-benzoic acid hydrolase beta subunit/N-benzoyl-L-tyrosyl-P-amino-benzoic acid hydrolase subunit beta |
| Human | EH1853 | Human CTSA(Lysosomal protective protein) | CTSA | 96T | CTSA(Lysosomal protective protein)/GLB2/PPCA/GSL/NGBE/PPGB/Lysosomal Carboxypeptidase A/beta-galactosidase 2/beta-galactosidase protective protein/Carboxypeptidase C/Carboxypeptidase L/cathepsin A/protective protein for beta-galactosidase(galactosialidosis)/Protective protein cathepsin A/Protective protein for beta-galactosidase |
| Human | EH1854 | Human SFTPB(Pulmonary surfactant-associated protein B) | SFTPB | 96T | SPB(Pulmonary Surfactant Associated Protein B)/SFTPB/SP-B/SFTP3/Pulmonary surfactant-associated proteolipid SPL(Phe)/18 kDa pulmonary-surfactant protein/6 kDa protein |
| Human | EH1855 | Human SFTPC(Pulmonary surfactant-associated protein C) | SFTPC | 96T | SPC(Pulmonary Surfactant Associated Protein C)/SFTPC/SFTP2/SP-C/SP5/Pulmonary surfactant-associated proteolipid SPL(Val) |
| Human | EH1856 | Human PLA2G4A(Cytosolic phospholipase A2) | PLA2G4A | 96T | cPLA2/PLA2G4A(Cytosolic phospholipase A2)/cPLA2-alpha/calcium-dependent phospholipid-binding protein/lysophospholipase/phosphatidylcholine 2-acylhydrolase/Phospholipase A2 group IVA/phospholipase A2, group IVA(cytosolic, calcium-dependent) |
| Human | EH1857 | Human PRAP1(Proline-rich acidic protein 1) | PRAP1 | 96T | PRAP1(Proline-rich acidic protein 1)/Uterine-specific proline-rich acidic protein/Uterine-specific proline-rich acidic protein |
| Human | EH1858 | Human SDCCAG3(Serologically defined colon cancer antigen 3) | SDCCAG3 | 96T | SDCCAG3(Serologically defined colon cancer antigen 3)/Antigen NY-CO-3 |
| Human | EH1859 | Human LTBP2(Latent-transforming growth factor beta-binding protein 2) | LTBP2 | 96T | LTBP2/LTBP-2/C14orf141/GLC3D/latent transforming growth factor beta binding protein 2/LTBP3/chromosome 14 open reading frame 141/Latent TGF-beta bp2 |
| Human | EH1860 | Human SLC40A1(Solute carrier family 40 member 1) | SLC40A1 | 96T | SLC40A1(Solute carrier family 40 member 1)/FPN1/HFE4/MTP1/IREG1/MST079/MSTP079/SLC11A3/Ferroportin-1/Iron-regulated transporter 1 |
| Human | EH1862 | Human SLC2A3(Solute carrier family 2, facilitated glucose transporter member 3) | SLC2A3 | 96T | SLC2A3/GLUT-3/GLUT3/Glucose transporter type 3, brain/solute carrier family 2(facilitated glucose transporter), member 3 |
| Human | EH1864 | Human NEBL(Nebulette) | NEBL | 96T | NEBL(Nebulette)/LNEBL/Actin-binding Z-disk protein |
| Human | EH1865 | Human ETFβ(Electron transfer flavoprotein subunit beta) | ETFβ | 96T | ETFβ(Electron transfer flavoprotein subunit beta)/FP585/Beta-ETF |
| Human | EH1866 | Human CLCF1(Cardiotrophin-like cytokine factor 1) | CLCF1 | 96T | CLCF1/BSF-3/BSF3/CISS2/CLC/NNT-1/NNT1/NR6/B-cell stimulating factor 3/CRLF1 associated cytokine-like factor 1/neurotrophin-1/B-cell stimulating factor-3/novel neurotroph/cardiotrophin-like cytokine factor 1/Novel neurotrophin-1 |
| Human | EH1867 | Human CCR7(C-C chemokine receptor type 7) | CCR7 | 96T | CCR7/CD197/BLR2/C-C chemokine receptor type 7/C-C CKR-7/CC-CKR-7/CCR-7/CD197/CD197 antigen/CDw197/CC chemokine receptor 7/chemokine(C-C motif) receptor 7/CMKBR7/chemokine(C-C) receptor 7/EBI1/EBV-induced G protein-coupled receptor 1/EBV-induced G-protein coupled receptor 1/Epstein-Barr virus induced gene 1/Epstein-Barr virus induced G-protein coupled receptor/Epstein-Barr virus-induced G-protein coupled receptor 1/EVI1/lymphocyte-specific G protein-coupled peptide receptor/MIP-3 beta receptor |
| Human | EH1868 | Human DEFA1(Defensin Alpha 1, Neutrophil) | DEFA1 | 96T | DEFA1/DEF1/HNP-1/HP1/MRS/alpha 2/DEFA1B/DEFA2/defensin, alpha 1, myeloid-related sequence/defensin, alpha 1/HP-1/myeloid-related sequence/neutrophil defensin 1/alpha-Defensin 1 |
| Human | EH1869 | Human SFRP4(Secreted frizzled-related protein 4) | SFRP4 | 96T | SFRP4(Secreted frizzled-related protein 4)/DDC-4/sFRP-4/FRP-4/FRP-AP/frpHE/FrzB2/Frizzled protein, human endometrium/secreted frizzled-related protein 4/secreted frizzled-related protein 4 |
| Human | EH1870 | Human MSTN(Growth/differentiation factor 8) | MSTN | 96T | MSTN(Myostatin)/GDF-8/GDF8/growth differentiation factor 8/growth,differentiation factor 8 |
| Human | EH1871 | Human SLC25A20(Mitochondrial carnitine/acylcarnitine carrier protein) | SLC25A20 | 96T | SLC25A20(Mitochondrial carnitine/acylcarnitine carrier protein)/CAC/CACT/Carnitine,acylcarnitine translocase/Solute carrier family 25 member 20 |
| Human | EH1872 | Human AGTR1(Type-1 angiotensin II receptor) | AGTR1 | 96T | ANG II R1/AGTR1(Angiotensin II Receptor 1)/AT1R/AG2S/AG2-S/AGTR1A/AGTR1B/AT1/AT1B/AT2R1/AT2-R1/AT2R1A/AT2R1B/HAT1R/Angiotensin II receptor, type |
| Human | EH1873 | Human CS(Citrate synthase, mitochondrial) | CS | 96T | CS(Chondroitin Sulfate)/NG2/MCSP/MCSPG/MSK16/HMW-MAA/MEL-CSPG |
| Human | EH1874 | Human PLK1(Serine/threonine-protein kinase PLK1) | PLK1 | 96T | PLK1/Serine/threonine-protein kinase PLK1/Polo-like kinase 1/PLK-1/Serine/threonine-protein kinase 13/STPK13/PLK/cell cycle regulated protein kinase |
| Human | EH1875 | Human MMP16(Matrix metalloproteinase-16) | MMP16 | 96T | MMP16/Matrix metalloproteinase-16/MMP-16/Membrane-type-3 matrix metalloproteinase/MT3-MMP/MT3MMP/MMP-X2/Membrane-type matrix metalloproteinase 3/MT-MMP 3/MTMMP3/MMPX2/MT-MMP2 |
| Human | EH1876 | Human CTXIII(C-terminal telopeptide of Collagen alpha-1(III) chain) | CTXIII | 96T | CTXIII(C-terminal telopeptide of Collagen alpha-1(III) chain) |
| Human | EH1877 | Human TTN(Titin) | TTN | 96T | TTN/Titin/Connectin/Rhabdomyosarcoma antigen MU-RMS-40.14/CMD1G/CMH9/CMPD4/EOMFC/HMERF/LGMD2J/MYLK5/TMD |
| Human | EH1878 | Human GOLM1(Golgi membrane protein 1) | GOLM1 | 96T | GOLM1/Golgi membrane protein 1/Golgi membrane protein GP73/Golgi phosphoprotein 2/GOLPH2 |
| Human | EH1879 | Human TNNT3(Troponin T, fast skeletal muscle) | TNNT3 | 96T | TNNT3/Troponin T, fast skeletal muscle/TnTf/Beta-TnTF/Fast skeletal muscle troponin T/fTnT |
| Human | EH1880 | Human MCAM(Cell surface glycoprotein MUC18) | MCAM | 96T | MCAM/Melanoma Cell Adhesion Molecule/S-endo 1 endothelial-associated antigen/Melanoma-associated antigen MUC18/Melanoma-associated antigen A32/Cell surface glycoprotein P1H12/Melanoma cell adhesion molecule/MUC18 |
| Human | EH1881 | Human PRKAB1(5'-AMP-activated protein kinase subunit beta-1) | PRKAB1 | 96T | PRKAB1/5'-AMP-activated protein kinase subunit beta-1/AMPK subunit beta-1/AMPKb/AMP |
| Human | EH1882 | Human GNRHR(Gonadotropin-releasing hormone receptor) | GNRHR | 96T | GNRHR/Gonadotropin-releasing hormone receptor/GnRH receptor/GnRH-R/GRHR/LHRHR/LRHR/GNRHR1/GRHR |
| Human | EH1883 | Human CSNK2B(Casein kinase II subunit beta) | CSNK2B | 96T | CSNK2B/Casein kinase II subunit beta/CK II beta/Phosvitin/Protein G5a/CK2N/G5A/CK2B/CSK2B/casein kinase 2, beta polypeptide/CK II beta/Protein G5a |
| Human | EH1884 | Human SOCS3(Suppressor of cytokine signaling 3) | SOCS3 | 96T | SOCS3/Suppressors of Cytokine Signaling 3/Suppressor of cytokine signaling 3/SOCS-3/Cytokine-inducible SH2 protein 3/CIS-3/STAT-induced STAT inhibitor 3/SSI-3/CIS3/SSI3/ATOD4/CIS3/Cish3 |
| Human | EH1885 | Human ITGAM(Integrin alpha-M) | ITGAM | 96T | ITGAM/Integrin alpha-M/Neutrophil adherence receptor/Leukocyte adhesion receptor MO1/Cell surface glycoprotein MAC-1 subunit alpha/CD11 antigen-like family member B/CR-3 alpha chain/CD11B/CR3A/MO1A/CD11B/MAC-1/MAC1A/SLEB6 |
| Human | EH1886 | Human IL-21(Interleukin-21) | IL-21 | 96T | IL-21/Interleukin-21/Za11/IL21 |
| Human | EH1888 | Human IL26(Interleukin-26) | IL26 | 96T | IL26/Interleukin-26/IL-26/Protein AK155/AK155/interleukin 26 |
| Human | EH1889 | Human LDHD(Probable D-lactate dehydrogenase, mitochondrial) | LDHD | 96T | LDHD/Probable D-lactate dehydrogenase, mitochondrial/DLD/Lactate dehydrogenase D |
| Human | EH1890 | Human CPA3(Mast cell carboxypeptidase A) | CPA3 | 96T | CPA3/Mast cell carboxypeptidase A/MC-CPA/Carboxypeptidase A3 |
| Human | EH1891 | Human LCN12(Epididymal-specific lipocalin-12) | LCN12 | 96T | LCN12/Epididymal-specific lipocalin-12 |
| Human | EH1892 | Human GP1BA(Platelet glycoprotein Ib alpha chain) | GP1BA | 96T | GP1BA/Platelet glycoprotein Ib alpha chain/GP-Ib alpha/GPIb-alpha/GPIbA/Glycoprotein Ibalpha/Antigen CD42b-alpha/BSS/CD42B/CD42b-alpha/GP1B |
| Human | EH1893 | Human PVRL1(Poliovirus receptor-related protein 1) | PVRL1 | 96T | PVRL1/Poliovirus receptor-related protein 1/Nectin-1/Herpes virus entry mediator C/Herpesvirus entry mediator C/HveC/Herpesvirus Ig-like receptor/HIgR/HVEC/PRR1/CD111/PVRR1/SK-12 |
| Human | EH1894 | Human PDXP(Pyridoxal phosphate phosphatase) | PDXP | 96T | PDXP/Pyridoxal phosphate phosphatase/PLP phosphatase/Chronophin/CIN/PLP/PLPP |
| Human | EH1895 | Human OAS3(2'-5'-oligoadenylate synthase 3) | OAS3 | 96T | OAS3/2'-5'-oligoadenylate synthase 3/(2-5')oligo(A) synthase 3/2-5A synthase 3/p100 OAS/p100OAS/P/OKcl.4 |
| Human | EH1896 | Human RAB11A(Ras-related protein Rab-11A) | RAB11A | 96T | RAB11A/Ras-related protein Rab-11A/Rab-11/YL8/RAB11 |
| Human | EH1897 | Human DEFA5(Defensin Alpha 5, Paneth Cell Specific) | DEFA5 | 96T | DEFA5/Defensin-5/Defensin, alpha 5/HD5(20-94)/DEF5/HD-5 |
| Human | EH1899 | Human PDXK(Pyridoxal kinase) | PDXK | 96T | PDXK/Pyridoxal kinase/Pyridoxine kinase/PRED79/C21orf124/C21orf97/PKH/PNK/Vitamin B6 Kinase/HEL-S-1a |
| Human | EH1900 | Human POMGNT1(Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1) | POMGNT1 | 96T | POMGNT1/Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1/POMGnT1/UDP-GlcNAc:alpha-D-mannoside beta-1,2-N-acetylglucosaminyltransferase I.2/GnT I.2/MDDGA3/MDDGB3/MDDGC3/MEB/MGAT1.2 |
| Human | EH1901 | Human GDF2(Growth/differentiation factor 2) | GDF2 | 96T | GDF2(Growth Differentiation Factor 2)/GDF-2/BMP9/BMP-9/Bone morphogenetic protein 9/growth differentiation factor 2 |
| Human | EH1902 | Human OIT3(Oncoprotein-induced transcript 3 protein) | OIT3 | 96T | OIT3(Oncoprotein Induced Transcript 3)/LZP/Liver-specific zona pellucida domain-containing protein |
| Human | EH1903 | Human CTSG(Cathepsin G) | CTSG | 96T | CTSG(Cathepsin G)/CG/CATG |
| Human | EH1904 | Human ANXA4(Annexin A4) | ANXA4 | 96T | ANXA4(Annexin A4)/AIV/Annexin IV/ANX4/Lipocortin IV/PIG28/ZAP36/annexin IV(placental anticoagulant protein II)/Annexin-4/Carbohydrate-binding protein p33,p41/Chromobindin-4/chromobindin-4,35-beta calcimedin/Endonexin I/P32.5/PAP-II/Placental anticoagulant protein II/PP4-X/proliferation-inducing gene 28/proliferation-inducing protein 28/Protein II |
| Human | EH1905 | Human RELB(Transcription factor RelB) | RELB | 96T | RELB(V-Rel Reticuloendotheliosis Viral oncogene Homolog B)/IREL/I-Rel/nuclear factor of kappalight polypeptide gene enhancer in B-cells 3/v-rel reticuloendotheliosis viral oncogene homolog B/Transcription factor RelB |
| Human | EH1906 | Human PA2G4(Proliferation-associated protein 2G4) | PA2G4 | 96T | PA2G4(Proliferation Associated Protein 2G4)/EBP1/HG4-1/Cell cycle protein p38-2G4 homolog/ErbB-3 binding protein 1/ErbB3-binding protein 1/ErbB3-binding protein Ebp1/p38-2G4/proliferation-associated 2G4, 38kD/proliferation-associated protein 2G4 |
| Human | EH1908 | Human UCHL1(Ubiquitin carboxyl-terminal hydrolase isozyme L1) | UCHL1 | 96T | UCHL1/PARK5/PGP9.5/Neuron cytoplasmic protein 9.5/PGP95/ubiquitin carboxyl-terminal esterase L1(ubiquitin thiolesterase)/ubiquitin C-terminal hydrolase/Ubiquitin thioesterase L1/UCH-L1 |
| Human | EH1909 | Human UGCG(Ceramide glucosyltransferase) | UGCG | 96T | UGCG(Ceramide glucosyltransferase)/GCS/UDP-glucose:N-acylsphingosine D-glucosyltransferase/UDP-glucose ceramide glucosyltransferase/GLCT-1/Glucosylceramide synthase |
| Human | EH1910 | Human HK3(Hexokinase-3) | HK3 | 96T | HK3(Hexokinase-3)/HK III/Hexokinase type III |
| Human | EH1911 | Human PRDX6(Peroxiredoxin-6) | PRDX6 | 96T | PRDX6/aiPLA2/AOP2/NSGPx/1-Cys/24 kDa protein/Acidic calcium-independent phospholipase A2/aiPLA21-Cys PRX/Antioxidant protein 2/Non-selenium glutathione peroxidase/Red blood cells page spot 12/Liver 2D page spot 40/NSGPx1-Cys peroxiredoxin/p29/peroxiredoxin 6/PRX |
| Human | EH1912 | Human GSTA3(Glutathione S-transferase A3) | GSTA3 | 96T | GSTA3(Glutathione S-transferase A3)/GST class-alpha member 3/Glutathione S-transferase A3-3 |
| Human | EH1913 | Human TPI1(Triosephosphate isomerase) | TPI1 | 96T | TIM(Triosephosphate isomerase)/TPI1/TPI/Triose-phosphate isomerase |
| Human | EH1915 | Human FSCN1(Fascin) | FSCN1 | 96T | Fascin/FSCN1/FAN1/HSN/Singed-like Protein/SNL/FAN1,55 kDa actin-bundling protein/fascin homolog 1, actin-bundling protein(Strongylocentrotus purpuratus)/p55/actin bundling protein/singed(Drosophila)-like(sea urchin fascin homolog like)/singed-like(fascin homolog, sea urchin)/Singed-like protein |
| Human | EH1916 | Human RNASE3/ECP(Ribonuclease A3/Eosinophil Cationic Protein) | RNASE3/ECP | 96T | RNASE3/ECP(Ribonuclease A3/Eosinophil Cationic Protein) |
| Human | EH1917 | Human HMGCS1(Hydroxymethylglutaryl-CoA synthase, cytoplasmic) | HMGCS1 | 96T | HMGCS1(Hydroxymethylglutaryl-CoA synthase, cytoplasmic)/HMG-CoA synthase/HMGCS/3-hydroxy-3-methylglutaryl coenzyme A synthase |
| Human | EH1919 | Human OSMR(Oncostatin-M-specific receptor subunit beta) | OSMR | 96T | OSMR(Oncostatin M Receptor)/OSMRB/IL-31 receptor subunit beta/IL-31R subunit beta/IL-31R-beta/IL-31RB/Interleukin-31 receptor subunit beta/oncostatin-M-specific receptor subunit beta |
| Human | EH1920 | Human INHBB(Inhibin beta B chain) | INHBB | 96T | INHBB/Inhibin beta B chain/Activin beta-B chain/Inhibin, Beta B/Inhibin, Beta-2/inhibin, beta B |
| Human | EH1921 | Human TPT1(Translationally-controlled tumor protein) | TPT1 | 96T | TPT1/Translationally-controlled Tumor Protein 1/TCTP/Fortilin/HRF/Histamine-releasing factor/p23/translationally-controlled tumor protein/tumor protein, translationally-controlled 1 |
| Human | EH1922 | Human MCM2(DNA replication licensing factor MCM2) | MCM2 | 96T | MCM2/DNA replication licensing factor MCM2/BM28/CCNL1/cdc19/CDCL1/Mitotin/CCNL 1/CDCL1mitotin/MCM2 minichromosome maintenance deficient 2, mitotin/minichromosome maintenance complex component 2/minichromosome maintenance deficient(S. cerevisiae) 2(mitotin)/minichromosome maintenance deficient 2(mitotin) |
| Human | EH1923 | Human S100A6(Protein S100-A6) | S100A6 | 96T | S100A6/S100 Calcium Binding Protein A6/CACY/MLN 4/PRA/2A9/CABP/CACY5B10/Calcyclin/Growth factor-inducible protein 2A9/PRAS100 calcium binding protein A6/Prolactin receptor-associated protein/protein S100-A6/S100 calcium-binding protein A6 |
| Human | EH1924 | Human MNDA(Myeloid cell nuclear differentiation antigen) | MNDA | 96T | MNDA/Myeloid cell nuclear differentiation antigen |
| Human | EH1925 | Human MXD1(Max dimerization protein 1) | MXD1 | 96T | MXD1/Max dimerization protein 1/Max dimerizer 1/Protein MAD/BHLHC58/MAD |
| Human | EH1926 | Human SPN(Leukosialin) | SPN | 96T | SPN/CD43/Leukosialin/GPL115/LSN/Ly-48/Sialophorin/CD43 antigen/Galactoglycoprotein/GALGP/Leukocyte sialoglycoprotein |
| Human | EH1927 | Human Opi(Opiorphin) | Opi | 96T | Opi/Opiorphin |
| Human | EH1928 | Human ORM2(Alpha-1-acid glycoprotein 2) | ORM2 | 96T | ORM2(Orosomucoid 2)/Alpha-1-acid glycoprotein 2/AGP 2/Orosomucoid-2/OMD 2 |
| Human | EH1929 | Human PLSCR1(Phospholipid scramblase 1) | PLSCR1 | 96T | PLSCR1(Phospholipid Scramblase 1)/MMTRA1B/Erythrocyte phospholipid scramblase/MmTRA1b/MMTRA1BCa(2+)-dependent phospholipid scramblase 1/PL scramblase 1 |
| Human | EH1930 | Human TMSB4X(Thymosin beta-4) | TMSB4X | 96T | TMSB4X/Thymosin beta 4/TB4X/THYB4/TMSB4/FX/PTMB4/T beta-4/TB4Xbeta 4, X chromosome/thymosin beta 4, X-linked/thymosin beta-4 |
| Human | EH1932 | Human GLT25D1(Procollagen galactosyltransferase 1) | GLT25D1 | 96T | GLT25D1/Procollagen galactosyltransferase 1/Hydroxylysine galactosyltransferase 1/Glycosyltransferase 25 family member 1 |
| Human | EH1933 | Human S100A8(Protein S100-A8) | S100A8 | 96T | S100A8(S100 Calcium Binding Protein A8)/Calgranulin A/CFAG/MRP8/CAGACP-10/Calgranulin-A/Calprotectin L1L subunit/CFAGL1Ag/CGLA/Cystic fibrosis antigen/Leukocyte L1 complex light chain/Migration inhibitory factor-related protein 8/MRP-8/NIF/P8/protein S100-A8/S100 calcium binding protein A8/Urinary stone protein band A |
| Human | EH1934 | Human S100A9(Protein S100-A9) | S100A9 | 96T | S100A9(S100 Calcium Binding Protein A9)/Calgranulin B/MRP-14/CAGBMigration inhibitory factor-related protein 14/Calgranulin-B/Calprotectin L1H subunit/CGLB/L1AG/LIAG/MRP14Leukocyte L1 complex heavy chain/NIF/P14/protein S100-A9 |
| Human | EH1935 | Human 11-DH-TXB2 (11-Dehydro-thromboxane B2) | 11-DH-TXB2 | 96T | 11-DH-TXB2(11-Dehydro-thromboxane B2)/11-dehydro-TXB2 |
| Human | EH1936 | Human CA1(Carbonic anhydrase 1) | CA1 | 96T | CA1(Carbonic Anhydrase I)/CA-I/Car1/Carbonate dehydratase I/Carbonic anhydrase B/carbonic anhydrase ICAB/carbonic dehydratase |
| Human | EH1937 | Human NMS(Neuromedin-S) | NMS | 96T | NMS/Neuromedin-S |
| Human | EH1938 | Human IL32(Interleukin-32) | IL32 | 96T | IL-32(Interleukin 32)/NK4/TAIF/IL-32/IL-32alpha/IL-32beta/interleukin-32/interleukin-32 theta/natural killer cell transcript 4/Natural killer cells protein 4/NK4IL-32delta/TAIFa/TAIFb/TAIFc/TAIFd/TAIFIL-32gamma/Tumor necrosis factor alpha-inducing factor |
| Human | EH1939 | Human NMU(Neuromedin-U) | NMU | 96T | NMU/Neuromedin-U |
| Human | EH1940 | Human ADAMTS4(A disintegrin and metalloproteinase with thrombospondin motifs 4) | ADAMTS4 | 96T | ADAMTS4/ADAMTS2/ADMP-1/ADAM-TS 4/ADAMTS-2/ADAM-TS4/ADAMTS-4/Aggrecanase 1/a disintegrin-like and metalloprotease(reprolysin type) with thrombospondintype 1 motif, 4/ADAM metallopeptidase with thrombospondin type 1 motif, 4/A disintegrin and metalloproteinase with thrombospondin motifs 4 |
| Human | EH1941 | Human KSR2(Kinase suppressor of Ras 2) | KSR2 | 96T | KSR2/hKSR2(Kinase suppressor of Ras 2) |
| Human | EH1942 | Human MUC7(Mucin-7) | MUC7 | 96T | MUC7/MG2/MUC-7/Apo-MG2/Salivary mucin-7 |
| Human | EH1943 | Human SEPP1(Selenoprotein P) | SEPP1 | 96T | SEPP1(Selenoprotein P)/SELP/SeP |
| Human | EH1944 | Human GC(Glucagon) | GC | 96T | GCG(Glucagon)/GLP1/GLP2/GRPP/glicentin-related polypeptide/glucagon-like peptide 1/glucagon-like peptide 2 |
| Human | EH1945 | Human BACE2(Beta-secretase 2) | BACE2 | 96T | BACE2(β-site APP Cleaving Enzyme 2)/AEPLC/Asp 1/ASP1/ASP21/Aspartic-like protease 56 kDa/Aspartyl protease 1/beta secretase 2/beta-secretase 2/beta-site amyloid beta A4 precursor protein-cleaving enzyme 2/Beta-site amyloid precursor protein cleaving enzyme 2/Beta-site APP cleaving enzyme 2/beta-site APP-cleaving enzyme 2/beta-site APP-cleaving enzyme 2, EC 3.4.2310ALP5656 kDa aspartic-like protease/CEAP1/Down region aspartic protease/Down syndrome region aspartic protease/DRAPBAE2/EC 3.4.23/EC 3.4.23.45/memapsin-1/Memapsin-1/Membrane-associated aspartic protease 1/theta-secretase/Theta-secretase/transmembrane aspartic proteinase Asp1 |
| Human | EH1946 | Human VCAN(Versican core protein) | VCAN | 96T | VCAN(Versican core protein)/CSPG2/GHAP/PG-M/Chondroitin sulfate proteoglycan 2/WGN/Chondroitin sulfate proteoglycan core protein 2/ERVR/Glial hyaluronate-binding protein/Large fibroblast proteoglycan/WGN1/versican/versican proteoglycan |
| Human | EH1947 | Human TNNT1(Troponin T, slow skeletal muscle) | TNNT1 | 96T | TNNT1(Troponin T Type 1, Slow Skeletal)/TNT/TnTs/sTnT/Slow skeletal muscle troponin T/Troponin T, slow skeletal muscle |
| Human | EH1948 | Human KRT17(Keratin, type I cytoskeletal 17) | KRT17 | 96T | CK-17/KRT17(Cytokeratin 17)/K17/Keratin-17/39.1/Cytokeratin-17/Keratin, type I cytoskeletal 17 |
| Human | EH1950 | Human NFKB1(Nuclear factor NF-kappa-B p105 subunit) | NFKB1 | 96T | NFKB1/NF-kB1/DNA-binding factor KBF1/EBP-1/NF-kappa-B/NFKB-p105/Nuclear factor NF-kappa-B p105 subunit/Nuclear factor of kappa light polypeptide gene enhancer in B-cells 1/p105 |
| Human | EH1951 | Human NTN1(Netrin-1) | NTN1 | 96T | Ntn1(Netrin 1)/netrin-1/Lnetrin 1, mouse, homolog of |
| Human | EH1952 | Human APOA5(Apolipoprotein A-V) | APOA5 | 96T | APOA5(Apolipoprotein A-V)/APOAV/RAP/Apo-AV/ApoA-V/Apolipoprotein A5/Regeneration-associated protein 3 |
| Human | EH1953 | Human PRSS1(Trypsin-1) | PRSS1 | 96T | PRSS1(Protease, Serine, 1)/PTRYI/TRY4/Trygn16/Trypsinogen 1/Beta-trypsin/Cationic trypsinogen/digestive zymogen/nonfunctional trypsin 1/protease, serine, 1(trypsin 1)/Serine protease 1/TRP1/TRY1/TRYP1/Trypsin I/trypsin-1/trypsinogen 1/trypsinogen A |
| Human | EH1954 | Human NTN4(Netrin-4) | NTN4 | 96T | NTN4(Netrin 4)/beta-Netrin/Netrin-4/CDY/CDY1A/chromodomain protein, Y chromosome, 1/chromodomain protein, Y-linked, 1/testis-specific chromodomain protein on Y/testis-specific chromodomain protein Y 1/Hepar-derived netrin-like protein |
| Human | EH1955 | Human IL2RB(Interleukin-2 receptor subunit beta) | IL2RB | 96T | IL-2Rβ(Interleukin 2 Receptor Beta)/IL2RB/CD122/IL-15 R beta/CD122 antigen/high affinity IL-2 receptor beta subunit/High affinity IL-2 receptor subunit beta/IL-2 receptor subunit beta/IL-2R subunit beta/IL-2RB/interleukin 15 receptor, beta/interleukin 2 receptor, beta/interleukin-2 receptor subunit beta/p70-75/P70-75/p75 |
| Human | EH1956 | Human CHRM3(Muscarinic acetylcholine receptor M3) | CHRM3 | 96T | CHRM3/HM3/mAChR M3/cholinergic receptor, muscarinic 3/m3 muscarinic receptor/muscarinic acetylcholine receptor M3 |
| Human | EH1957 | Human VCL(Vinculin) | VCL | 96T | VCL(Vinculin)/MVCL/CMD1W/CMH15/Metavinculin |
| Human | EH1958 | Human MUCL1(Mucin-like protein 1) | MUCL1 | 96T | MUCL1(Mucin-like protein 1)/SBEM/Protein BS106/Small breast epithelial mucin |
| Human | EH1959 | Human NRP1(Neuropilin-1) | NRP1 | 96T | NRP1(Neuropilin 1)/BDCA-4/CD304/BDCA4/CD304 antigen/neuropilin 1/neuropilin-1/NRPNP1/transmembrane receptor/Vascular endothelial cell growth factor 165 receptor/VEGF165R |
| Human | EH1962 | Human VLDL(Very low-density lipoprotein) | VLDL | 96T | VLDL(Very low-density lipoprotein) |
| Human | EH1963 | Human NFKBIB(NF-kappa-B inhibitor beta) | NFKBIB | 96T | NFKBIB/TR-interacting protein 9,beta/IkappaBbeta/I-kappa-B-beta/IkB-B/ikB-B/IkB-beta/IKBB/ikB-beta/NF-kappa-B inhibitor beta/NF-kappa-BIB/nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor/Thyroid receptor-interacting protein 9/TR-interacting protein 9/TRIP-9/TRIP9 |
| Human | EH1964 | Human EN2(Homeobox protein engrailed-2) | EN2 | 96T | EN2(Homeobox protein engrailed-2)/AUTS10/engrailed homeobox 2/engrailed homolog 2/engrailed-2/Homeobox protein en-2/hu-En-2/Hu-En-2 |
| Human | EH1965 | Human Rock-2 (Rho Associated Coiled Coil Containing Protein Kinase 2) | Rock-2 | 96T | Rock-2(Rho-kinase/Rock-II/Rock2m/ROKalpha)/Rho-kinase 2/Rock-II/Rock2m/ROKalpha |
| Human | EH1966 | Human CALU(Calumenin) | CALU | 96T | CALU(Calumenin)/crocalbin-like protein/multiple EF-hand protein/Crocalbin/IEF SSP 9302 |
| Human | EH1967 | Human HPN(Serine protease hepsin) | HPN | 96T | HPN/TMPRSS1/hepsin/serine protease hepsin/serine protease hepsin catalytic chain/serine protease hepsin non-catalytic chain/Transmembrane protease serine 1/transmembrane protease, serine 1 |
| Human | EH1968 | Human HLA-B27(HLA class I histocompatibility antigen, B-27 alpha chain) | HLA-B27 | 96T | HLA-B27(HLA class I histocompatibility antigen, B-27 alpha chain)/HLAB/MHC class I antigen B27 |
| Human | EH1970 | Human ECM1(Extracellular matrix protein 1) | ECM1 | 96T | ECM1/p85/Secretory Component P85/extracellular matrix protein 1/Secretory Component Glycoprotein |
| Human | EH1971 | Human APLN36(Apelin-36) | APLN36 | 96T | AP36(Apelin 36) |
| Human | EH1972 | Human NRG-1(Neuregulin 1) | NRG-1 | 96T | NRG-1(Neuregulin 1)/Heregulin-1/HGL/HRG1-alpha/HRG1-beta 1/NRG1/ARIA/GGF2/GGF/glial growth factor/HGLneu differentiation factor/HRG/HRG1/HRGA/neuregulin 1 type IV beta 1a/MST131/MSTP131/NDFheregulin, alpha(45kD, ERBB2 p185-activator)/neuregulin 1/neuregulin 1 type IV beta 3/pro-neuregulin-1, membrane-bound isoform/pro-NRG1/sensory and motor neuron derived factor/SMDF |
| Human | EH1973 | Human MT2A(Metallothionein-2) | MT2A | 96T | MT2(Metallothionein-2)/MT2A/CES1/MT-2/MT-II/Metallothionein-2A/Metallothionein-II |
| Human | EH1974 | Human TUBB(Tubulin beta chain) | TUBB | 96T | TUBβ(β-Tubulin)/TUBB/OK/SW-cl.56/TUBB5/Tubulin beta chain/Tubulin beta-5 chain |
| Human | EH1975 | Human ERCC1(DNA excision repair protein ERCC-1) | ERCC1 | 96T | ERCC1(Excision Repair Cross Complementing Rodent Repair Deficiency Complementation 1)/DNA excision repair protein ERCC-1 |
| Human | EH1976 | Human CD3E(T-cell surface glycoprotein CD3 epsilon chain) | CD3E | 96T | CD3E(T-cell surface glycoprotein CD3 epsilon chain)/CD3e/CD3e antigen/CD3e antigen, epsilon polypeptide(TiT3 complex)/CD3e molecule, epsilon(CD3-TCR complex)/CD3-epsilon/T3E/T-cell antigen receptor complex, epsilon subunit of T3/T-cell surface antigen T3,Leu-4 epsilon chain/TCRE |
| Human | EH1977 | Human 12-HETE (12-Hydroxyeicosatetraenoic Acid) | 12-HETE | 96T | 12-HETE(12-Hydroxyeicosatetraenoic Acid) |
| Human | EH1978 | Human FOXP3(Forkhead box protein P3) | FOXP3 | 96T | FOXP3(Forkhead box protein P3)/DIETER/IPEX/JM2/PIDX/SCURFIN/XPID/AIID/forkhead box P3/FOXP3delta7/immune dysregulation, polyendocrinopathy, enteropathy, X-linked/Scurfin/XPIDpolyendocrinopathy, enteropathy, X-linked |
| Human | EH1979 | Human FGF10(Fibroblast growth factor 10) | FGF10 | 96T | FGF10(Fibroblast growth factor 10)/KGF-2/FGF-10/fibroblast growth factor 10/Keratinocyte growth factor 2/produced by fibroblasts of urinary bladder lamina propria |
| Human | EH1980 | Human 12-LO (Arachidonate 12-Lipoxygenase) | 12-LO | 96T | 12-LO(Arachidonate 12-Lipoxygenase)/ALOX12/LOG12/12S-LOX/12S-lipoxygenase/Platelet-type lipoxygenase 12/Platelet-type lipoxygenase 12 |
| Human | EH1981 | Human PLN(Cardiac phospholamban) | PLN | 96T | PLN/Cardiac phospholamban/PLB |
| Human | EH1982 | Human EIF3A(Eukaryotic translation initiation factor 3 subunit A) | EIF3A | 96T | EIF3A/Eukaryotic translation initiation factor 3 subunit A/eIF3a/eIF3 p185/eIF3 p180/eIF3 p167/Eukaryotic translation initiation factor 3 subunit 10/eIF-3-theta/EIF3S10 |
| Human | EH1983 | Human DVD/DHVD 3(1,25-dihydroxyvitamin D3) | DVD/DHVD 3 | 96T | / |
| Human | EH1984 | Human CDK2(Cyclin-dependent kinase 2) | CDK2 | 96T | CDK2/Cyclin-dependent kinase 2/Cell division protein kinase 2/p33 protein kinase/CDKN2/cdc2-related protein kinase/Cell division kinase 2 |
| Human | EH1985 | Human TOR2A(Prosalusin) | TOR2A | 96T | TOR2A/Prosalusin/Torsin family 2 member A/Torsin-2A |
| Human | EH1986 | Human VHL(Von Hippel-Lindau disease tumor suppressor) | VHL | 96T | VHL/Von Hippel-Lindau disease tumor suppressor/Protein G7/pVHL/RCA1/VHL1/pVHL/HRCA1 |
| Human | EH1987 | Human MASP1(Mannan-binding lectin serine protease 1) | MASP1 | 96T | MASP1/Mannan-binding lectin serine protease 1/Serine protease 5/Ra-reactive factor serine protease p100/RaRF/Mannose-binding protein-associated serine protease/Mannose-binding lectin-associated serine protease 1/MASP-1/Complement factor MASP-3/Complement-activating component of Ra-reactive factor/CRARF/CRARF1/PRSS5/ |
| Human | EH1988 | Human IDE(Insulin-degrading enzyme) | IDE | 96T | IDE/Insulin-degrading enzyme/Abeta-degrading protease/Insulin protease/Insulinase/Insulysin |
| Human | EH1989 | Human LSS(Lanosterol synthase) | LSS | 96T | LSS/Lanosterol synthase/2,3-epoxysqualene--lanosterol cyclase/Oxidosqualene--lanosterol cyclase/OSC/hOSC |
| Human | EH1990 | Human IFI16(Gamma-interferon-inducible protein 16) | IFI16 | 96T | IFI16/amma-interferon-inducible protein 16/Ifi-16/Interferon-inducible myeloid differentiation transcriptional activator/IFNGIP1/PYHIN2 |
| Human | EH1993 | Human GP9(Platelet glycoprotein IX) | GP9 | 96T | GP9/Platelet glycoprotein IX/GP-IX/GPIX/Glycoprotein 9 |
| Human | EH1995 | Human ACAN(Aggrecan core protein) | ACAN | 96T | ACAN/Aggrecan core protein/Cartilage-specific proteoglycan core protein/CSPCP/Chondroitin sulfate proteoglycan core protein 1/Chondroitin sulfate proteoglycan 1/AGC1/CSPG1/MSK16/AGCAN/CSPGCP/SEDK |
| Human | EH1996 | Human KLK7(Kallikrein-7) | KLK7 | 96T | KLK7/Kallikrein-7/hK7/Serine protease 6/Stratum corneum chymotryptic enzyme/hSCCE/PRSS6/SCCE/kallikrein 7/chymotryptic, stratum corneum/signal protein/protease, serine, 6 |
| Human | EH1997 | Human FPR2(N-formyl peptide receptor 2) | FPR2 | 96T | FPR2/N-formyl peptide receptor 2/RFP/Lipoxin A4 receptor/LXA4 receptor/HM63/FMLP-related receptor I/FMLP-R-I/Formyl peptide receptor-like 1/FPRH1/FPRL1/LXA4R |
| Human | EH1998 | Human BTK(Tyrosine-protein kinase BTK) | BTK | 96T | BTK/Tyrosine-protein kinase BTK/Bruton tyrosine kinase/Agammaglobulinaemia tyrosine kinase/ATK/B-cell progenitor kinase/BPK/AT/XLA/IMD1/AGMX1/PSCTK1/dominant-negative kinase-deficient Brutons tyrosine kinase/Bruton agammaglobulinemia tyrosine kinase |
| Human | EH1999 | Human PRKACA(cAMP-dependent protein kinase catalytic subunit alpha) | PRKACA | 96T | PRKACA/cAMP-dependent protein kinase catalytic subunit alpha/PKA C-alpha |
| Human | EH2000 | Human ANGPTL2(Angiopoietin-related protein 2) | ANGPTL2 | 96T | ANGPTL2/Angiopoietin-related protein 2/Angiopoietin-like protein 2/ARP2/HARP/ANGRP2 |
| Human | EH2001 | Human CCR4(C-C chemokine receptor type 4) | CCR4 | 96T | CCR4/C-C chemokine receptor type 4/C-C CKR-4/CC-CKR-4/CCR-4/CCR4/K5-5/CMKBR4/CD194/CD194 antigen/CKR4/ChemR13 |
| Human | EH2002 | Human OGDH(2-oxoglutarate dehydrogenase, mitochondrial) | OGDH | 96T | OGDH/2-oxoglutarate dehydrogenase, mitochondrial/2-oxoglutarate dehydrogenase complex component E1/OGDC-E1/Alpha-ketoglutarate dehydrogenase/E1k/OGDC/AKGDH |
| Human | EH2003 | Human ROMO1(Reactive oxygen species modulator 1) | ROMO1 | 96T | ROMO1/Reactive oxygen species modulator 1/ROS modulator 1/Protein MGR2 homolog/Mitochondrial targeting GxxxG motif protein/MTGM/Protein MGR2 homolog/Glyrichin |
| Human | EH2004 | Human THRA(Thyroid hormone receptor alpha) | THRA | 96T | THRA/Thyroid hormone receptor alpha/c-erbA-alpha/c-erbA-1/Nuclear receptor subfamily 1 group A member 1/V-erbA-related protein 7/EAR-7/EAR7/ERBA1/NR1A1/THRA1/THRA2/AR7/ERBA/ERBA-related 7/triiodothyronine receptor/thyroid hormone receptor, alpha/erythroblastic leukemia viral(v-erb-a)oncogene homolog, avian |
| Human | EH2005 | Human FH(Fumarate hydratase, mitochondrial) | FH | 96T | FH/Fumarate hydratase, mitochondrial/Fumarase/HLRCC/LRCC/MCL/MCUL1 |
| Human | EH2006 | Human GAPDH(Glyceraldehyde-3-phosphate dehydrogenase) | GAPDH | 96T | GAPDH/Glyceraldehyde-3-phosphate dehydrogenase/Peptidyl-cysteine S-nitrosylase GAPDH/GAPD/G3PD/G3PDH/aging-associated gene 9 protein |
| Human | EH2007 | Human LRG1(Leucine-rich alpha-2-glycoprotein) | LRG1 | 96T | LRG1/Leucine-rich alpha-2-glycoprotein/LRG/leucine-rich alpha-2-glycoprotein 1 |
| Human | EH2008 | Human AANAT(Serotonin N-acetyltransferase) | AANAT | 96T | AANAT/Serotonin N-acetyltransferase/Serotonin acetylase/Aralkylamine N-acetyltransferase/AA-NAT/SNAT |
| Human | EH2009 | Human APEX1(DNA-(apurinic or apyrimidinic site) lyase) | APEX1 | 96T | APEX1/DNA-(apurinic or apyrimidinic site) lyase/Redox factor-1/REF-1/APEX nuclease/APEN/Apurinic-apyrimidinic endonuclease 1/AP endonuclease 1/APE-1/APE1/APEX/APX/HAP1/REF1/APE/Apurinic/Apyrimidinic Endonuclease/multifunctional DNA repair enzyme |
| Human | EH2010 | Human TFPI2(Tissue factor pathway inhibitor 2) | TFPI2 | 96T | TFPI2/Tissue factor pathway inhibitor 2/TFPI-2/Placental protein 5/PP5/REF-1 |
| Human | EH2011 | Human CDKN2C(Cyclin-dependent kinase 4 inhibitor C) | CDKN2C | 96T | CDKN2C/Cyclin-dependent kinase 4 inhibitor C/p18-INK6/Cyclin-dependent kinase 6 inhibitor/p18-INK4c/CDKN6/p18/CDK6 inhibitor p18/cyclin-dependent kinase inhibitor 2C/p18, inhibits CDK4 |
| Human | EH2012 | Human ANXA2(Annexin A2) | ANXA2 | 96T | ANXA2/Annexin A2/Lipocortin II/Chromobindin-8/Calpactin-1 heavy chain/Calpactin I heavy chain/p36/Protein I/Placental anticoagulant protein IV/PAP-IV/Annexin II/Annexin-2/ANX2/ANX2L4/CAL1H/LPC2D/LIP2/LPC2 |
| Human | EH2013 | Human EREG(Proepiregulin) | EREG | 96T | EREG/Proepiregulin/ER/EPR/epiregulin |
| Human | EH2014 | Human ACR(Acrosin) | ACR | 96T | ACR/Acrosin/ACRS |
| Human | EH2015 | Human TLR7(Toll-like receptor 7) | TLR7 | 96T | TLR7/Toll-like receptor 7 |
| Human | EH2017 | Human PROM1(Prominin-1) | PROM1 | 96T | PROM1/Prominin-1/Antigen AC133/Prominin-like protein 1/MSTP061/PROML1/AC133/CD133/CORD12/MCDR2/RP41/STGD4 |
| Human | EH2018 | Human IKBKB(Inhibitor of nuclear factor kappa-B kinase subunit beta) | IKBKB | 96T | IKBKB/Inhibitor of nuclear factor kappa-B kinase subunit beta/I-kappa-B-kinase beta/IKK-B/IKK-beta/IkBKB/I-kappa-B kinase 2/IKK2/Nuclear factor NF-kappa-B inhibitor kinase beta/NFKBIKB/IKKB |
| Human | EH2019 | Human CBS(Cystathionine beta-synthase) | CBS | 96T | CBS/Cystathionine beta-synthase/Beta-thionase/Serine sulfhydrase/HIP4 |
| Human | EH2020 | Human CD34(Hematopoietic progenitor cell antigen CD34) | CD34 | 96T | CD34/Hematopoietic progenitor cell antigen CD34/HPCA1/CD34 antigenhematopoietic progenitor cell antigen CD34/CD34 molecule |
| Human | EH2021 | Human TLN2(Talin-2) | TLN2 | 96T | TLN2(Talin-2)/ILWEQ/KIAA0320/talin2/talin-2 |
| Human | EH2022 | Human DNM1(Dynamin-1) | DNM1 | 96T | DNM1(Dynamin-1) |
| Human | EH2025 | Human PROS1(Vitamin K-dependent protein S) | PROS1 | 96T | PROS1(Vitamin K-dependent protein S)/PSA/PROS/PS21/PS22/PS23/PS24/PS25/THPH5/THPH6/protein S(alpha)/protein Sa/vitamin K-dependent plasma protein S/vitamin K-dependent protein S |
| Human | EH2026 | Human ADAMTS7(A disintegrin and metalloproteinase with thrombospondin motifs 7) | ADAMTS7 | 96T | ADAMTS7(A Disintegrin And Metalloproteinase With Thrombospondin 7)/COMPase |
| Human | EH2027 | Human TNC(Tenascin) | TNC | 96T | TNC(Tenascin C)/Tenascin/JI/Hexabrachion/Glioma-associated-extracellular matrix antigen/GP 150-225/Neuronectin/Myotendinous antigen/Cytotactin/GMEM/HXB/Tenascin J1/Cytotactin/Glioma-associated-extracellular matrix antigen/Hexabrachion/hexabrachion(tenascin)/HXBcytotactin/TN-C/TNGP |
| Human | EH2028 | Human EDA(Ectodysplasin-A) | EDA | 96T | EDA(Ectodysplasin-A)/EDA protein homolog/Tabby protein/ED1/HED/EDA1/EDA2/HED1/ODT1/XHED/ECTD1/XLHED/ED1-A1/ED1-A2/EDA-A1/EDA-A2/STHAGX1/Ectodermal dysplasia protein |
| Human | EH2030 | Human MAPT(Microtubule-associated protein tau) | MAPT | 96T | MAPT(Microtubule-associated protein tau)/TAU/MSTD/PPND/DDPAC/MAPTL/MTBT1/MTBT2/FTDP-17/Neurofibrillary tangle protein/Paired helical filament-tau |
| Human | EH2031 | Human HPX(Hemopexin) | HPX | 96T | HPX(Hemopexin)/Beta-1B-glycoprotein/beta-1B-glycoprotein//hemopexin/HX |
| Human | EH2032 | Human PRKACB(cAMP-dependent protein kinase catalytic subunit beta) | PRKACB | 96T | PRKACB(cAMP-dependent protein kinase catalytic subunit beta) |
| Human | EH2034 | Human TLR5(Toll-like receptor 5) | TLR5 | 96T | TLR5(Toll-like receptor 5)/TIL3/SLEB1/Toll/interleukin-1 receptor-like protein 3/TIL-3/TIL3Toll/interleukin-1 receptor-like protein 3/toll-like receptor 5 |
| Human | EH2035 | Human ARRB2(Beta-arrestin-2) | ARRB2 | 96T | ARRβ2(Arrestin Beta 2)/ARRB2/ARB2/ARR2/BARR2/Beta-arrestin-2/Arrestin beta-2/arrestin 3/Arrestin beta-2/arrestin, beta 2/beta-arrestin-2 |
| Human | EH2036 | Human ProHAMP(Hepcidin prohormone) | ProHAMP | 96T | ProHAMP(Hepcidin prohormone) |
| Human | EH2037 | Human CNN1(Calponin-1) | CNN1 | 96T | CNN1(Calponin-1)/Calponin H1/Sm-Calp/SMCC/Basic calponin/calponin 1, basic, smooth muscle/Calponin H1, smooth muscle/calponins, basic |
| Human | EH2038 | Human MMP28(Matrix metalloproteinase-28) | MMP28 | 96T | MMP28(Matrix metalloproteinase-28) |
| Human | EH2039 | Human GKN2(Gastrokine-2) | GKN2 | 96T | GKN2(Gastrokine-2) |
| Human | EH2040 | Human HTRA1(Serine protease HTRA1) | HTRA1 | 96T | HTRA1(Serine protease HTRA1)/IGFBP5-protease/PRSS11/ARMD7/High-temperature requirement A serine peptidase 1/HtrA serine peptidase 1/L56/ORF480/Serine protease 11/serine, 11(IGF binding)/CARASIL/HtrA |
| Human | EH2041 | Human EPAS1(Endothelial PAS domain-containing protein 1) | EPAS1 | 96T | EPAS1(Endothelial PAS domain-containing protein 1)/EPAS-1/HLF/MOP2/Basic-helix-loop-helix-PAS protein MOP2/BHLHE73/Class E basic helix-loop-helix protein 73/endothelial PAS domain protein 1/HIF-1alpha-like factor/HIF2A/HIF-2-alpha/HIF-1-alpha-like factor/hypoxia-inducible factor 2 alpha/Hypoxia-inducible factor 2-alpha/Member of PAS protein 2/HIF2-alpha/PASD2/PAS domain-containing protein 2 |
| Human | EH2042 | Human SLC3A2(4F2 cell-surface antigen heavy chain) | SLC3A2 | 96T | SLC3A2(4F2 cell-surface antigen heavy chain)/4F2/CD98/4T2HC/antigen identified by monoclonal antibodies 4F2, TRA1.10, TROP4, and T43,4F2HC/CD98 antigen/CD98 heavy chain/CD98HC/heavy chain/Lymphocyte activation antigen 4F2 large subunit/MDU1antigen defined by monoclonal 4F2, heavy chain/monoclonal 44D7/NACAE4F2 cell-surface antigen heavy chain/solute carrier family 3(activators of dibasic and neutral amino acidtransport), member 2,4F2 heavy chain antigen |
| Human | EH2043 | Human IL34(Interleukin-34) | IL34 | 96T | IL34(Interleukin-34) |
| Human | EH2044 | Human IL36A(Interleukin-36 alpha) | IL36A | 96T | IL36A(Interleukin-36 alpha)/FIL1 epsilon/IL-1E/IL1F6/FIL1/FIL1 epsilon/FIL1(EPSILON)/FIL1E/IL-1 epsilon/IL1(EPSILON)/IL1E/IL1F6/IL-1F6/IL-1F6(FIL-1-epsilon)/interleukin 1 family, member 6(epsilon)/interleukin 1, epsilon/Interleukin 36, Alpha/Interleukin-1 epsilon/interleukin-1 family member 6/Interleukin-36 Alpha |
| Human | EH2045 | Human CFB(Complement factor B) | CFB | 96T | CFB(Complement Factor B)/BF/BFD/C3,C5 convertase/CFAB/CFB/GBG/H2-Bf/PBF2/B-factor, properdin/BFAHUS4/C3 proaccelerator/C3 proactivator/complement factor B/FB/FBI12/GBGCFAB/Glycine-rich beta glycoprotein/glycine-rich beta-glycoprotein/H2-Bf/PBF2/Properdin factor B |
| Human | EH2046 | Human IL36B(Interleukin-36 beta) | IL36B | 96T | IL36B(Interleukin-36 beta)/FIL1 eta/IL-1 eta/IL1F8/IL-1H2/family of interleukin 1-eta/FIL1/FIL1-(ETA)/FIL1H/IL1-ETA/IL-1F8/IL1F8(Canonical product IL-1F8a)/IL-1F8(FIL1-eta)/IL1H2/interleukin 1 family, member 8(eta)/interleukin 1, eta/Interleukin 36, Beta/Interleukin-1 eta/interleukin-1 family member 8/Interleukin-1 homolog 2/Interleukin-1 Superfamily e |
| Human | EH2047 | Human CCR6(C-C chemokine receptor type 6) | CCR6 | 96T | CCR6(C-C chemokine receptor type 6)/CD196/GPR29/GPR-CY4/STRL22/BN-1/CC-CKR-6/CCR-6/CD196 antigen/chemokine(C-C motif) receptor 6/CKR-L3G-protein coupled receptor 29/CKRL3LARC receptor/CMKBR6/DRY6/GPR29/C-C CKR-6/DRY-6/lymphocyte, 22 |
| Human | EH2048 | Human NPEPPS(Puromycin-sensitive aminopeptidase) | NPEPPS | 96T | NPEPPS(Puromycin-sensitive aminopeptidase)/AAP-S/MP100/aminopeptidase puromycin sensitive/Cytosol alanyl aminopeptidase/metalloproteinase MP100/puromycin-sensitive aminopeptidase |
| Human | EH2049 | Human PYY3(Putative peptide YY-3) | PYY3 | 96T | PYY3(Putative peptide YY-3) |
| Human | EH2050 | Human UNC13C(Protein unc-13 homolog C) | UNC13C | 96T | UNC13C(Protein unc-13 homolog C) |
| Human | EH2051 | Human PLA2R1(Secretory phospholipase A2 receptor) | PLA2R1 | 96T | PLA2R1(Secretory phospholipase A2 receptor)/CLEC13C/PLA2G1R/CLEC13CC-type lectin domain family 13 member C/phospholipase A2 receptor 1, 180kDa/PLA2IR/PLA2-RM-type receptor |
| Human | EH2052 | Human KHK(Ketohexokinase) | KHK | 96T | KHK(Ketohexokinase)/Hepatic fructokinase/Fructokinase |
| Human | EH2056 | Human MGMT(Methylated-DNA--protein-cysteine methyltransferase) | MGMT | 96T | MGMT(Methylated-DNA--protein-cysteine methyltransferase)/6-O-methylguanine-DNA methyltransferase/MGMT/O-6-methylguanine-DNA-alkyltransferase |
| Human | EH2057 | Human IL28B(Interleukin-28B) | IL28B | 96T | IL28B(Interleukin-28B)/IL-28B/Interleukin-28C/IL-28C/Interferon lambda-4/IFN-lambda-4/Cytokine Zcyto22/Interferon lambda-3/IFN-lambda-3/IL28C/IL-28B/interferon, lambda 3 |
| Human | EH2059 | Human CKB(Creatine kinase B-type) | CKB | 96T | CKB(Creatine kinase B-type)/B-CK/Creatine kinase B chain |
| Human | EH2060 | Human IL4R(Interleukin-4 receptor) | IL4R | 96T | IL4R(Interleukin-4 receptor subunit alpha)/IL-4 receptor subunit alpha/IL-4R subunit alpha/IL-4R-alpha/IL-4RA/IL4RA/interleukin 4 receptor/interleukin-4 receptor alpha chain |
| Human | EH2061 | Human MMEL1(Membrane metallo-endopeptidase-like 1) | MMEL1 | 96T | MMEL1(Membrane metallo-endopeptidase-like 1)/Neprilysin-2/NEP2/NL2/Neprilysin II/NEPII/Membrane metallo-endopeptidase-like 2/NEP2(m)/MELL1/MMEL2/SEP/soluble secreted endopeptidase/zinc metallopeptidase |
| Human | EH2063 | Human OB(Obestatin) | OB | 96T | OB(Obestatin) |
| Human | EH2064 | Human DEFB126(Beta-defensin 126) | DEFB126 | 96T | DEFB126(Beta-defensin 126)/Epididymal secretory protein/Beta-defensin 26/DEFB-26/Defensin, beta 126/C20orf8/DEFB26 |
| Human | EH2065 | Human PPARD(Peroxisome proliferator-activated receptor delta) | PPARD | 96T | PPARD(Peroxisome proliferator-activated receptor delta)/PPAR-delta/Peroxisome proliferator-activated receptor beta/PPAR-beta/Nuclear receptor subfamily 1 group C member 2/NUCI/Nuclear hormone receptor 1/NUC1/NR1C2/PPARB/FAAR/NUCII |
| Human | EH2066 | Human NR1H4(Bile acid receptor) | NR1H4 | 96T | NR1H4(Bile acid receptor)/Retinoid X receptor-interacting protein 14/RXR-interacting protein 14/Nuclear receptor subfamily 1 group H member 4/Farnesoid X-activated receptor/Farnesol receptor/HRR-1/BAR/FXR/HRR1/RIP14 |
| Human | EH2067 | Human NR1H3(Oxysterols receptor LXR-alpha) | NR1H3 | 96T | NR1H3(Oxysterols receptor LXR-alpha) Liver X receptor alpha/Nuclear receptor subfamily 1 group H member 3/LXRA/LXR-a/RLD-1 |
| Human | EH2068 | Human DEFB127(Beta-defensin 127) | DEFB127 | 96T | DEFB127(Beta-defensin 127)/Beta-defensin 27/DEFB-27/Defensin, beta 127 |
| Human | EH2069 | Human DEFB129(Beta-defensin 129) | DEFB129 | 96T | DEFB129(Beta-defensin 129)/Beta-defensin 29/DEFB-29/Defensin, beta 129 |
| Human | EH2070 | Human ZBED3(Zinc finger BED domain-containing protein 3) | ZBED3 | 96T | ZBED3(Zinc finger BED domain-containing protein 3)/Axin-interacting protein |
| Human | EH2071 | Human WTIP(Wilms tumor protein 1-interacting protein) | WTIP | 96T | WTIP(Wilms tumor protein 1-interacting protein)/WT1-interacting protein |
| Human | EH2072 | Human EPHX4(Epoxide hydrolase 4) | EPHX4 | 96T | EPHX4(Epoxide hydrolase 4)/ABHD7/EPHXRP/Abhydrolase domain-containing protein 7/Epoxide hydrolase-related protein |
| Human | EH2073 | Human S100P(Protein S100-P) | S100P | 96T | S100P(Protein S100-P)/MIG9/migration-inducing gene 9/Protein S100-E/S100 calcium binding protein P/S100 calcium-binding protein Pprotein S100-P/S100E |
| Human | EH2074 | Human CCR5(C-C chemokine receptor type 5) | CCR5 | 96T | CCR5(C-C chemokine receptor type 5)/CD195/C-C CKR-5/C-C motif chemokine receptor 5/CCCKR/CCR-5/CD195 antigen/chemokine(C-C motif) receptor 5/chemokine receptor CCR5/CHEMR13/chemr13/CKR5/CKR-5/HIV-1 fusion coreceptor/IDDM22CMKBR5 |
| Human | EH2076 | Human 26S-PSM (26S Proteasome) | 26S-PSM | 96T | 26S-PSM(26S Proteasome)/26SPSM/26-SPSM |
| Human | EH2077 | Human CMA1(Chymase) | CMA1 | 96T | CMA1(Chymase)/Alpha-chymase/Mast cell protease I |
| Human | EH2079 | Human KISS1(Metastasis-suppressor KiSS-1) | KISS1 | 96T | KISS1(Metastasis-suppressor KiSS-1)/Kisspeptin-1 |
| Human | EH2080 | Human 4-HNE (4-Hydroxynonenal) | 4-HNE | 96T | 4-HNE(4-Hydroxynonenal)/HNE/4 HNE |
| Human | EH2081 | Human ADAMTS9(A disintegrin and metalloproteinase with thrombospondin motifs 9) | ADAMTS9 | 96T | ADAMTS9(A disintegrin and metalloproteinase with thrombospondin motifs 9)/ADAM-TS 9/ADAM-TS9/ADAMTS-9 |
| Human | EH2082 | Human UCP2(Mitochondrial uncoupling protein 2) | UCP2 | 96T | UCP2(Mitochondrial uncoupling protein 2)/UCPH/uncoupling protein 2/Solute carrier family 25 member 8/uncoupling protein 2(mitochondrial, proton carrier) |
| Human | EH2083 | Human UCP1(Mitochondrial brown fat uncoupling protein 1) | UCP1 | 96T | UCP1(Mitochondrial brown fat uncoupling protein 1)/Solute carrier family 25 member 7/Thermogenin/UCP 1/UCP/uncoupling protein 1(mitochondrial, proton carrier)/Thermogenin/SLC25A7mitochondrial brown fat uncoupling protein 1 |
| Human | EH2084 | Human LRP1(Prolow-density lipoprotein receptor-related protein 1) | LRP1 | 96T | LRP1(Prolow-density lipoprotein receptor-related protein 1)/LRP-1/Alpha-2-macroglobulin receptor/A2MR/Apolipoprotein E receptor/APOER/CD91 |
| Human | EH2086 | Human COQ10B(Coenzyme Q-binding protein COQ10 homolog B, mitochondrial) | COQ10B | 96T | |
| Human | EH2087 | Human QPCTL(Glutaminyl-peptide cyclotransferase-like protein) | QPCTL | 96T | QPCTL(Glutaminyl-peptide cyclotransferase-like protein)/Golgi-resident glutaminyl-peptide cyclotransferase/isoQC/gQC |
| Human | EH2088 | Human SELENBP1(Selenium-binding protein 1) | SELENBP1 | 96T | SELENBP1/SBP/SBP56/SP56/56 kDa selenium-binding protein |
| Human | EH2089 | Human CCR3(C-C chemokine receptor type 3) | CCR3 | 96T | CCR3/CMKBR3/CD193/b-chemokine receptor/CC chemokine receptor 3/C-C chemokine receptor type 3/C-C CKR-3/CCR-3/CD193 antigen/chemokine(C-C motif) receptor 3/CKR3/CC-CKR-3/CMKBR3/eosinophil CC chemokine receptor 3/Eosinophil eotaxin receptor/MGC102841 |
| Human | EH2090 | Human DMP1(Dentin matrix acidic phosphoprotein 1) | DMP1 | 96T | DMP1/Dentin matrix protein 1/ARHP/ARHR/dentin matrix acidic phosphoprotein/dentin matrix acidic phosphoprotein 1/Dentin matrix protein 1 |
| Human | EH2091 | Human PION(Gamma-secretase-activating protein) | PION | 96T | PION/GSAP/Protein pigeon homolog |
| Human | EH2093 | Human ALAD(Delta-aminolevulinic acid dehydratase) | ALAD | 96T | ALAD/ALADH/Porphobilinogen synthase |
| Human | EH2094 | Human FECH(Ferrochelatase, mitochondrial) | FECH | 96T | FECH/Heme synthase/Protoheme ferro-lyase |
| Human | EH2095 | Human QPCT(Glutaminyl-peptide cyclotransferase) | QPCT | 96T | QPCT/GCT/Glutaminyl cyclase/Glutamyl cyclase/EC 2.3.2.5/GCT/Glutaminyl cyclase/glutaminyl-peptide cyclotransferase/Glutaminyl-tRNA cyclotransferase/Glutamyl cyclase/QCEC/sQC |
| Human | EH2096 | Human DDOST(Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit) | DDOST | 96T | DDOST/OK/SW-cl.45/KIAA0115/OST48/DDOST 48 kDa subunit/Oligosaccharyl transferase 48 kDa subunit |
| Human | EH2097 | Human PDPN(Podoplanin) | PDPN | 96T | PDPN/Aggrus/Gp38/RANDAM-2/T1A-2/36-KD/aggrus/AGGRUS/Gp36/GP40/HT1A-1/hT1alpha-1/hT1alpha-2/lung type I cell membrane associated glycoprotein/lung type-I cell membrane-associated glycoprotein(T1A-2)/OTS 8/OTS8/PA2.26 antigen/podoplanin/T1A/T1-alpha |
| Human | EH2098 | Human LGALS13(Galactoside-binding soluble lectin 13) | LGALS13 | 96T | LGALS13/PLAC8/Gal-13/PP13/Placental protein 13/Galectin-13/Placental tissue protein 13 |
| Human | EH2099 | Human MCL1(Induced myeloid leukemia cell differentiation protein Mcl-1) | MCL1 | 96T | MCL1/BCL2L3/bcl2-L-3/Bcl2-L-3/MGC104264/Bcl-2-like protein 3/Bcl-2-related protein EAT/mcl1/EAT/induced myeloid leukemia cell differentiation protein Mcl-1/Mcl-1/mcl1/EAT/MCL1-ES/MCL1L/MCL1S/MGC1839/myeloid cell leukemia ES/myeloid cell leukemia sequence 1(BCL2-related)/TM |
| Human | EH2101 | Human ADAMTS5(A disintegrin and metalloproteinase with thrombospondin motifs 5) | ADAMTS5 | 96T | ADAMTS5(A disintegrin and metalloproteinase with thrombospondin motifs 5)/ADAMTS11/ADMP-2/Aggrecanase 2/A disintegrin and metalloproteinase with thrombospondin motifs 11/a disintegrin-like and metalloprotease(reprolysin type) with thrombospondintype 1 motif/5(aggrecanase-2)/ADAM metallopeptidase with thrombospondin type 1 motif/5/ADAM-TS 11/ADAM-TS 5/ADAMTS-11/ADAM-TS5/ADAMTS-5/ADMP2/ADMP-2A disintegrin and metalloproteinase with thrombospondin motifs 5/Aggrecanase-2/aggrecanase-2/disintegrin-like and metalloprotease with thrombospondin type 1 motif |
| Human | EH2102 | Human MEFV(Pyrin) | MEFV | 96T | MEFV/MEF/Marenostrin |
| Human | EH2103 | Human DNMT1(DNA (cytosine-5)-methyltransferase 1) | DNMT1 | 96T | DNMT1(DNA(cytosine-5)-methyltransferase 1)/CXXC9/MCMT/AIM/CXXC9CXXC finger protein 9/CXXC-type zinc finger protein 9/DNA(cytosine-5-)-methyltransferase 1/DNA(cytosine-5)-methyltransferase 1/DNA methyltransferase 1/DNA methyltransferase HsaI/DNA MTase HsaI/DNMT |
| Human | EH2104 | Human IL17B(Interleukin-17B) | IL17B | 96T | IL17B/Cytokine Zcyto7/cytokine-like protein ZCYTO7/IL-17Binterleukin-17 beta/IL20/IL-20interleukin-17B/interleukin 17B/interleukin 20/Interleukin-20/MGC138900/MGC138901/neuronal interleukin-17 related factor/Neuronal interleukin-17-related factor/NIRF/ZCYTO7interleukin-20 |
| Human | EH2105 | Human TLN1(Talin-1) | TLN1 | 96T | TLN1(Talin-1)/KIAA1027/ILWEQ/KIAA1027/talin 1/talin-1/TLN |
| Human | EH2106 | Human MRC2(C-type mannose receptor 2) | MRC2 | 96T | MRC2(CD280C-type mannose receptor 2)/CD280/CLEC13E/Endo180/uPARAP/CD280 antigen/CLEC13EUPAR-associated protein/ENDO180C-type lectin domain family 13 member E/Endocytic receptor 180/KIAA0709FLJ35911/Macrophage mannose receptor 2/mannose receptor, C type 2/UPARAPendocytic receptor(macrophage mannose receptor family)/urokinase plasminogen activator receptor-associated protein/Urokinase receptor-associated protein/Urokinase-type plasminogen activator receptor-associated protein |
| Human | EH2107 | Human IFNE(Interferon epsilon) | IFNE | 96T | IFNE/IFN-epsilon/Interferon epsilon-1 |
| Human | EH2108 | Human GOT1L1(Putative aspartate aminotransferase, cytoplasmic 2) | GOT1L1 | 96T | GOT1L1(Glutamate oxaloacetate transaminase 1-like protein 1)/Putative aspartate aminotransferase, cytoplasmic 2/Transaminase A-like protein 1 |
| Human | EH2109 | Human TK1(Thymidine kinase, cytosolic) | TK1 | 96T | TK1(thymidine kinase 1,soluble)/thymidine kinase 1 soluble isoform/thymidine kinase/cytosolic/thymidine kinase-1/TK2 |
| Human | EH2110 | Human 5-HETE (5-Hydroxyeicosatetraenoic Acid) | 5-HETE | 96T | 5-HETE(5-Hydroxyeicosatetraenoic Acid) |
| Human | EH2111 | Human LCAT(Phosphatidylcholine-sterol acyltransferase) | LCAT | 96T | Lecithin-cholesterol acyltransferase/Phospholipid-cholesterol acyltransferase/ |
| Human | EH2112 | Human CD59(CD59 glycoprotein) | CD59 | 96T | CD59/HRF20/MACIF/MIC11/Protectin/16.3A5/1F5/1F5 antigen/20 kDa homologous restriction factor/CD59 antigen/CD59 antigen p18-20(antigen identified by monoclonal antibodies 16.3A5, EJ16/CD59 antigen, complement regulatory protein/CD59 glycoprotein/CD59 molecule, complement regulatory protein/human leukocyte antigen MIC11/Ly-6-like protein/lymphocytic antigen CD59/MEM43/MACIF/MAC-inhibitory protein/MAC-IP/MEM43/MEM43 antigen/membrane attack complex(MAC) inhibition factor/Membrane attack complex inhibition factor/Membrane inhibitor of reactive lysis/MGC2354/MIC11MSK21/MIN1/MIN2/MIN3/MIRL/p18-20/Protectin/protectin/surface anitgen recognized by monoclonal 16.3A5/T cell-activating protein |
| Human | EH2113 | Human EDN3(Endothelin-3) | EDN3 | 96T | EDN3/endothelin 3/endothelin-3/ET3/ET-3/HSCR4/PPET3/preproendothelin-3/Preproendothelin-3/truncated endothelin 3/WS4B |
| Human | EH2114 | Human EDN2(Endothelin-2) | EDN2 | 96T | ET-2/Preproendothelin-2(PPET2) |
| Human | EH2115 | Human DAB2(Disabled homolog 2) | DAB2 | 96T | Disabled-2/DOC2/Differentially-expressed protein 2/disabled(Drosophila) homolog 2(mitogen-responsive phosphoprotein)/disabled homolog 2, mitogen-responsive phosphoprotein(Drosophila)/DOC-2DOC2disabled homolog 2/FLJ26626/mitogen-responsive phosphoprotein |
| Human | EH2116 | Human PFN1(Profilin-1) | PFN1 | 96T | PFN1(Profilin-1)/Profilin I/PROF1 |
| Human | EH2117 | Human SIRT6(NAD-dependent deacetylase sirtuin-6) | SIRT6 | 96T | SIRT6(NAD-dependent deacetylase sirtuin-6)/SIR2L6/SIR2-like protein 6 |
| Human | EH2118 | Human NPR1(Atrial natriuretic peptide receptor 1) | NPR1 | 96T | NPR1(Atrial natriuretic peptide receptor 1)/ANPa/ANPRA/GC-A/GUCY2A/NPRA/Pndr/ANP-A/ANPR-A/Atrial natriuretic peptide receptor type A/atrionatriuretic peptide receptor A/Guanylate cyclase A/GUC2A/natriuretic peptide A type receptor/natriuretic peptide receptor A/natriuretic peptide receptor A/guanylate cyclase A(atrionatriuretic peptidereceptor A)/NPR-A |
| Human | EH2119 | Human GREM1(Gremlin-1) | GREM1 | 96T | GREM1(GremLin 1)/DAND2/DRM/Cell proliferation-inducing gene 2 protein/CKTSF1B1/gremLin 1, cysteine knot superfamily, homolog/DAN domain family member 2/GREMLIN/Down-regulated in Mos-transformed cells protein/DRMM/gremLin/gremLin-1/gremLin 1-like protein/IHG-2/Increased in high glucose protein 2/increased in high glucose-2/proliferation-inducing gene 2 |
| Human | EH2120 | Human TERT(Telomerase reverse transcriptase) | TERT | 96T | TERT(Telomerase Reverse Transcriptase)/CMM9/DKCA2/DKCB4/EST2/PFBMFT1/TCS1/TP2/TRT/Telomerase-associated protein 2/Telomerase catalytic subunit |
| Human | EH2121 | Human RELN(Reelin) | RELN | 96T | RELN(Reelin)/Reeler/RL |
| Human | EH2123 | Human FGF8(Fibroblast growth factor 8) | FGF8 | 96T | FGF8/Androgen-induced growth factor(AIGF)/Heparin-binding growth factor 8(HBGF-8)/AIGF/HBGF-8/AIGFKAL6/Androgen-induced growth factor/FGF-8/fibroblast growth factor 8 |
| Human | EH2124 | Human PIP(Prolactin-inducible protein) | PIP | 96T | PIP/GCDFP-15/GCDFP15/GPIP4/gp17/Secretory actin-binding protein(SABP)/Gross cystic disease fluid protein 15/Prolactin-induced protein/ |
| Human | EH2125 | Human AIM2(Interferon-inducible protein AIM2) | AIM2 | 96T | AIM2/Interferon-inducible protein AIM2 |
| Human | EH2126 | Human KISS1R(KiSS-1 receptor) | KISS1R | 96T | KISS1R/HH8/GPR54/AXOR12/KISS-1R/HOT7T175/Metastin receptor/Kisspeptins receptor/Hypogonadotropin-1/G-protein coupled receptor 54/G-protein coupled receptor OT7T175(hOT7T175)/AXOR12/GPR54//OT7T175/AXOR12hypogonadotropin-1/GPR54kiSS-1R/KISS1 recepto |
| Human | EH2128 | Human PNPLA6(Neuropathy target esterase) | PNPLA6 | 96T | PNPLA6/NTE/Patatin-like phospholipase domain-containing protein 6 |
| Human | EH2129 | Human GZMM(Granzyme M) | GZMM | 96T | GZMM/LMET1/MET1/Natural killer cell granular protease/Met-1 serine protease(Hu-Met-1)/Met-ase/ |
| Human | EH2130 | Human NQO1(NAD(P)H dehydrogenase [quinone] 1) | NQO1 | 96T | NQO1/DTD/QR1/DHQU/DIA4/NMOR1/NMORI/Azoreductase//Diaphorase-4/Dioxin-inducible 1/Menadione Reductase/Quinone Reductase 1/DIA4azoreductase/diaphorase(NADH/NADPH)(cytochrome b-5 reductase)/dioxin-inducible 1/DT-diaphorase/NAD(P)H:menadione oxidoreductase 1/NAD(P)H:Quinone acceptor oxidoreductase type 1/NAD(P)H:quinone oxidoreductase 1/diaphorase-4/Phylloquinone reductase |
| Human | EH2131 | Human NR1I3(Nuclear receptor subfamily 1 group I member 3) | NR1I3 | 96T | NR1I3/CAR/CAR1/MB67/Orphan nuclear receptor MB67/Constitutive activator of retinoid response/Constitutive active response/Constitutive androstane receptor/nuclear receptor subfamily 1 group I member 3/orphan nuclear hormone receptor/Orphan nuclear receptor MB67 |
| Human | EH2132 | Human DSPP(Dentin sialophosphoprotein) | DSPP | 96T | DSPP |
| Human | EH2133 | Human CRHBP(Corticotropin-releasing factor-binding protein) | CRHBP | 96T | CRHBP/Corticotropin-releasing factor-binding protein/CRFBP/corticotropin releasing hormone binding protein/CRFBPcorticotropin releasing hormone-binding protein/CRF-BPCRF-binding protein/CRH-BP. |
| Human | EH2134 | Human APOM(Apolipoprotein M) | APOM | 96T | |
| Human | EH2135 | Human APOD(Apolipoprotein D) | APOD | 96T | |
| Human | EH2136 | Human CXCR4(C-X-C chemokine receptor type 4) | CXCR4 | 96T | CXCR4/Chemokine C-X-C-Motif Receptor/Stromal cell-derived factor 1 receptor(SDF-1 receptor)/Leukocyte-derived seven transmembrane domain receptor(LESTR)/Fusin/LCR1/CD184/Fusin/chemokine(C-X-C motif) receptor 4/C-X-C chemokine receptor type 4/CXC-R4//D2S201ESDF-1 receptor/FB22/Fusin/HM89NPYRL/HSY3RR/LAP3/LCR1/LESTRCD184 antigen/Leukocyte-derived seven transmembrane domain receptor/lipopolysaccharide-associated protein 3/neuropeptide Y receptor Y3/NPY3RWHIM/NPYR/NPYY3R/seven transmembrane helix receptor/seven-transmembrane-segment receptor, spleen/Stromal cell-derived factor 1 recepto |
| Human | EH2137 | Human AMY2 (Amylase Alpha 2, Pancreatic) | AMY2 | 96T | AMY2/Pancreatic alpha-amylase/1,4-alpha-D-glucan glucanohydrolase |
coresciences 코아사이언스 면역학 시약 키트 ELISA kit antibody 항체
'ELISA,항체,단백질' 카테고리의 다른 글
공지사항
최근에 올라온 글
최근에 달린 댓글
- Total
- Today
- Yesterday
링크
TAG
- 바이오하자드백
- 코아사이언스
- gradient gel
- 조직절편
- time release pellets
- 미니멸균백
- 조직염색절편제작
- material science
- 오토클레이브백
- matrix-driven delivery pellet
- OPV
- 연속절편
- Coresciences
- filter
- 조직절편제작
- allview PAGE buffer
- solar cells
- Sterlitech
- 건스터바이오텍
- OLED
- 면역화학분석
- 후나코시
- 바이오헤저드백
- 고수용성 콘드로이틴
- 막필터
- 파라핀 블럭
- 파라핀 블록
- 콘드로이틴 황산 올리고당
- 형광염색
- Funakoshi
| 일 | 월 | 화 | 수 | 목 | 금 | 토 |
|---|---|---|---|---|---|---|
| 1 | 2 | 3 | 4 | 5 | 6 | 7 |
| 8 | 9 | 10 | 11 | 12 | 13 | 14 |
| 15 | 16 | 17 | 18 | 19 | 20 | 21 |
| 22 | 23 | 24 | 25 | 26 | 27 | 28 |
| 29 | 30 |
글 보관함