Carboxyethylsilanetriol sodium salt - 25% in water [FC139273][CAS no. 18191-40-7]_Biosynth - 코아사이언스
Carboxyethylsilanetriol sodium salt - 25% in water
Cat.# FC139273 / Size: 5g, 10g, 25g, 50g, 100g
Carboxyethylsilanetriol sodium salt - 25% in water is a reagent that is used to form complex compounds. It can be used as a reaction component or a building block to create more complex compounds, such as new medicines. Carboxyethylsilanetriol sodium salt - 25% in water has been shown to be an efficient and versatile scaffold for the production of fine chemicals and research chemicals. CAS No. 18191-40-7 is a speciality chemical that can react with other organic compounds to form new compounds for research purposes. Carboxyethylsilanetriol sodium salt - 25% in water is a useful intermediate and building block for various synthetic reactions because it can easily react with other organics to form new compounds which are useful in pharmaceuticals, agrochemicals, and other industries.
CAS No: [18191-40-7]
Synonyms: Disodium 3-[dihydroxy(oxido)silyl]propanoate
MOL file: Download
Chemical Formula: C3H6Na2O5Si
Molecular Weight: 196.14 g/mol
Smiles: C(C[Si](O)(O)[O-])C(=O)[O-].[Na+].[Na+]
Density: 1.17 g/cm3
* 본 상품은 오직 연구용으로만 사용 가능합니다. 인체 및 제품화에 사용하실 수 없습니다.
코아사이언스 coresciences Biosynth Carbosynth limited UK Korea 한국 대리점